![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | 4653047_Re:what a business.html | 2002-11-12 02:22 | 107 | |
![[TXT]](/icons/text.gif) | 11085146_Let me be the first to say....html | 2004-12-14 03:53 | 123 | |
![[TXT]](/icons/text.gif) | 9789060_LOOK SCREEN.html | 2004-07-24 11:06 | 127 | |
![[TXT]](/icons/text.gif) | 10889007_Re:Threading on thin ice here.html | 2004-11-22 11:55 | 129 | |
![[TXT]](/icons/text.gif) | 9787419_Re:maturation of the software industry.html | 2004-07-23 12:55 | 133 | |
![[TXT]](/icons/text.gif) | 9914451_Re:Canary.html | 2004-08-05 01:42 | 136 | |
![[TXT]](/icons/text.gif) | 5786516_Re:For those having trouble playing it:.html | 2003-04-22 09:14 | 137 | |
![[TXT]](/icons/text.gif) | 5034259_Re:A quick analysis looking over it.html | 2003-01-07 01:46 | 139 | |
![[TXT]](/icons/text.gif) | 6156739_Re:Speaking of FUD.html | 2003-06-06 06:59 | 140 | |
![[TXT]](/icons/text.gif) | 11516920_Re:In hardware?.html | 2005-01-29 08:10 | 148 | |
![[TXT]](/icons/text.gif) | 10322853_Re:glut?.html | 2004-09-22 03:58 | 150 | |
![[TXT]](/icons/text.gif) | 11393023_Re:Off the top of my head, here you go.html | 2005-01-17 03:03 | 150 | |
![[TXT]](/icons/text.gif) | 8992558_Re:Finally....html | 2004-04-28 09:27 | 154 | |
![[TXT]](/icons/text.gif) | 11070557_Progress Quest.html | 2005-02-07 09:55 | 155 | |
![[TXT]](/icons/text.gif) | 4501389_Re:Why SCSI?.html | 2002-10-21 10:07 | 156 | |
![[TXT]](/icons/text.gif) | 9685035_Re:Probably still RH_Fedora....html | 2004-07-13 08:01 | 160 | |
![[TXT]](/icons/text.gif) | 4682882_Re:What keeps me on windows.html | 2002-11-13 09:20 | 161 | |
![[TXT]](/icons/text.gif) | 11313419_Re:Some of these predictions are -1 redundant.html | 2005-01-10 03:24 | 162 | |
![[TXT]](/icons/text.gif) | 5482584_Re:Loud-mouthed weasel!.html | 2003-03-11 11:58 | 163 | |
![[TXT]](/icons/text.gif) | 4550747_Re:NFS server performance.html | 2002-10-28 03:54 | 164 | |
![[TXT]](/icons/text.gif) | 5763634_Good Job Slashdot!.html | 2003-04-18 10:25 | 164 | |
![[TXT]](/icons/text.gif) | 9783934_Re:Don't vote Libertarian.html | 2004-07-23 04:05 | 164 | |
![[TXT]](/icons/text.gif) | 10380417_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:27 | 166 | |
![[TXT]](/icons/text.gif) | 4590326_Re:Vint Cerf says Gore was 'instrumental' too..html | 2002-11-01 04:47 | 168 | |
![[TXT]](/icons/text.gif) | 10370446_Re:18-35 #6 DRUG POLICY.html | 2004-09-28 12:06 | 168 | |
![[TXT]](/icons/text.gif) | 11068867_Re:Searching file content!.html | 2004-12-12 06:43 | 168 | |
![[TXT]](/icons/text.gif) | 10251880_Re:fakechroot.html | 2004-09-13 08:15 | 169 | |
![[TXT]](/icons/text.gif) | 10943746_Re:Whaa?.html | 2004-11-29 12:23 | 174 | |
![[TXT]](/icons/text.gif) | 4934383_Re:It is an oxymoron.html | 2002-12-20 11:00 | 175 | |
![[TXT]](/icons/text.gif) | 7191312_Re:Wasn't there a similar case with some Linux syn.html | 2003-10-11 03:57 | 175 | |
![[TXT]](/icons/text.gif) | 10222905_Re:Porting the whine...html | 2004-09-11 05:10 | 176 | |
![[TXT]](/icons/text.gif) | 11405189_Re:Storage.html | 2005-01-16 12:18 | 176 | |
![[TXT]](/icons/text.gif) | 9345876_Re:I've said this long ago....html | 2004-06-05 03:30 | 179 | |
![[TXT]](/icons/text.gif) | 10892675_Re:Interesting book but.html | 2004-11-17 05:45 | 179 | |
![[TXT]](/icons/text.gif) | 4942492_Re:exploit?.html | 2002-12-22 09:13 | 181 | |
![[TXT]](/icons/text.gif) | 11376923_Re:So useful for Windows OC'ers.html | 2005-01-15 10:30 | 181 | |
![[TXT]](/icons/text.gif) | 4688256_um, mod up plz.html | 2002-11-16 08:41 | 182 | |
![[TXT]](/icons/text.gif) | 9808425_Re:LOOK SCREEN.html | 2004-07-24 11:04 | 182 | |
![[TXT]](/icons/text.gif) | 10251890_My mother doesn't think so.html | 2004-09-14 08:18 | 182 | |
![[TXT]](/icons/text.gif) | 10453815_Re:Exchange ?.html | 2004-10-06 03:21 | 182 | |
![[TXT]](/icons/text.gif) | 10595368_Re:Reality.html | 2004-10-19 11:53 | 182 | |
![[TXT]](/icons/text.gif) | 11154132_Re:Fun Facts Time!.html | 2004-12-21 06:57 | 183 | |
![[TXT]](/icons/text.gif) | 5525581_Re:not gnu.html | 2003-03-16 06:48 | 184 | |
![[TXT]](/icons/text.gif) | 8435114_Re:Hello..html | 2004-03-01 07:01 | 185 | |
![[TXT]](/icons/text.gif) | 10223517_Re:To suggest this is almost criminally stupid.html | 2004-09-11 06:38 | 185 | |
![[TXT]](/icons/text.gif) | 9403088_Re:obligatory.html | 2004-06-08 05:56 | 189 | |
![[TXT]](/icons/text.gif) | 11154015_Re:IE?.html | 2004-12-21 06:45 | 189 | |
![[TXT]](/icons/text.gif) | 4565089_Re:Migrate.html | 2002-10-30 11:46 | 191 | |
![[TXT]](/icons/text.gif) | 8563620_Re:Fear Uncle Sam.html | 2004-03-14 04:55 | 191 | |
![[TXT]](/icons/text.gif) | 4678636_Re:DOS 6.2.html | 2002-11-14 01:19 | 192 | |
![[TXT]](/icons/text.gif) | 6896785_Mods on crack?.html | 2003-09-07 09:24 | 192 | |
![[TXT]](/icons/text.gif) | 9327908_Re:How about....html | 2004-06-03 01:07 | 193 | |
![[TXT]](/icons/text.gif) | 4457289_Re:Documentation.html | 2002-10-15 05:45 | 197 | |
![[TXT]](/icons/text.gif) | 4656671_Re:OpenGL 2.0.html | 2002-11-12 10:59 | 197 | |
![[TXT]](/icons/text.gif) | 9352397_Re:Lets see you do that for hundreds of systems.html | 2004-06-06 03:56 | 197 | |
![[TXT]](/icons/text.gif) | 4600870_MOD UP..html | 2002-11-05 02:09 | 198 | |
![[TXT]](/icons/text.gif) | 10454694_Re:register_globals = off.html | 2004-10-05 05:05 | 198 | |
![[TXT]](/icons/text.gif) | 4389849_Re:Historical perspective..html | 2002-10-04 03:53 | 199 | |
![[TXT]](/icons/text.gif) | 7822752_Re:Those Cobalt cubes were cute....html | 2003-12-28 02:24 | 199 | |
![[TXT]](/icons/text.gif) | 8149389_Re:Linux in cache?.html | 2004-01-31 02:56 | 199 | |
![[TXT]](/icons/text.gif) | 9750094_Re:Holy God ....html | 2004-07-19 11:09 | 199 | |
![[TXT]](/icons/text.gif) | 4555244_Re:Commodore One.html | 2002-10-28 09:05 | 200 | |
![[TXT]](/icons/text.gif) | 11498748_Re:MOD PARENT UP!!!.html | 2005-01-22 07:13 | 200 | |
![[TXT]](/icons/text.gif) | 4674848_Re:DOS 6.2.html | 2002-11-14 11:37 | 203 | |
![[TXT]](/icons/text.gif) | 4735132_Re:In all fairness to the switch ads.html | 2002-11-22 04:39 | 203 | |
![[TXT]](/icons/text.gif) | 9341556_Re:Still got my BeBox..html | 2004-06-04 08:10 | 203 | |
![[TXT]](/icons/text.gif) | 10321393_Re:glut?.html | 2004-09-22 01:58 | 203 | |
![[TXT]](/icons/text.gif) | 11239472_Re:Spooks and cracks.html | 2005-01-01 03:07 | 203 | |
![[TXT]](/icons/text.gif) | 11469482_Re:duh.html | 2005-01-25 11:42 | 203 | |
![[TXT]](/icons/text.gif) | 4653113_Re:Wrong Douche bags!.html | 2002-11-12 02:29 | 204 | |
![[TXT]](/icons/text.gif) | 9382767_Re:What else besides games?.html | 2004-06-09 06:29 | 204 | |
![[TXT]](/icons/text.gif) | 10873102_Re:Common knowledge?.html | 2004-11-16 02:12 | 205 | |
![[TXT]](/icons/text.gif) | 11376883_Re:So useful for Windows OC'ers.html | 2005-01-15 10:17 | 208 | |
![[TXT]](/icons/text.gif) | 8912055_Re:Notice....html | 2004-04-19 08:33 | 210 | |
![[TXT]](/icons/text.gif) | 5193565_Re:in case of slashdotting.html | 2003-01-31 09:56 | 211 | |
![[TXT]](/icons/text.gif) | 11118330_Re:Hello it's me again.html | 2004-12-17 01:47 | 211 | |
![[TXT]](/icons/text.gif) | 4390441_Re:Funny.html | 2002-10-04 05:10 | 212 | |
![[TXT]](/icons/text.gif) | 10825575_Re:dry joints.html | 2004-11-14 07:36 | 212 | |
![[TXT]](/icons/text.gif) | 8438350_Re:Are we turning into the Ferengi?.html | 2004-03-01 03:08 | 214 | |
![[TXT]](/icons/text.gif) | 9692002_Re:Probably still RH_Fedora....html | 2004-07-13 06:33 | 215 | |
![[TXT]](/icons/text.gif) | 5925301_Re:I wish I knew where I could find the MS fonts.html | 2003-05-09 07:29 | 216 | |
![[TXT]](/icons/text.gif) | 6712220_BSD.html | 2003-08-16 09:43 | 216 | |
![[TXT]](/icons/text.gif) | 4726884_Re:Microsoft's contribution.html | 2002-11-21 05:33 | 217 | |
![[TXT]](/icons/text.gif) | 8624277_Re:Oh no.html | 2004-03-21 08:52 | 217 | |
![[TXT]](/icons/text.gif) | 9332562_Re:How about....html | 2004-06-03 12:42 | 219 | |
![[TXT]](/icons/text.gif) | 11591927_Re:Read the WHOLE article..html | 2005-02-05 04:10 | 219 | |
![[TXT]](/icons/text.gif) | 5329693_Re:elitism....html | 2003-02-18 05:26 | 220 | |
![[TXT]](/icons/text.gif) | 10366586_Re:Why would this lure them away?.html | 2004-09-27 04:08 | 220 | |
![[TXT]](/icons/text.gif) | 10650167_Re:Progress.html | 2004-10-27 11:12 | 220 | |
![[TXT]](/icons/text.gif) | 10540068_Re:Both Amiga and OS_2?.html | 2004-10-15 04:28 | 221 | |
![[TXT]](/icons/text.gif) | 10866061_Re:Or better yet....html | 2004-11-19 01:04 | 221 | |
![[TXT]](/icons/text.gif) | 9762371_Re:Cue the Flash-bashers....html | 2004-07-20 02:04 | 222 | |
![[TXT]](/icons/text.gif) | 4740488_Re:Bill Cares?.html | 2002-11-23 07:01 | 224 | |
![[TXT]](/icons/text.gif) | 9854010_Re:Some thoughts....html | 2004-07-30 03:16 | 224 | |
![[TXT]](/icons/text.gif) | 10436901_Re:Needed... bad.html | 2004-10-05 12:26 | 224 | |
![[TXT]](/icons/text.gif) | 5925210_Re:I wish I.html | 2003-05-09 06:32 | 225 | |
![[TXT]](/icons/text.gif) | 10938535_Re:Waste of time.html | 2004-11-28 03:32 | 225 | |
![[TXT]](/icons/text.gif) | 8834641_Re:So...What's the point?.html | 2004-04-11 09:04 | 226 | |
![[TXT]](/icons/text.gif) | 9798224_Re:Think Cigarettes company brand Crack....html | 2004-07-25 10:36 | 226 | |
![[TXT]](/icons/text.gif) | 11314016_Re:same feeling with S-ATA.html | 2005-01-10 04:05 | 226 | |
![[TXT]](/icons/text.gif) | 5017040_Re:Okay who's with me?.html | 2003-01-04 09:25 | 227 | |
![[TXT]](/icons/text.gif) | 11482868_Re:duh.html | 2005-01-25 01:42 | 227 | |
![[TXT]](/icons/text.gif) | 8161988_Re:Anything NOT in Linux?.html | 2004-02-02 03:11 | 228 | |
![[TXT]](/icons/text.gif) | 10421452_Re:Guess who loses?.html | 2004-10-03 02:15 | 228 | |
![[TXT]](/icons/text.gif) | 11314074_Re:Many Things.html | 2005-01-10 04:10 | 229 | |
![[TXT]](/icons/text.gif) | 8961161_Re:This is a very bad trend.html | 2004-04-24 04:33 | 231 | |
![[TXT]](/icons/text.gif) | 7604596_Re:blah blah.html | 2003-12-01 07:18 | 232 | |
![[TXT]](/icons/text.gif) | 11095941_.gnu TLD.html | 2004-12-15 03:00 | 232 | |
![[TXT]](/icons/text.gif) | 11591046_JPEG-2000 is encumbered by patents.html | 2005-02-06 02:04 | 232 | |
![[TXT]](/icons/text.gif) | 10269721_Re:Perhaps is the user base of those versions?.html | 2004-09-16 02:28 | 233 | |
![[TXT]](/icons/text.gif) | 11068854_Re:Searching file content!.html | 2004-12-12 06:40 | 233 | |
![[TXT]](/icons/text.gif) | 10850305_Re:dry joints.html | 2004-11-14 11:28 | 234 | |
![[TXT]](/icons/text.gif) | 4983345_Re:preach to the choir.html | 2002-12-30 03:01 | 235 | |
![[TXT]](/icons/text.gif) | 10112670_Re:Longhorn.html | 2004-08-30 05:01 | 237 | |
![[TXT]](/icons/text.gif) | 9822941_Re:Future source code release..html | 2004-07-28 12:46 | 238 | |
![[TXT]](/icons/text.gif) | 4940309_Re:exploit?.html | 2002-12-22 10:21 | 239 | |
![[TXT]](/icons/text.gif) | 4983419_Re:Nitpick..html | 2002-12-30 03:12 | 239 | |
![[TXT]](/icons/text.gif) | 10222924_Re:Port the IE rendering engine.html | 2004-09-11 05:12 | 239 | |
![[TXT]](/icons/text.gif) | 4495890_Re:Not Version Bloat..html | 2002-10-21 10:44 | 240 | |
![[TXT]](/icons/text.gif) | 4605080_Re:Transmeta needs to give up.html | 2002-11-05 10:32 | 240 | |
![[TXT]](/icons/text.gif) | 10241713_Re:Regulation.html | 2004-09-13 07:02 | 240 | |
![[TXT]](/icons/text.gif) | 4816831_Re:SCSI for workstations?.html | 2002-12-04 01:43 | 241 | |
![[TXT]](/icons/text.gif) | 9403108_Re:obligatory.html | 2004-06-08 05:59 | 241 | |
![[TXT]](/icons/text.gif) | 9692022_Re:Probably still RH_Fedora....html | 2004-07-13 06:36 | 241 | |
![[TXT]](/icons/text.gif) | 10164127_Re:My part to end this foolishness.html | 2004-09-05 03:37 | 241 | |
![[TXT]](/icons/text.gif) | 10273165_Re:Yeah, I was worried too....html | 2004-09-16 08:05 | 241 | |
![[TXT]](/icons/text.gif) | 11096289_Re:it's easy to speed up boot.html | 2004-12-15 03:27 | 241 | |
![[TXT]](/icons/text.gif) | 4653016_Re:Security??.html | 2002-11-12 02:20 | 242 | |
![[TXT]](/icons/text.gif) | 4713319_Re:Their rules.html | 2002-11-19 12:25 | 242 | |
![[TXT]](/icons/text.gif) | 4729356_Re:Have they not seen Wierd Science.html | 2002-11-21 11:12 | 242 | |
![[TXT]](/icons/text.gif) | 5221324_Re:Free BSD Dying.html | 2003-02-03 02:49 | 242 | |
![[TXT]](/icons/text.gif) | 4576577_Re:pet peeve, don't call us, we'll call you.html | 2002-10-31 12:28 | 244 | |
![[TXT]](/icons/text.gif) | 9092025_Answer.html | 2004-05-08 02:02 | 245 | |
![[TXT]](/icons/text.gif) | 4726117_Re:Have they not seen Wierd Science.html | 2002-11-21 04:15 | 248 | |
![[TXT]](/icons/text.gif) | 8507775_Re:Who actually pays?.html | 2004-03-09 03:05 | 248 | |
![[TXT]](/icons/text.gif) | 9373310_Re:Using the right tool for the job.html | 2004-06-08 09:13 | 248 | |
![[TXT]](/icons/text.gif) | 10595266_Re:How about a Free Software Friendly Audio Card?.html | 2004-10-22 11:33 | 248 | |
![[TXT]](/icons/text.gif) | 11498536_Re:correlational!.html | 2005-01-23 06:52 | 248 | |
![[TXT]](/icons/text.gif) | 4438468_Re:WINE.html | 2002-10-12 05:39 | 249 | |
![[TXT]](/icons/text.gif) | 8728397_Re:Backups are legit for some of us....html | 2004-03-31 03:00 | 249 | |
![[TXT]](/icons/text.gif) | 10134195_Re:Other good Options.html | 2005-02-07 10:07 | 249 | |
![[TXT]](/icons/text.gif) | 10428701_Re:How is software really different?.html | 2004-10-03 09:27 | 249 | |
![[TXT]](/icons/text.gif) | 10903626_Re:Please don't make them require root access..html | 2004-11-23 05:03 | 250 | |
![[TXT]](/icons/text.gif) | 4653189_Re:Welcome to System Administration 101.html | 2002-11-12 02:37 | 251 | |
![[TXT]](/icons/text.gif) | 4955860_Re:One man's fragmentation is another's variety ..html | 2002-12-20 12:07 | 251 | |
![[TXT]](/icons/text.gif) | 9755946_Re:Cue the Flash-bashers....html | 2004-07-20 09:24 | 251 | |
![[TXT]](/icons/text.gif) | 4656077_Re:OpenGL 2.0.html | 2002-11-12 09:04 | 252 | |
![[TXT]](/icons/text.gif) | 11089093_Re:VHDL + FPGA.html | 2004-12-14 09:16 | 252 | |
![[TXT]](/icons/text.gif) | 5732155_Re:Can you say 'Ford Pinto'? I knew you could!.html | 2003-04-14 06:32 | 255 | |
![[TXT]](/icons/text.gif) | 8934521_Re:GPL?.html | 2004-04-19 06:14 | 255 | |
![[TXT]](/icons/text.gif) | 11241931_Re:ET runs well.html | 2005-01-02 11:41 | 256 | |
![[TXT]](/icons/text.gif) | 4389560_Re:Sigh..html | 2002-10-04 03:22 | 257 | |
![[TXT]](/icons/text.gif) | 10302319_Re:Darn....html | 2004-09-20 05:16 | 257 | |
![[TXT]](/icons/text.gif) | 10242342_Re:I want the opposite!.html | 2004-09-13 08:23 | 258 | |
![[TXT]](/icons/text.gif) | 11085216_Re:I don't think so.html | 2004-12-14 03:57 | 258 | |
![[TXT]](/icons/text.gif) | 4746398_Re:And while you're so hot about the movie....html | 2002-11-24 06:25 | 259 | |
![[TXT]](/icons/text.gif) | 8399400_Re:Criminal tools like "diff"?.html | 2004-02-26 01:09 | 259 | |
![[TXT]](/icons/text.gif) | 8980710_Re:Interesting.html | 2004-04-26 12:42 | 259 | |
![[TXT]](/icons/text.gif) | 9891341_Re:Canary.html | 2004-08-05 01:08 | 259 | |
![[TXT]](/icons/text.gif) | 10277137_Re:MS stands behind its products?.html | 2004-09-17 10:58 | 259 | |
![[TXT]](/icons/text.gif) | 4855221_A free interview?.html | 2002-12-10 12:03 | 261 | |
![[TXT]](/icons/text.gif) | 5017536_Re:Moral?.html | 2003-01-03 11:05 | 261 | |
![[TXT]](/icons/text.gif) | 5112381_Re:And compromise compatibility with drivers, etc.html | 2003-01-19 04:57 | 261 | |
![[TXT]](/icons/text.gif) | 4454895_Re:Bullshit technology.html | 2002-10-15 12:58 | 262 | |
![[TXT]](/icons/text.gif) | 4502996_Re:rejection ?.html | 2002-10-22 06:58 | 262 | |
![[TXT]](/icons/text.gif) | 4796496_Water-cool your PC.....html | 2002-12-02 04:29 | 264 | |
![[TXT]](/icons/text.gif) | 9383776_Re:Using the right tool for the job.html | 2004-06-08 09:47 | 264 | |
![[TXT]](/icons/text.gif) | 10567848_Re:Reality Distortion Fields ON!.html | 2004-10-19 01:50 | 264 | |
![[TXT]](/icons/text.gif) | 11099231_Re:it's easy to speed up boot.html | 2004-12-15 08:23 | 264 | |
![[TXT]](/icons/text.gif) | 4599771_Re:PDF = open format, won't go away.html | 2002-11-04 11:10 | 265 | |
![[TXT]](/icons/text.gif) | 4729325_Re:Violating Service Contracts?.html | 2002-11-22 11:05 | 265 | |
![[TXT]](/icons/text.gif) | 11381398_Re: What?.html | 2005-01-13 06:28 | 266 | |
![[TXT]](/icons/text.gif) | 8381099_Re:can x86-64 do big endian?.html | 2004-02-24 08:50 | 268 | |
![[TXT]](/icons/text.gif) | 10892693_Re:My guess.html | 2004-11-17 05:48 | 268 | |
![[TXT]](/icons/text.gif) | 4468599_Re:The ACLU Sucks!.html | 2002-10-17 08:31 | 269 | |
![[TXT]](/icons/text.gif) | 10242122_Re:I want the opposite!.html | 2004-09-13 07:49 | 269 | |
![[TXT]](/icons/text.gif) | 4555129_Re:Apple ][ Forever !.html | 2002-10-28 08:46 | 271 | |
![[TXT]](/icons/text.gif) | 4760986_Re:I hate it.html | 2002-11-25 02:21 | 271 | |
![[TXT]](/icons/text.gif) | 5767432_Re:....what the hell......html | 2003-04-18 11:36 | 272 | |
![[TXT]](/icons/text.gif) | 4688285_Re:Some useful RE links....html | 2002-11-16 08:49 | 276 | |
![[TXT]](/icons/text.gif) | 5234059_Re:And how do you flash a BIOS without a floppy?.html | 2003-02-05 03:35 | 276 | |
![[TXT]](/icons/text.gif) | 11331797_Re:WMP-out.html | 2005-01-11 01:03 | 277 | |
![[TXT]](/icons/text.gif) | 10712094_Re:Open Cores?.html | 2004-11-03 12:07 | 278 | |
![[TXT]](/icons/text.gif) | 6329313_Re:Installer.html | 2003-06-29 05:00 | 279 | |
![[TXT]](/icons/text.gif) | 7538237_Re:One cool thing in the roadmap....html | 2003-11-22 04:48 | 279 | |
![[TXT]](/icons/text.gif) | 10556211_Re:Sweet! Bring it on back =).html | 2004-10-18 09:53 | 279 | |
![[TXT]](/icons/text.gif) | 4792111_Re:Good intentions, but....html | 2002-12-01 05:28 | 280 | |
![[TXT]](/icons/text.gif) | 8149364_Re:Linux in cache?.html | 2004-01-31 02:51 | 280 | |
![[TXT]](/icons/text.gif) | 9837685_Re:Home Run.html | 2004-07-29 05:18 | 280 | |
![[TXT]](/icons/text.gif) | 10421397_Re:So is alcohol.html | 2004-10-03 02:07 | 282 | |
![[TXT]](/icons/text.gif) | 10123566_Hits from what?.html | 2004-08-31 05:55 | 283 | |
![[TXT]](/icons/text.gif) | 4618298_Re:Missing a point.html | 2002-11-07 01:33 | 284 | |
![[TXT]](/icons/text.gif) | 10566302_Re:Reality Distortion Fields ON!.html | 2004-10-19 11:22 | 285 | |
![[TXT]](/icons/text.gif) | 11196428_Re:This quote sums it up.html | 2004-12-27 09:05 | 285 | |
![[TXT]](/icons/text.gif) | 5585550_Re:I fail to see what the big deal is....html | 2003-03-24 03:39 | 286 | |
![[TXT]](/icons/text.gif) | 9602730_Re:like there is any chance this WON'T happen.html | 2004-07-03 06:47 | 286 | |
![[TXT]](/icons/text.gif) | 6483651_Re:Can someone explain what these programs DO?.html | 2003-07-19 08:23 | 287 | |
![[TXT]](/icons/text.gif) | 7704999_Re:On warnings.html | 2003-12-12 03:41 | 287 | |
![[TXT]](/icons/text.gif) | 8683695_Re:There were better GUIs.html | 2004-03-26 03:41 | 288 | |
![[TXT]](/icons/text.gif) | 11534902_Re:What a frackin' idiot.html | 2005-01-31 07:07 | 288 | |
![[TXT]](/icons/text.gif) | 11383307_Re:Tux Racer.html | 2005-01-16 01:19 | 290 | |
![[TXT]](/icons/text.gif) | 6270317_Re:No new CDs.html | 2003-06-22 08:22 | 291 | |
![[TXT]](/icons/text.gif) | 4538058_Re:Another troll article!.html | 2002-10-26 03:34 | 293 | |
![[TXT]](/icons/text.gif) | 9798193_Re:A Clockwork Orange.html | 2004-07-25 10:30 | 296 | |
![[TXT]](/icons/text.gif) | 10959697_Re:this will totally crush BSD.html | 2004-11-30 09:40 | 296 | |
![[TXT]](/icons/text.gif) | 10058013_Re:DirectX.html | 2004-08-24 12:02 | 299 | |
![[TXT]](/icons/text.gif) | 5017110_Re:Bolixed..html | 2003-01-04 09:42 | 301 | |
![[TXT]](/icons/text.gif) | 10444645_Re:Why not use SDL?.html | 2004-10-05 04:19 | 301 | |
![[TXT]](/icons/text.gif) | 9865403_Re:Sure.html | 2004-08-02 05:40 | 302 | |
![[TXT]](/icons/text.gif) | 10618652_Re:We knew this day would come.html | 2004-10-24 01:59 | 302 | |
![[TXT]](/icons/text.gif) | 5109499_Re:Repost.html | 2003-01-18 04:49 | 303 | |
![[TXT]](/icons/text.gif) | 10104007_heh.html | 2004-08-29 02:57 | 303 | |
![[TXT]](/icons/text.gif) | 11591908_Re:runs on old and rare archs.html | 2005-02-05 04:07 | 303 | |
![[TXT]](/icons/text.gif) | 10766836_Re:frist?.html | 2004-11-09 11:50 | 304 | |
![[TXT]](/icons/text.gif) | 10816212_Re:What's wrong with freezing a drive?.html | 2004-11-14 07:50 | 304 | |
![[TXT]](/icons/text.gif) | 11085741_Re:Who comes up with these ideas.html | 2004-12-14 04:31 | 304 | |
![[TXT]](/icons/text.gif) | 11026079_Re:Evolution.html | 2004-12-07 06:53 | 305 | |
![[TXT]](/icons/text.gif) | 11530134_Re:And another idiot.html | 2005-01-31 01:02 | 305 | |
![[TXT]](/icons/text.gif) | 9703849_Re:Probably still RH_Fedora....html | 2004-07-13 10:21 | 306 | |
![[TXT]](/icons/text.gif) | 7544254_Re:My first debian.html | 2003-11-23 06:40 | 307 | |
![[TXT]](/icons/text.gif) | 9171289_Re:License.html | 2004-05-16 02:06 | 307 | |
![[TXT]](/icons/text.gif) | 9363638_Re:Been said before, will be said again:.html | 2004-06-08 03:04 | 307 | |
![[TXT]](/icons/text.gif) | 10910809_Re:In other news....html | 2004-11-24 01:21 | 307 | |
![[TXT]](/icons/text.gif) | 11134135_Re:It's a major issue..html | 2004-12-18 09:16 | 307 | |
![[TXT]](/icons/text.gif) | 10761391_Re:Sometimes you gotta take a look around..html | 2004-11-07 07:33 | 308 | |
![[TXT]](/icons/text.gif) | 11593240_Re:Read the WHOLE article..html | 2005-02-05 08:09 | 308 | |
![[TXT]](/icons/text.gif) | 6817765_Re:Good idea.html | 2003-08-28 03:24 | 309 | |
![[TXT]](/icons/text.gif) | 10516719_Re:Because we have a TWO PARTY SYSTEM.html | 2004-10-13 03:01 | 313 | |
![[TXT]](/icons/text.gif) | 8434154_Re:So you want MORE coercion through force....html | 2004-03-01 05:05 | 315 | |
![[TXT]](/icons/text.gif) | 9091640_Hah.html | 2004-05-07 11:44 | 316 | |
![[TXT]](/icons/text.gif) | 10301580_Code.html | 2004-09-20 04:10 | 316 | |
![[TXT]](/icons/text.gif) | 8381442_I'm all for this.html | 2004-02-24 09:23 | 317 | |
![[TXT]](/icons/text.gif) | 5787443_Re:What about Transgaming.html | 2003-04-22 01:31 | 318 | |
![[TXT]](/icons/text.gif) | 10802274_Re:No version 2?.html | 2004-11-12 04:34 | 318 | |
![[TXT]](/icons/text.gif) | 8255858_Re:PC Demo?.html | 2004-02-11 01:13 | 319 | |
![[TXT]](/icons/text.gif) | 6316296_Re:gnomemeeting? (warning - kinda long).html | 2003-06-27 07:46 | 320 | |
![[TXT]](/icons/text.gif) | 9211872_Re:Microsoft really pisses me off.html | 2004-05-19 11:36 | 320 | |
![[TXT]](/icons/text.gif) | 11110552_Re:Deja Voodoo.html | 2004-12-16 06:28 | 320 | |
![[TXT]](/icons/text.gif) | 11591422_Re:The problem with windows is.html | 2005-02-05 03:00 | 320 | |
![[TXT]](/icons/text.gif) | 11074627_Re:I miss SGI.html | 2004-12-13 02:24 | 322 | |
![[TXT]](/icons/text.gif) | 4557889_Re:And all of you running PPC or Alpha Linux.html | 2002-10-29 02:21 | 323 | |
![[TXT]](/icons/text.gif) | 5908606_Re:Release date.html | 2003-05-07 03:15 | 323 | |
![[TXT]](/icons/text.gif) | 6661245_Re:Apple II graphics were different.html | 2003-08-10 04:26 | 323 | |
![[TXT]](/icons/text.gif) | 11329218_Re:Sleep Apnea (OSA).html | 2005-01-11 07:55 | 323 | |
![[TXT]](/icons/text.gif) | 4626486_Re:Skinning == crap!.html | 2002-11-08 12:56 | 324 | |
![[TXT]](/icons/text.gif) | 8524850_Re:Sometimes they do....html | 2004-03-10 03:57 | 324 | |
![[TXT]](/icons/text.gif) | 9206135_Re:I really don't see.html | 2004-05-20 12:38 | 326 | |
![[TXT]](/icons/text.gif) | 8435135_Re:Hello..html | 2004-03-01 07:03 | 327 | |
![[TXT]](/icons/text.gif) | 11530168_Re:Matrox?.html | 2005-01-31 01:04 | 327 | |
![[TXT]](/icons/text.gif) | 5883404_Re:How retarded.html | 2003-05-05 12:42 | 328 | |
![[TXT]](/icons/text.gif) | 7564695_Um.....html | 2003-11-25 08:45 | 328 | |
![[TXT]](/icons/text.gif) | 4652954_Re:Could work.html | 2002-11-12 02:15 | 329 | |
![[TXT]](/icons/text.gif) | 9383761_Re:Oh, the irony..html | 2004-06-08 09:44 | 329 | |
![[TXT]](/icons/text.gif) | 10998333_Re:Dow-chem chairman Warren Anderson.html | 2004-12-03 05:50 | 330 | |
![[TXT]](/icons/text.gif) | 11313348_Re:What does this tell you about Stallman's crusad.html | 2005-01-10 03:18 | 331 | |
![[TXT]](/icons/text.gif) | 11577684_Re:Common sense, for the love of Pete....html | 2005-02-04 05:51 | 331 | |
![[TXT]](/icons/text.gif) | 4466016_Re:Illegal?.html | 2002-10-16 08:00 | 332 | |
![[TXT]](/icons/text.gif) | 11330858_Re:Do we really need....html | 2005-01-11 10:45 | 332 | |
![[TXT]](/icons/text.gif) | 9213207_Re:PF and ALTQ.html | 2004-05-17 04:45 | 333 | |
![[TXT]](/icons/text.gif) | 9236446_Re:FLAC?.html | 2004-05-24 07:07 | 333 | |
![[TXT]](/icons/text.gif) | 4555092_Re:Grass Roots Movement.html | 2002-10-28 08:38 | 336 | |
![[TXT]](/icons/text.gif) | 8162572_Re:Anything NOT in Linux?.html | 2004-02-02 03:54 | 336 | |
![[TXT]](/icons/text.gif) | 4652859_Re:Fujitsu Drives - Bad for some time.html | 2002-11-12 02:05 | 338 | |
![[TXT]](/icons/text.gif) | 5130183_Re:Anyone else see the note at the top of the patc.html | 2003-01-21 05:24 | 339 | |
![[TXT]](/icons/text.gif) | 7642267_Re:AMD blows.html | 2003-12-05 04:10 | 339 | |
![[TXT]](/icons/text.gif) | 11577651_Re:Common sense, for the love of Pete....html | 2005-02-04 05:48 | 340 | |
![[TXT]](/icons/text.gif) | 10238213_Re:Federal Regulators..html | 2004-09-13 01:34 | 341 | |
![[TXT]](/icons/text.gif) | 10377576_Re:Congrats, but be wary of monocultures....html | 2004-09-28 03:54 | 341 | |
![[TXT]](/icons/text.gif) | 9368312_Re:Did you read the story?.html | 2004-06-08 12:56 | 342 | |
![[TXT]](/icons/text.gif) | 10273179_Re:Somebody is busy ....html | 2004-09-16 08:07 | 342 | |
![[TXT]](/icons/text.gif) | 9337920_Re:Still got my BeBox..html | 2004-06-04 02:05 | 343 | |
![[TXT]](/icons/text.gif) | 4600713_Re:Distribution Method.html | 2002-11-05 01:51 | 345 | |
![[TXT]](/icons/text.gif) | 10406321_Re:what my party should be?.html | 2004-10-01 12:37 | 345 | |
![[TXT]](/icons/text.gif) | 11332067_Re:and still no ATI AIW support.html | 2005-01-12 01:47 | 345 | |
![[TXT]](/icons/text.gif) | 6339295_Re:and if you act now.....html | 2003-07-01 10:11 | 346 | |
![[TXT]](/icons/text.gif) | 11534684_Re:Matrox?.html | 2005-01-31 06:48 | 346 | |
![[TXT]](/icons/text.gif) | 9892745_Re:Sure.html | 2004-08-02 02:51 | 347 | |
![[TXT]](/icons/text.gif) | 10313188_Re:Darn....html | 2004-09-20 04:35 | 348 | |
![[TXT]](/icons/text.gif) | 11134507_Re:I don't think so.html | 2004-12-14 10:18 | 348 | |
![[TXT]](/icons/text.gif) | 4703327_Re:Crazy World.html | 2002-11-18 10:09 | 349 | |
![[TXT]](/icons/text.gif) | 5786916_Re:Even though the other dude is sort of trolling.html | 2003-04-22 10:38 | 349 | |
![[TXT]](/icons/text.gif) | 10507289_Re:CherryOS's speed claims, at least, are fraudule.html | 2004-10-12 03:52 | 351 | |
![[TXT]](/icons/text.gif) | 10390488_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 09:15 | 352 | |
![[TXT]](/icons/text.gif) | 11435341_Re:I read the FA.html | 2005-01-17 03:23 | 353 | |
![[TXT]](/icons/text.gif) | 9332430_Re:massively offtopic, but important.html | 2004-06-04 12:03 | 354 | |
![[TXT]](/icons/text.gif) | 10960312_Re:I'm not sure how I feel about.html | 2004-11-27 11:32 | 354 | |
![[TXT]](/icons/text.gif) | 4940245_exploit?.html | 2002-12-22 09:57 | 355 | |
![[TXT]](/icons/text.gif) | 4965785_Re:Legislation isn't needed!.html | 2002-12-25 09:12 | 355 | |
![[TXT]](/icons/text.gif) | 6344667_Re:He is correct.html | 2003-07-01 06:30 | 356 | |
![[TXT]](/icons/text.gif) | 5252256_Re:GNU's take on Licenses.html | 2003-02-07 01:53 | 357 | |
![[TXT]](/icons/text.gif) | 7524146_Re:I think....html | 2003-11-20 05:59 | 357 | |
![[TXT]](/icons/text.gif) | 8728349_Re:Go with your gut feeling.html | 2004-03-31 02:57 | 357 | |
![[TXT]](/icons/text.gif) | 5318235_Re:GNU's take on Licenses.html | 2003-02-07 05:30 | 361 | |
![[TXT]](/icons/text.gif) | 7312656_Re:C64.html | 2003-10-26 03:06 | 361 | |
![[TXT]](/icons/text.gif) | 10954572_Re:Breaks Gentoo as a learning tool.html | 2004-11-30 01:21 | 361 | |
![[TXT]](/icons/text.gif) | 11196176_Re:This may not be that bad....html | 2004-12-27 08:23 | 361 | |
![[TXT]](/icons/text.gif) | 7253145_Re:Very interesting comment about GNU libc.html | 2003-10-19 06:14 | 362 | |
![[TXT]](/icons/text.gif) | 9750051_Re:That's beside the point.html | 2004-07-19 11:05 | 362 | |
![[TXT]](/icons/text.gif) | 9762805_Re:fair and balanced?.html | 2004-07-21 02:38 | 362 | |
![[TXT]](/icons/text.gif) | 10369842_Re:18-35 #6 DRUG POLICY.html | 2004-09-28 10:44 | 363 | |
![[TXT]](/icons/text.gif) | 4523897_Re:a worse example.html | 2002-10-24 01:18 | 366 | |
![[TXT]](/icons/text.gif) | 8881197_Re:Sadly....html | 2004-04-16 10:15 | 368 | |
![[TXT]](/icons/text.gif) | 10193730_Penny Arcade said it best....html | 2004-09-08 03:03 | 371 | |
![[TXT]](/icons/text.gif) | 5565457_Re:Inaccuracies.html | 2003-03-20 11:24 | 372 | |
![[TXT]](/icons/text.gif) | 9236935_Re:FLAC?.html | 2004-05-24 08:18 | 372 | |
![[TXT]](/icons/text.gif) | 9749868_Re:Cheapest way to play Doom 3.html | 2004-07-20 10:52 | 372 | |
![[TXT]](/icons/text.gif) | 11593208_Re:my (not so) offtopic dream.html | 2005-02-06 08:04 | 372 | |
![[TXT]](/icons/text.gif) | 4454868_Here we go again....html | 2002-10-15 12:55 | 374 | |
![[TXT]](/icons/text.gif) | 9393460_Re:Easy to Find Out.html | 2004-06-10 06:44 | 374 | |
![[TXT]](/icons/text.gif) | 4519988_Re:Argh..html | 2002-10-23 02:27 | 375 | |
![[TXT]](/icons/text.gif) | 9900019_Re:The biggest problem Linux currently has.html | 2004-08-05 11:34 | 376 | |
![[TXT]](/icons/text.gif) | 4682706_Re:I'm a Lightwave dude....html | 2002-11-13 08:49 | 377 | |
![[TXT]](/icons/text.gif) | 4500405_Re:Why SCSI?.html | 2002-10-21 07:04 | 378 | |
![[TXT]](/icons/text.gif) | 4555144_Re:Commodore 64 drives?.html | 2002-10-28 08:49 | 378 | |
![[TXT]](/icons/text.gif) | 4687907_Re:X has kept me away from Linux.html | 2002-11-13 07:22 | 378 | |
![[TXT]](/icons/text.gif) | 6388412_Re:README:.html | 2003-07-06 10:16 | 379 | |
![[TXT]](/icons/text.gif) | 8096563_Re:Hmm.html | 2004-01-27 10:43 | 379 | |
![[TXT]](/icons/text.gif) | 11577962_Re:FBI raids themselves.html | 2005-02-04 06:14 | 379 | |
![[TXT]](/icons/text.gif) | 9762836_Re:Attack of the Weak Analogies.html | 2004-07-21 02:41 | 380 | |
![[TXT]](/icons/text.gif) | 4494829_Re:SCSI.html | 2002-10-21 08:46 | 381 | |
![[TXT]](/icons/text.gif) | 9620948_Re:I will never shop Best Buy, and here is why....html | 2004-07-06 09:06 | 381 | |
![[TXT]](/icons/text.gif) | 11383399_Re:Storage.html | 2005-01-16 01:53 | 381 | |
![[TXT]](/icons/text.gif) | 9383145_Re:Hmmm.html | 2004-06-09 07:29 | 382 | |
![[TXT]](/icons/text.gif) | 5878184_Re:GCC and glibc are the most important parts.html | 2003-05-03 08:49 | 383 | |
![[TXT]](/icons/text.gif) | 4956506_Re:More MS bashing for fark's sake?!.html | 2002-12-24 06:30 | 384 | |
![[TXT]](/icons/text.gif) | 6386826_Re:They were lucky....html | 2003-07-02 05:50 | 385 | |
![[TXT]](/icons/text.gif) | 7798258_Re:Good job NVIDIA.html | 2003-12-23 04:41 | 385 | |
![[TXT]](/icons/text.gif) | 8328999_Re:Hard drives and mainframe manufacturers.html | 2004-02-18 01:26 | 385 | |
![[TXT]](/icons/text.gif) | 10386321_Re:What's wrong?.html | 2004-09-29 01:54 | 385 | |
![[TXT]](/icons/text.gif) | 11009485_Re:NASA has little time (and money).html | 2004-12-06 02:10 | 385 | |
![[TXT]](/icons/text.gif) | 5110264_Re:Repost.html | 2003-01-18 06:59 | 389 | |
![[TXT]](/icons/text.gif) | 9914523_Re:Screenshots.html | 2004-08-08 01:53 | 390 | |
![[TXT]](/icons/text.gif) | 4555188_Re:Better sooner than later.html | 2002-10-28 08:55 | 392 | |
![[TXT]](/icons/text.gif) | 4713335_Re:Wow.html | 2002-11-19 12:29 | 392 | |
![[TXT]](/icons/text.gif) | 6315976_Re:To Be Fair.html | 2003-06-27 06:57 | 393 | |
![[TXT]](/icons/text.gif) | 6012837_Re:Touchy subject.html | 2003-05-20 09:50 | 395 | |
![[TXT]](/icons/text.gif) | 8460965_Re:IPR isnt a.html | 2004-03-01 02:32 | 395 | |
![[TXT]](/icons/text.gif) | 4872756_Re:IN COMMUNIST CHINA.html | 2002-12-11 01:16 | 396 | |
![[TXT]](/icons/text.gif) | 10932777_Re:I'm not sure how I feel about this.html | 2004-11-27 03:34 | 397 | |
![[TXT]](/icons/text.gif) | 4688295_Re:You have to admit that this is hard.html | 2002-11-16 08:53 | 398 | |
![[TXT]](/icons/text.gif) | 8329577_Re:I can't wait....html | 2004-02-19 01:59 | 398 | |
![[TXT]](/icons/text.gif) | 5016804_Re:It is not supposed to work that way.html | 2003-01-04 08:31 | 399 | |
![[TXT]](/icons/text.gif) | 11314109_Replace PAM.html | 2005-01-10 04:13 | 400 | |
![[TXT]](/icons/text.gif) | 4543536_Re:Contributions should be illegal.html | 2002-10-27 05:22 | 401 | |
![[TXT]](/icons/text.gif) | 8452646_Re:Gonna go buy.html | 2004-03-03 11:27 | 401 | |
![[TXT]](/icons/text.gif) | 4474554_Re:The ACLU Sucks!.html | 2002-10-17 06:48 | 402 | |
![[TXT]](/icons/text.gif) | 5303748_Re:Wouldn't it be nice...?.html | 2003-02-14 01:27 | 402 | |
![[TXT]](/icons/text.gif) | 4458292_Re:What's in it for consumers?.html | 2002-10-15 08:23 | 403 | |
![[TXT]](/icons/text.gif) | 4858377_Re:*Sigh*.html | 2002-12-10 05:58 | 403 | |
![[TXT]](/icons/text.gif) | 7449044_Re:Force change, not reform..html | 2003-11-11 06:24 | 404 | |
![[TXT]](/icons/text.gif) | 11381429_Re:You should listen to him....html | 2005-01-14 06:33 | 404 | |
![[TXT]](/icons/text.gif) | 4626895_Re:I use Dualhead in X.html | 2002-11-07 01:42 | 405 | |
![[TXT]](/icons/text.gif) | 10947875_Re:in other words: why open source software's ille.html | 2004-11-29 06:25 | 405 | |
![[TXT]](/icons/text.gif) | 8442977_Re:Tell me -.html | 2004-02-19 01:53 | 406 | |
![[TXT]](/icons/text.gif) | 6350444_Re:The M.html | 2003-07-02 11:11 | 407 | |
![[TXT]](/icons/text.gif) | 10755870_Re:Sometimes you gotta take a look around..html | 2004-11-07 12:14 | 407 | |
![[TXT]](/icons/text.gif) | 11383465_Re:You should listen to him....html | 2005-01-14 02:16 | 407 | |
![[TXT]](/icons/text.gif) | 4674268_Re:EFF Endored Legislation?.html | 2002-11-13 09:32 | 409 | |
![[TXT]](/icons/text.gif) | 7961978_Re:Weak? Not tested in court?.html | 2004-01-12 08:58 | 411 | |
![[TXT]](/icons/text.gif) | 8523146_Re:No No!.html | 2004-03-10 01:25 | 412 | |
![[TXT]](/icons/text.gif) | 8945545_Re:Free, but not automatic.html | 2004-04-22 07:48 | 412 | |
![[TXT]](/icons/text.gif) | 5329849_Re:attitude?.html | 2003-02-17 05:40 | 414 | |
![[TXT]](/icons/text.gif) | 10635916_De-allegizing existing cats?.html | 2004-10-26 05:14 | 416 | |
![[TXT]](/icons/text.gif) | 5858901_Re:Pronounciation.html | 2003-05-01 08:40 | 419 | |
![[TXT]](/icons/text.gif) | 11514588_Re:Ho-hum.html | 2005-01-29 01:49 | 420 | |
![[TXT]](/icons/text.gif) | 11331889_Re:competition is good, usually.html | 2005-01-11 01:22 | 421 | |
![[TXT]](/icons/text.gif) | 10182584_Re:Patents and Copyright.html | 2004-09-07 04:50 | 423 | |
![[TXT]](/icons/text.gif) | 4761511_Re:Explorer?.html | 2002-11-25 03:08 | 425 | |
![[TXT]](/icons/text.gif) | 5571874_Re:XFree Obsolete?.html | 2003-03-21 09:50 | 426 | |
![[TXT]](/icons/text.gif) | 10688565_Re:Merkey's effect on Linux NTFS support.html | 2004-11-01 01:20 | 428 | |
![[TXT]](/icons/text.gif) | 4599595_Re:Not a big deal for Microsoft.html | 2002-11-05 10:43 | 430 | |
![[TXT]](/icons/text.gif) | 10443964_Re:Biggest problem with Unix.html | 2004-10-05 03:23 | 430 | |
![[TXT]](/icons/text.gif) | 11379732_Re:You should listen to him....html | 2005-01-14 01:55 | 430 | |
![[TXT]](/icons/text.gif) | 10595251_Re:Secrets.html | 2004-10-22 11:31 | 431 | |
![[TXT]](/icons/text.gif) | 5500475_Re:Two points...html | 2003-03-12 11:18 | 433 | |
![[TXT]](/icons/text.gif) | 7808907_Re:Two options.html | 2003-12-25 02:11 | 433 | |
![[TXT]](/icons/text.gif) | 6339350_Re:Good reference, but 'copyleft' isn't more 'free.html | 2003-07-01 10:18 | 435 | |
![[TXT]](/icons/text.gif) | 11332088_Re:Uhh....html | 2005-01-12 01:50 | 435 | |
![[TXT]](/icons/text.gif) | 10903656_Re:Whoa - "perfectly"? I think not..html | 2004-11-23 05:07 | 436 | |
![[TXT]](/icons/text.gif) | 5878159_Re:what a stupid flame..html | 2003-05-03 08:44 | 439 | |
![[TXT]](/icons/text.gif) | 4870926_IN COMMUNIST CHINA.html | 2002-12-11 10:14 | 440 | |
![[TXT]](/icons/text.gif) | 10889060_Re:Just to play devils advocate.html | 2004-11-22 11:59 | 440 | |
![[TXT]](/icons/text.gif) | 11339222_Re:In other words.html | 2005-01-12 03:06 | 440 | |
![[TXT]](/icons/text.gif) | 9901151_Re:Bogus conclusions..html | 2004-08-05 01:18 | 441 | |
![[TXT]](/icons/text.gif) | 4389581_Re:Crock of shit.html | 2002-10-04 03:26 | 442 | |
![[TXT]](/icons/text.gif) | 5479085_Re:Inovate.html | 2003-03-10 02:50 | 442 | |
![[TXT]](/icons/text.gif) | 8560616_Re:True. XGItech is a co which did as much as poss.html | 2004-03-13 07:14 | 442 | |
![[TXT]](/icons/text.gif) | 9825425_Re:Another solution in search of problem.html | 2004-07-28 04:08 | 443 | |
![[TXT]](/icons/text.gif) | 10397404_Does innovation suffer?.html | 2004-09-30 01:40 | 443 | |
![[TXT]](/icons/text.gif) | 10229764_Best solution.html | 2004-09-12 04:47 | 445 | |
![[TXT]](/icons/text.gif) | 10561125_Re:The best programmer of all time???.html | 2004-10-18 08:37 | 450 | |
![[TXT]](/icons/text.gif) | 4575026_Re:pet peeve, don't call us, we'll call you.html | 2002-10-31 06:30 | 453 | |
![[TXT]](/icons/text.gif) | 9872094_Re:Debian....html | 2004-08-03 04:11 | 453 | |
![[TXT]](/icons/text.gif) | 10747627_Re:Indeed - you're full of What If's....html | 2004-11-06 01:53 | 454 | |
![[TXT]](/icons/text.gif) | 5714426_Re:I actually tried to check this out....html | 2003-04-11 07:57 | 456 | |
![[TXT]](/icons/text.gif) | 6329003_Re:The first person to mention.html | 2003-06-29 02:16 | 458 | |
![[TXT]](/icons/text.gif) | 6783695_Re:Sound Mixing.....html | 2003-08-24 09:14 | 458 | |
![[TXT]](/icons/text.gif) | 8852701_Re:AFS doesn't work at my uni.html | 2004-04-12 03:50 | 458 | |
![[TXT]](/icons/text.gif) | 4687916_Re:X has kept me away from Linux.html | 2002-11-13 07:24 | 461 | |
![[TXT]](/icons/text.gif) | 4497245_Btw.html | 2002-10-21 12:49 | 462 | |
![[TXT]](/icons/text.gif) | 11141484_Re:I'm sorry for the LSB guys.html | 2004-12-20 05:46 | 466 | |
![[TXT]](/icons/text.gif) | 4927246_Re:Why does this matter to _.-ers?.html | 2002-12-19 08:25 | 468 | |
![[TXT]](/icons/text.gif) | 9447195_Re:User level virus.html | 2004-06-16 06:19 | 472 | |
![[TXT]](/icons/text.gif) | 10118945_Re:Let me ask everyone here....html | 2004-08-31 10:55 | 473 | |
![[TXT]](/icons/text.gif) | 5021025_Re:Why do you care so much?.html | 2003-01-05 03:27 | 474 | |
![[TXT]](/icons/text.gif) | 7274625_Re:Unix administrators aren't mushrooms..html | 2003-10-21 03:23 | 474 | |
![[TXT]](/icons/text.gif) | 6948267_Re:Your patent link is infringing.html | 2003-09-12 05:24 | 475 | |
![[TXT]](/icons/text.gif) | 9668652_Re:It's the hardware too!.html | 2004-07-11 03:27 | 475 | |
![[TXT]](/icons/text.gif) | 11089447_Re:ReactOS?.html | 2004-12-15 10:08 | 476 | |
![[TXT]](/icons/text.gif) | 4726855_Re:Besides.html | 2002-11-21 05:30 | 479 | |
![[TXT]](/icons/text.gif) | 7633150_Re:Integrity checks.html | 2003-12-04 04:44 | 479 | |
![[TXT]](/icons/text.gif) | 9393769_Re:No posts thus far - an omen?.html | 2004-06-07 07:38 | 479 | |
![[TXT]](/icons/text.gif) | 11415655_Re:I read the FA.html | 2005-01-17 09:29 | 479 | |
![[TXT]](/icons/text.gif) | 4399805_Re:Why don't they use standard CVS?.html | 2002-10-06 08:57 | 482 | |
![[TXT]](/icons/text.gif) | 9348663_Re:Replace it with a key labelled [help].html | 2004-06-05 12:41 | 482 | |
![[TXT]](/icons/text.gif) | 5820900_Re:Activists vs. anti-spam crowd.html | 2003-04-27 04:29 | 483 | |
![[TXT]](/icons/text.gif) | 6408021_Re:Make the darn drivers Open Source!.html | 2003-07-10 12:03 | 485 | |
![[TXT]](/icons/text.gif) | 8718003_Re:Amen..html | 2004-03-30 03:15 | 485 | |
![[TXT]](/icons/text.gif) | 7223431_Re:Stallman declined to be interviewed ....html | 2003-10-15 03:44 | 486 | |
![[TXT]](/icons/text.gif) | 10036334_Re:first things first--.html | 2004-08-21 01:26 | 486 | |
![[TXT]](/icons/text.gif) | 5257357_Re:you're an.html | 2003-02-05 04:11 | 487 | |
![[TXT]](/icons/text.gif) | 11069515_Re:I found the truth!.html | 2004-12-07 08:52 | 487 | |
![[TXT]](/icons/text.gif) | 11023813_Re:Egalitarian? Who are.html | 2004-12-07 04:20 | 488 | |
![[TXT]](/icons/text.gif) | 11223726_copyright?.html | 2004-12-30 07:17 | 488 | |
![[TXT]](/icons/text.gif) | 10423336_Re:How is software really different?.html | 2004-10-03 07:39 | 489 | |
![[TXT]](/icons/text.gif) | 4909387_Re:Is this news?.html | 2002-12-17 02:32 | 490 | |
![[TXT]](/icons/text.gif) | 11141427_Re:"linux standardization".html | 2004-12-20 05:41 | 492 | |
![[TXT]](/icons/text.gif) | 9440161_Re:Kids.html | 2004-06-15 05:40 | 495 | |
![[TXT]](/icons/text.gif) | 10238413_Re:Mixed feelings about piracy.html | 2004-09-13 01:51 | 497 | |
![[TXT]](/icons/text.gif) | 10556232_Re:What this love will consist of.html | 2004-10-18 09:56 | 497 | |
![[TXT]](/icons/text.gif) | 11141367_Re:FreeBSD has it figured out.html | 2004-12-20 05:37 | 497 | |
![[TXT]](/icons/text.gif) | 8291818_Re:Binary drivers are inevitable.html | 2004-02-15 02:19 | 498 | |
![[TXT]](/icons/text.gif) | 10238445_Re:Regulation.html | 2004-09-13 01:53 | 498 | |
![[TXT]](/icons/text.gif) | 10889133_Talking out of both sides of their mouth.html | 2004-11-22 12:05 | 498 | |
![[TXT]](/icons/text.gif) | 6193215_Re:Phu-lease!.html | 2003-06-13 01:34 | 499 | |
![[TXT]](/icons/text.gif) | 8314769_Re:MAME cabinets.html | 2004-02-17 08:12 | 499 | |
![[TXT]](/icons/text.gif) | 11100936_Re:MOD PARENT UP.html | 2004-12-14 12:19 | 500 | |
![[TXT]](/icons/text.gif) | 10433969_Re:Chip Spec's would be better.html | 2004-10-04 04:40 | 501 | |
![[TXT]](/icons/text.gif) | 4543611_Re:how long...html | 2002-10-27 05:40 | 503 | |
![[TXT]](/icons/text.gif) | 8934603_Re:So...What's the point?.html | 2004-04-11 06:22 | 503 | |
![[TXT]](/icons/text.gif) | 9383748_Re:Using the right tool for the job.html | 2004-06-08 09:42 | 503 | |
![[TXT]](/icons/text.gif) | 8526052_Re:This isn't like overclocking your hard drive....html | 2004-03-10 05:37 | 505 | |
![[TXT]](/icons/text.gif) | 11007524_Re:good opportunity to say.html | 2004-12-06 10:28 | 507 | |
![[TXT]](/icons/text.gif) | 11198154_Re:Respect to.html | 2004-12-27 05:11 | 509 | |
![[TXT]](/icons/text.gif) | 5733806_Re:So you are saying....html | 2003-04-14 12:43 | 510 | |
![[TXT]](/icons/text.gif) | 4938961_Re:Anything would be faster....html | 2002-12-21 11:03 | 512 | |
![[TXT]](/icons/text.gif) | 10145809_Re:FUD?.html | 2004-09-02 10:07 | 512 | |
![[TXT]](/icons/text.gif) | 6151514_Re:Speaking of FUD.html | 2003-06-06 11:43 | 513 | |
![[TXT]](/icons/text.gif) | 9796704_Just like circumcision.html | 2004-07-25 05:42 | 514 | |
![[TXT]](/icons/text.gif) | 11206540_Re:The [Crimminal] is out of the bottle....html | 2004-12-28 12:22 | 514 | |
![[TXT]](/icons/text.gif) | 6197576_Re:As if it will matter....html | 2003-06-13 12:16 | 515 | |
![[TXT]](/icons/text.gif) | 10421386_Re:The War on Drugs funds Terrorists.html | 2004-10-03 02:05 | 515 | |
![[TXT]](/icons/text.gif) | 11005701_Re:MySQL sucks.html | 2004-12-02 01:03 | 519 | |
![[TXT]](/icons/text.gif) | 4965834_Re:Legislation isn't needed!.html | 2002-12-25 09:19 | 522 | |
![[TXT]](/icons/text.gif) | 10003891_Re:Currect track record.html | 2004-08-17 12:56 | 522 | |
![[TXT]](/icons/text.gif) | 6322394_Re:Wasn't smart enough..html | 2003-06-28 08:03 | 523 | |
![[TXT]](/icons/text.gif) | 11206523_Re:Anybody else find this disturbing?.html | 2004-12-28 12:18 | 524 | |
![[TXT]](/icons/text.gif) | 8071373_Re:Name issues.html | 2004-01-23 06:56 | 526 | |
![[TXT]](/icons/text.gif) | 9202127_Re:Microsoft really pisses me off.html | 2004-05-19 02:53 | 526 | |
![[TXT]](/icons/text.gif) | 11069530_Re:I found the truth!.html | 2004-12-07 08:55 | 526 | |
![[TXT]](/icons/text.gif) | 4857726_Re:Good work..html | 2002-12-10 04:46 | 528 | |
![[TXT]](/icons/text.gif) | 8223395_Re:Open Source Software is one thing.html | 2004-02-08 01:46 | 528 | |
![[TXT]](/icons/text.gif) | 4682665_Re:I like the Windows community spirit.html | 2002-11-13 08:42 | 529 | |
![[TXT]](/icons/text.gif) | 4927514_Re:Woops.html | 2002-12-19 09:31 | 529 | |
![[TXT]](/icons/text.gif) | 5034277_Re:On XBOX Emulation.html | 2003-01-07 01:48 | 530 | |
![[TXT]](/icons/text.gif) | 9077336_Re:good book!.html | 2004-04-27 03:48 | 532 | |
![[TXT]](/icons/text.gif) | 10975694_Re:Real Window Managers.html | 2004-12-02 12:19 | 532 | |
![[TXT]](/icons/text.gif) | 5712124_Re:I actually tried to check this out....html | 2003-04-11 01:21 | 533 | |
![[TXT]](/icons/text.gif) | 11464566_Re:The bottom line.html | 2005-01-20 10:57 | 535 | |
![[TXT]](/icons/text.gif) | 7415831_Re:What isn't MS bundling into Longhorn?.html | 2003-11-06 08:28 | 537 | |
![[TXT]](/icons/text.gif) | 4682781_Re:X has kept me away from Linux.html | 2002-11-13 09:04 | 538 | |
![[TXT]](/icons/text.gif) | 11092573_Re:Cygwin RULES.html | 2004-12-15 10:39 | 538 | |
![[TXT]](/icons/text.gif) | 5878172_Re:to be technically correct....html | 2003-05-03 08:46 | 539 | |
![[TXT]](/icons/text.gif) | 6194140_Re:As if it will matter....html | 2003-06-13 02:52 | 540 | |
![[TXT]](/icons/text.gif) | 9354218_Re:Lets see you do that for hundreds of systems.html | 2004-06-06 10:58 | 542 | |
![[TXT]](/icons/text.gif) | 10414907_Re:Seems to me to be a bit... *duh*.html | 2004-10-02 02:34 | 543 | |
![[TXT]](/icons/text.gif) | 5189782_Re:Self-installing programs are.html | 2003-01-30 12:08 | 545 | |
![[TXT]](/icons/text.gif) | 8330055_Re:Who cares?.html | 2004-02-18 02:25 | 548 | |
![[TXT]](/icons/text.gif) | 10546216_Re:Best quotes.html | 2004-10-16 03:36 | 548 | |
![[TXT]](/icons/text.gif) | 10084783_Re:ACPI.html | 2004-08-25 09:46 | 550 | |
![[TXT]](/icons/text.gif) | 8466072_Re:How To Hire Delopers? Mandatory read..html | 2004-03-03 01:44 | 551 | |
![[TXT]](/icons/text.gif) | 9341576_Re:How about....html | 2004-06-03 08:14 | 552 | |
![[TXT]](/icons/text.gif) | 10044134_Re:right direction.html | 2004-08-22 09:12 | 554 | |
![[TXT]](/icons/text.gif) | 10888979_Re:Let's make everything free!.html | 2004-11-22 11:52 | 554 | |
![[TXT]](/icons/text.gif) | 10900160_Re:Confused....html | 2004-11-22 12:49 | 554 | |
![[TXT]](/icons/text.gif) | 8328912_Re:Never a problem.html | 2004-02-18 01:20 | 555 | |
![[TXT]](/icons/text.gif) | 11020678_Re:that's not the goddamn point.html | 2004-12-06 12:58 | 556 | |
![[TXT]](/icons/text.gif) | 8656097_Re:Free as in "get out of my face".html | 2004-03-24 10:13 | 558 | |
![[TXT]](/icons/text.gif) | 11110583_Re:Advantage?.html | 2004-12-15 06:32 | 558 | |
![[TXT]](/icons/text.gif) | 5173359_Re:The wrongness is not that relevant.html | 2003-01-28 06:57 | 561 | |
![[TXT]](/icons/text.gif) | 11141326_Re:Radio Edit....html | 2004-12-20 05:33 | 561 | |
![[TXT]](/icons/text.gif) | 6146546_Re:Only if they changed something....html | 2003-06-08 08:21 | 562 | |
![[TXT]](/icons/text.gif) | 10572177_Re:What's so great about FreeBSD 5?.html | 2004-10-19 10:26 | 564 | |
![[TXT]](/icons/text.gif) | 9352549_Re:Replace it with a key labelled [help].html | 2004-06-05 04:27 | 565 | |
![[TXT]](/icons/text.gif) | 8328951_Re:And i thought it was normal...html | 2004-02-18 01:23 | 566 | |
![[TXT]](/icons/text.gif) | 10796178_Re:Pirating Old NES Games?.html | 2004-11-11 03:19 | 569 | |
![[TXT]](/icons/text.gif) | 4520003_Re:too bad that.html | 2002-10-23 02:30 | 570 | |
![[TXT]](/icons/text.gif) | 4555296_Re:PDF format freer than Word?.html | 2002-10-29 09:13 | 572 | |
![[TXT]](/icons/text.gif) | 4618400_Re:Where to begin.html | 2002-11-07 01:45 | 573 | |
![[TXT]](/icons/text.gif) | 4726775_Re:Hah squared!.html | 2002-11-21 05:22 | 574 | |
![[TXT]](/icons/text.gif) | 10241663_Re:I want the opposite!.html | 2004-09-13 06:56 | 574 | |
![[TXT]](/icons/text.gif) | 4734878_Re:Pot. Kettle. Black..html | 2002-11-22 04:13 | 577 | |
![[TXT]](/icons/text.gif) | 5034180_Re:Don't buy one!.html | 2003-01-07 01:36 | 577 | |
![[TXT]](/icons/text.gif) | 4770712_Re:And while you're so hot about the movie....html | 2002-11-24 04:55 | 578 | |
![[TXT]](/icons/text.gif) | 5858571_Re:What about the Audio Home Recording Act?.html | 2003-04-30 07:43 | 588 | |
![[TXT]](/icons/text.gif) | 8330523_Re:Who cares?.html | 2004-02-18 02:50 | 589 | |
![[TXT]](/icons/text.gif) | 9783972_Re:I no longer care.html | 2004-07-23 04:09 | 591 | |
![[TXT]](/icons/text.gif) | 10889371_Re:LAMP.html | 2004-11-22 12:28 | 591 | |
![[TXT]](/icons/text.gif) | 4927401_Re:More FUD.html | 2002-12-19 08:58 | 594 | |
![[TXT]](/icons/text.gif) | 10341688_Re:"Derivative" is a legal term, not a technical t.html | 2004-09-21 12:22 | 594 | |
![[TXT]](/icons/text.gif) | 11068841_Re:for all the slocate guys.html | 2004-12-12 06:36 | 594 | |
![[TXT]](/icons/text.gif) | 11377108_Re:Education no longer matters.html | 2005-01-15 11:14 | 595 | |
![[TXT]](/icons/text.gif) | 6159126_Uh.html | 2003-06-10 03:25 | 602 | |
![[TXT]](/icons/text.gif) | 11100919_Re:Device drivers.html | 2004-12-14 12:14 | 604 | |
![[TXT]](/icons/text.gif) | 11206117_Re:Intel Generations?.html | 2004-12-27 10:53 | 604 | |
![[TXT]](/icons/text.gif) | 10414419_Re:Seems to me to be a bit... *duh*.html | 2004-10-02 01:33 | 605 | |
![[TXT]](/icons/text.gif) | 8665058_Re:How can we fracture it?.html | 2004-03-25 02:04 | 607 | |
![[TXT]](/icons/text.gif) | 11196120_Re:Don't fuck around w_your modem's MAC..html | 2004-12-27 08:12 | 608 | |
![[TXT]](/icons/text.gif) | 7611705_Re:Who cares? It's still digital.html | 2003-12-02 03:39 | 611 | |
![[TXT]](/icons/text.gif) | 6661659_Design case history: the Commodore 64.html | 2003-08-10 05:48 | 614 | |
![[TXT]](/icons/text.gif) | 9383890_Re:Using the.html | 2004-06-08 10:15 | 615 | |
![[TXT]](/icons/text.gif) | 11376901_Re:So useful for Windows OC'ers.html | 2005-01-15 10:21 | 615 | |
![[TXT]](/icons/text.gif) | 4496656_Re:Protection..html | 2002-10-21 12:01 | 622 | |
![[TXT]](/icons/text.gif) | 4725470_Re:Riddle me this Hasie?.html | 2002-11-21 03:03 | 623 | |
![[TXT]](/icons/text.gif) | 5681521_Re:Editors?.html | 2003-04-07 04:26 | 623 | |
![[TXT]](/icons/text.gif) | 5257351_Re:GNU's take on Licenses.html | 2003-02-07 04:07 | 624 | |
![[TXT]](/icons/text.gif) | 5326818_Re:attitude?.html | 2003-02-17 12:19 | 628 | |
![[TXT]](/icons/text.gif) | 4442823_Re:Everyone will still see it as slow.html | 2002-10-13 07:59 | 629 | |
![[TXT]](/icons/text.gif) | 5527798_Re:no.html | 2003-03-16 04:51 | 631 | |
![[TXT]](/icons/text.gif) | 10269763_Re:Perhaps is the user base of those versions?.html | 2004-09-16 02:30 | 633 | |
![[TXT]](/icons/text.gif) | 11591897_Re:no brainer - commerial embedded devices.html | 2005-02-05 04:05 | 635 | |
![[TXT]](/icons/text.gif) | 4987911_Re:Um..html | 2002-12-30 09:45 | 636 | |
![[TXT]](/icons/text.gif) | 4454681_Re:Nintendo too?.html | 2002-10-15 12:36 | 637 | |
![[TXT]](/icons/text.gif) | 5712254_Re:I actually tried to check this out....html | 2003-04-11 01:39 | 637 | |
![[TXT]](/icons/text.gif) | 8092790_Re:And thus....html | 2004-01-26 04:37 | 640 | |
![[TXT]](/icons/text.gif) | 4703262_Re:It runs Linux and plays DVDs?.html | 2002-11-18 09:52 | 643 | |
![[TXT]](/icons/text.gif) | 4857703_Re:*Sigh*.html | 2002-12-10 04:44 | 643 | |
![[TXT]](/icons/text.gif) | 9440187_Re:Fighting a losing battle.html | 2004-06-15 05:47 | 643 | |
![[TXT]](/icons/text.gif) | 4704824_Re:A little OT.html | 2002-11-18 06:05 | 645 | |
![[TXT]](/icons/text.gif) | 7814905_Re:Linux Games.html | 2003-12-26 06:02 | 648 | |
![[TXT]](/icons/text.gif) | 4618361_Re:new FS....html | 2002-11-07 01:40 | 652 | |
![[TXT]](/icons/text.gif) | 5592715_Re:XFree Obsolete?.html | 2003-03-21 01:42 | 656 | |
![[TXT]](/icons/text.gif) | 11096226_Re:Device drivers.html | 2004-12-14 03:22 | 656 | |
![[TXT]](/icons/text.gif) | 5858932_Re:Don't Bother.html | 2003-05-01 08:44 | 657 | |
![[TXT]](/icons/text.gif) | 9372996_Re:Wasn't it in Eclipse first?.html | 2004-06-08 08:30 | 657 | |
![[TXT]](/icons/text.gif) | 4713979_Re:Their rules.html | 2002-11-19 03:57 | 658 | |
![[TXT]](/icons/text.gif) | 8078484_Re:New MS BIOS source code leaked!.html | 2004-01-24 08:59 | 659 | |
![[TXT]](/icons/text.gif) | 5414063_Re:The problems of GNOME.html | 2003-02-28 02:11 | 662 | |
![[TXT]](/icons/text.gif) | 5732121_Re:So you are saying....html | 2003-04-14 06:28 | 662 | |
![[TXT]](/icons/text.gif) | 11593251_Re:my (not so) offtopic dream.html | 2005-02-06 08:12 | 666 | |
![[TXT]](/icons/text.gif) | 11300337_Re: keep the politics out, please.....html | 2005-01-08 06:48 | 669 | |
![[TXT]](/icons/text.gif) | 8086325_Re:!opteron == no dual proc.html | 2004-01-26 03:32 | 670 | |
![[TXT]](/icons/text.gif) | 4498949_Re:Protection..html | 2002-10-21 03:55 | 672 | |
![[TXT]](/icons/text.gif) | 4911304_Re:Why boycotts are a risky business.html | 2002-12-17 06:00 | 672 | |
![[TXT]](/icons/text.gif) | 5038107_Re:Don't buy one!.html | 2003-01-07 12:57 | 674 | |
![[TXT]](/icons/text.gif) | 6144474_Re:Only if they changed something....html | 2003-06-08 01:50 | 675 | |
![[TXT]](/icons/text.gif) | 4474374_Re:Does anyone here actually understand TCP_IP?.html | 2002-10-17 06:18 | 676 | |
![[TXT]](/icons/text.gif) | 8386893_Re:mount -o ro,loop dvdimg.iso _something_movietit.html | 2004-02-25 11:15 | 679 | |
![[TXT]](/icons/text.gif) | 9406673_Re:80386 was more significant..html | 2004-06-12 10:08 | 679 | |
![[TXT]](/icons/text.gif) | 4909288_Re:Great news? Or bad news?.html | 2002-12-17 02:22 | 682 | |
![[TXT]](/icons/text.gif) | 4704260_Re:Someone explain this about BSD_Linux to me..html | 2002-11-19 02:14 | 683 | |
![[TXT]](/icons/text.gif) | 8680354_Re:Its a beautiful thing!.html | 2004-03-25 11:21 | 684 | |
![[TXT]](/icons/text.gif) | 10911287_Re:The Desktop.html | 2004-11-22 02:11 | 684 | |
![[TXT]](/icons/text.gif) | 10817813_Re:Piracy in China.html | 2004-11-11 01:17 | 687 | |
![[TXT]](/icons/text.gif) | 8328839_Re:Institutional behaviour.html | 2004-02-18 01:16 | 688 | |
![[TXT]](/icons/text.gif) | 6202085_Re:Mandate Free Software.html | 2003-06-14 08:46 | 694 | |
![[TXT]](/icons/text.gif) | 4927468_Re:Great Statement, I hope Apple listens..html | 2002-12-19 09:17 | 695 | |
![[TXT]](/icons/text.gif) | 9612916_Re:Economics and politics and software.html | 2004-07-05 09:41 | 700 | |
![[TXT]](/icons/text.gif) | 10761368_Re:An anecdote and an opinion..html | 2004-11-08 07:31 | 700 | |
![[TXT]](/icons/text.gif) | 10572201_Re:What's so great about FreeBSD 5?.html | 2004-10-19 10:31 | 705 | |
![[TXT]](/icons/text.gif) | 6178968_Dear lord.html | 2003-06-12 12:53 | 709 | |
![[TXT]](/icons/text.gif) | 9589654_Re:Uh okay.html | 2004-07-02 12:43 | 710 | |
![[TXT]](/icons/text.gif) | 10796187_Re:Piracy in China.html | 2004-11-11 03:21 | 711 | |
![[TXT]](/icons/text.gif) | 8837037_Re:Because I like PHP was: Um....html | 2004-04-07 08:46 | 713 | |
![[TXT]](/icons/text.gif) | 4988028_Re:really?.html | 2002-12-28 10:05 | 714 | |
![[TXT]](/icons/text.gif) | 7016045_Re:Telnet.html | 2003-09-21 01:38 | 714 | |
![[TXT]](/icons/text.gif) | 8641889_Re:secure.html | 2004-03-22 11:36 | 715 | |
![[TXT]](/icons/text.gif) | 9237014_Re:It's called a "control"....html | 2004-05-24 08:27 | 716 | |
![[TXT]](/icons/text.gif) | 4589623_Re:Am I the only one.html | 2002-11-03 02:51 | 717 | |
![[TXT]](/icons/text.gif) | 11092431_Re:The point?.html | 2004-12-15 10:23 | 722 | |
![[TXT]](/icons/text.gif) | 4959731_Re:Legislation isn't needed!.html | 2002-12-25 04:39 | 724 | |
![[TXT]](/icons/text.gif) | 10777089_Re:I am the parent poster and I agree.html | 2004-11-10 10:50 | 726 | |
![[TXT]](/icons/text.gif) | 4389441_Re:Sigh..html | 2002-10-04 03:04 | 728 | |
![[TXT]](/icons/text.gif) | 9804562_Re:Free Software.html | 2004-07-25 02:19 | 728 | |
![[TXT]](/icons/text.gif) | 9839240_Re:Commodore still in business?.html | 2005-02-07 10:09 | 729 | |
![[TXT]](/icons/text.gif) | 10072648_Re:My idea.html | 2004-08-25 04:36 | 732 | |
![[TXT]](/icons/text.gif) | 5681398_Re:Getting the corporate word out.html | 2003-04-07 04:06 | 733 | |
![[TXT]](/icons/text.gif) | 5952341_Re:AFS good on linux, good luck on FreeBSD.html | 2003-05-13 01:05 | 733 | |
![[TXT]](/icons/text.gif) | 5858952_Re:SuSE 8.2 freezes.html | 2003-05-01 08:47 | 734 | |
![[TXT]](/icons/text.gif) | 8641757_Re:Xine? Mplayer?.html | 2004-03-22 11:13 | 736 | |
![[TXT]](/icons/text.gif) | 10992716_Re:Breaks Gentoo as a learning tool.html | 2004-11-30 06:23 | 736 | |
![[TXT]](/icons/text.gif) | 9113212_Re:Where are the English release notes?.html | 2004-05-10 09:23 | 737 | |
![[TXT]](/icons/text.gif) | 10993889_Re:MySQL sucks.html | 2004-12-02 09:07 | 740 | |
![[TXT]](/icons/text.gif) | 4599751_Re:Stock took a hit?.html | 2002-11-04 11:07 | 741 | |
![[TXT]](/icons/text.gif) | 9247658_Re:Like building a plane.html | 2004-05-25 09:44 | 742 | |
![[TXT]](/icons/text.gif) | 4725497_Re:Bingo!.html | 2002-11-21 03:06 | 746 | |
![[TXT]](/icons/text.gif) | 4940184_Re:Yes it could be grounds..html | 2002-12-19 09:34 | 747 | |
![[TXT]](/icons/text.gif) | 8603647_Re:Virus protection on the chip?.html | 2004-03-18 04:54 | 749 | |
![[TXT]](/icons/text.gif) | 10959608_Re:don't know.html | 2004-11-30 09:23 | 750 | |
![[TXT]](/icons/text.gif) | 4708556_Re:Crazy World.html | 2002-11-18 01:39 | 751 | |
![[TXT]](/icons/text.gif) | 4702992_Re:rebooting 4 or 5 times a week?.html | 2002-11-18 08:45 | 753 | |
![[TXT]](/icons/text.gif) | 4909338_Re:in a word....html | 2002-12-17 02:26 | 755 | |
![[TXT]](/icons/text.gif) | 6651937_Re:dreamcast, too.html | 2003-08-08 08:31 | 757 | |
![[TXT]](/icons/text.gif) | 10380479_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:35 | 758 | |
![[TXT]](/icons/text.gif) | 10756120_Re:Blaming the language....html | 2004-11-07 12:36 | 758 | |
![[TXT]](/icons/text.gif) | 10240221_Re:No.html | 2004-09-13 04:40 | 759 | |
![[TXT]](/icons/text.gif) | 5707936_Re:Hmm....html | 2003-04-10 11:02 | 761 | |
![[TXT]](/icons/text.gif) | 4927417_Re:More FUD.html | 2002-12-19 09:03 | 762 | |
![[TXT]](/icons/text.gif) | 6367395_Re:Waste of GNU, gains for MS.....html | 2003-07-04 10:39 | 765 | |
![[TXT]](/icons/text.gif) | 4703150_Re:A little OT.html | 2002-11-18 09:23 | 768 | |
![[TXT]](/icons/text.gif) | 8487715_Re:closed source != bad always.html | 2004-03-06 06:18 | 768 | |
![[TXT]](/icons/text.gif) | 5694796_Re:Why the DMCA licks it....html | 2003-04-09 02:17 | 769 | |
![[TXT]](/icons/text.gif) | 6130909_Re:I hate the Apple ][....html | 2003-06-06 07:40 | 769 | |
![[TXT]](/icons/text.gif) | 10421435_Re:So is alcohol-Nature Neutering..html | 2004-10-03 02:13 | 769 | |
![[TXT]](/icons/text.gif) | 5851585_Re:Getting 0wn3d.html | 2003-05-01 07:33 | 773 | |
![[TXT]](/icons/text.gif) | 4956509_Re:More MS bashing for fark's sake?!.html | 2002-12-24 06:32 | 776 | |
![[TXT]](/icons/text.gif) | 5334256_Re:attitude?.html | 2003-02-17 08:51 | 777 | |
![[TXT]](/icons/text.gif) | 4558148_Re:(OT) x86.html | 2002-10-29 02:51 | 778 | |
![[TXT]](/icons/text.gif) | 5303721_Re:They go through the air!.html | 2003-02-14 01:24 | 780 | |
![[TXT]](/icons/text.gif) | 6778087_Re:Drivers.html | 2003-08-24 12:13 | 783 | |
![[TXT]](/icons/text.gif) | 6172479_Re:No....html | 2003-06-04 11:40 | 784 | |
![[TXT]](/icons/text.gif) | 4796357_Re:heh.html | 2002-12-02 04:06 | 787 | |
![[TXT]](/icons/text.gif) | 11085692_Re:Too many opcodes?.html | 2004-12-14 04:28 | 787 | |
![[TXT]](/icons/text.gif) | 11096173_Re:Device drivers.html | 2004-12-14 03:18 | 787 | |
![[TXT]](/icons/text.gif) | 9322502_Re:For the *BSD nay sayers.html | 2004-05-27 11:45 | 788 | |
![[TXT]](/icons/text.gif) | 5017008_Re:Note that Free != freedom.html | 2003-01-04 09:18 | 791 | |
![[TXT]](/icons/text.gif) | 5017156_Re:Here's my stand.html | 2003-01-04 09:50 | 795 | |
![[TXT]](/icons/text.gif) | 6380713_Re:Not the full OS.html | 2003-07-06 10:27 | 802 | |
![[TXT]](/icons/text.gif) | 6373190_Re:"Can Open Source save Tom's Hardware".html | 2003-07-05 02:13 | 804 | |
![[TXT]](/icons/text.gif) | 10892746_Re:The Desktop.html | 2004-11-22 05:55 | 804 | |
![[TXT]](/icons/text.gif) | 8050050_Re:Best Keyboard....html | 2004-01-21 07:06 | 806 | |
![[TXT]](/icons/text.gif) | 8637369_Re:Xine? Mplayer?.html | 2004-03-22 03:14 | 812 | |
![[TXT]](/icons/text.gif) | 8665529_Re:But....html | 2004-03-25 04:50 | 813 | |
![[TXT]](/icons/text.gif) | 5038148_Re:Oops, they did it again..html | 2003-01-06 01:07 | 814 | |
![[TXT]](/icons/text.gif) | 4955808_Re:Linux is great for server duties.html | 2002-12-20 11:46 | 815 | |
![[TXT]](/icons/text.gif) | 11175561_Re:what about dual?.html | 2004-12-23 05:34 | 816 | |
![[TXT]](/icons/text.gif) | 9749937_Re:Cheapest way to play.html | 2004-07-20 10:58 | 825 | |
![[TXT]](/icons/text.gif) | 8618279_Re:From the looks of their page.html | 2004-03-19 10:53 | 826 | |
![[TXT]](/icons/text.gif) | 6817719_Re:yay (faker!).html | 2003-08-28 03:21 | 828 | |
![[TXT]](/icons/text.gif) | 10341758_Re:Another view on OS_GPL.html | 2004-09-21 12:26 | 830 | |
![[TXT]](/icons/text.gif) | 9225070_Re:web standards should ignore IE.html | 2004-05-22 11:16 | 835 | |
![[TXT]](/icons/text.gif) | 11339026_Re:Free as in beer.html | 2005-01-12 02:53 | 838 | |
![[TXT]](/icons/text.gif) | 8434460_Re:bad for economy too.html | 2004-03-01 05:44 | 843 | |
![[TXT]](/icons/text.gif) | 9798177_Re:FYI.html | 2004-07-25 10:27 | 845 | |
![[TXT]](/icons/text.gif) | 4959728_Re:Legislation isn't needed!.html | 2002-12-25 04:36 | 849 | |
![[TXT]](/icons/text.gif) | 6413027_Re:how wonderfully useless.html | 2003-07-11 02:05 | 850 | |
![[TXT]](/icons/text.gif) | 10889254_Re:How to be an effective advocate.html | 2004-11-22 12:16 | 851 | |
![[TXT]](/icons/text.gif) | 5950103_AFS vs NFS.html | 2003-05-13 06:24 | 852 | |
![[TXT]](/icons/text.gif) | 9762572_Re:That's beside the point.html | 2004-07-19 02:19 | 852 | |
![[TXT]](/icons/text.gif) | 11076837_Re:simplify the instruction set..html | 2004-12-13 06:04 | 854 | |
![[TXT]](/icons/text.gif) | 4648357_Re:This is important stuff!.html | 2002-11-11 11:08 | 861 | |
![[TXT]](/icons/text.gif) | 4844736_Re:Whatever.....html | 2002-12-09 12:27 | 864 | |
![[TXT]](/icons/text.gif) | 6429862_Re:IAWTP.html | 2003-07-13 04:36 | 866 | |
![[TXT]](/icons/text.gif) | 9931480_Re:This is hilarious....html | 2004-08-10 12:39 | 866 | |
![[TXT]](/icons/text.gif) | 10341634_Re:Dynamically linking OK?.html | 2004-09-21 12:18 | 870 | |
![[TXT]](/icons/text.gif) | 8437968_Re:bad for economy too.html | 2004-03-01 01:47 | 872 | |
![[TXT]](/icons/text.gif) | 4623528_Re:new FS....html | 2002-11-07 01:43 | 883 | |
![[TXT]](/icons/text.gif) | 9003004_Re:Well spoken..html | 2004-04-28 07:28 | 884 | |
![[TXT]](/icons/text.gif) | 6201267_Re:Mandatory defies the nature of open source.....html | 2003-06-14 05:16 | 885 | |
![[TXT]](/icons/text.gif) | 10650101_Re:As I remember....html | 2004-10-27 11:00 | 889 | |
![[TXT]](/icons/text.gif) | 6651147_Re:Beginning to look Valid.html | 2003-08-08 06:27 | 896 | |
![[TXT]](/icons/text.gif) | 8435088_Re:Initrd tools?.html | 2004-03-01 06:57 | 902 | |
![[TXT]](/icons/text.gif) | 9844207_Re:gates is cool.html | 2004-07-30 10:39 | 908 | |
![[TXT]](/icons/text.gif) | 11113988_Re:Device drivers.html | 2004-12-14 03:47 | 913 | |
![[TXT]](/icons/text.gif) | 10271988_Re:Answer2 - interesting reasoning....html | 2004-09-16 05:32 | 918 | |
![[TXT]](/icons/text.gif) | 11096030_Re:Platform or application?.html | 2004-12-14 03:07 | 919 | |
![[TXT]](/icons/text.gif) | 4471069_Re:IDE vs. SCSI Warranty.html | 2002-10-17 12:55 | 920 | |
![[TXT]](/icons/text.gif) | 4725093_Re:that's why.html | 2002-11-21 02:22 | 924 | |
![[TXT]](/icons/text.gif) | 4976125_Re:Not surprised.html | 2002-12-28 08:36 | 927 | |
![[TXT]](/icons/text.gif) | 4496838_Re:FSP.html | 2002-10-21 12:13 | 935 | |
![[TXT]](/icons/text.gif) | 9762453_Re:Cheapest way to play Doom 3.html | 2004-07-20 02:10 | 939 | |
![[TXT]](/icons/text.gif) | 9825119_Re:Another solution in search of problem.html | 2004-07-28 03:45 | 939 | |
![[TXT]](/icons/text.gif) | 4987991_Re:Um..html | 2002-12-30 09:59 | 946 | |
![[TXT]](/icons/text.gif) | 9825378_Re:NFS4 is not supported in Windows.html | 2004-07-28 04:04 | 946 | |
![[TXT]](/icons/text.gif) | 4867191_Re:Umbrella.html | 2002-12-11 07:54 | 947 | |
![[TXT]](/icons/text.gif) | 8434117_Re:IPR isnt a problem in itself....html | 2004-03-01 05:00 | 949 | |
![[TXT]](/icons/text.gif) | 9901235_Re:Bogus conclusions. This is the reason..html | 2004-08-05 01:24 | 950 | |
![[TXT]](/icons/text.gif) | 4600694_Re:What are they trying to protect?.html | 2002-11-05 01:48 | 957 | |
![[TXT]](/icons/text.gif) | 4497149_Re:I like.html | 2002-10-21 12:41 | 958 | |
![[TXT]](/icons/text.gif) | 10567986_Re:What's so great about FreeBSD 5?.html | 2004-10-19 02:01 | 966 | |
![[TXT]](/icons/text.gif) | 4729494_Re:The Truth? You can't handle the truth.html | 2002-11-21 11:36 | 1.0K | |
![[TXT]](/icons/text.gif) | 8728566_Re:Terrible research.html | 2004-03-31 03:11 | 1.0K | |
![[TXT]](/icons/text.gif) | 4524006_Re:It's not just individuals....html | 2002-10-24 01:32 | 1.0K | |
![[TXT]](/icons/text.gif) | 5543816_Re:Absolutely one step closer!.html | 2003-03-19 09:26 | 1.0K | |
![[TXT]](/icons/text.gif) | 10568077_Re:What's so great about FreeBSD 5?.html | 2004-10-19 02:08 | 1.0K | |
![[TXT]](/icons/text.gif) | 4647298_Re:Why Open Source Needs Microsoft.html | 2002-11-11 08:16 | 1.0K | |
![[TXT]](/icons/text.gif) | 8522957_Re:Other ISPs start to do this?.html | 2004-03-10 01:12 | 1.0K | |
![[TXT]](/icons/text.gif) | 7166526_Re:What a stupid trend.html | 2003-10-08 04:51 | 1.0K | |
![[TXT]](/icons/text.gif) | 9317041_Re:What is free? Is your free the same as mine?.html | 2004-06-02 12:54 | 1.0K | |
![[TXT]](/icons/text.gif) | 8642386_NWFS.html | 2004-03-23 01:05 | 1.0K | |
![[TXT]](/icons/text.gif) | 11577810_Re:Common sense, for the love of Pete....html | 2005-02-04 06:03 | 1.0K | |
![[TXT]](/icons/text.gif) | 11015397_Re:Timely topic, IMHO.....html | 2004-12-06 01:37 | 1.0K | |
![[TXT]](/icons/text.gif) | 11096106_Re:Device drivers.html | 2004-12-14 03:13 | 1.0K | |
![[TXT]](/icons/text.gif) | 8649207_Re:Abandonware.html | 2004-03-23 04:28 | 1.0K | |
![[TXT]](/icons/text.gif) | 9003045_Re:Someone failed Sesame Street.html | 2004-04-28 07:35 | 1.0K | |
![[TXT]](/icons/text.gif) | 6179410_Re:Poorly applied logic.html | 2003-06-12 02:31 | 1.0K | |
![[TXT]](/icons/text.gif) | 9792494_Re:The lesson of X11.....html | 2004-07-24 11:19 | 1.0K | |
![[TXT]](/icons/text.gif) | 8139676_Re:nice.html | 2004-01-30 06:01 | 1.0K | |
![[TXT]](/icons/text.gif) | 6201251_Re:History?.html | 2003-06-14 05:10 | 1.0K | |
![[TXT]](/icons/text.gif) | 4647345_Re:Phew.html | 2002-11-11 08:23 | 1.0K | |
![[TXT]](/icons/text.gif) | 4845181_Re:Use your own advice.html | 2002-12-09 01:32 | 1.0K | |
![[TXT]](/icons/text.gif) | 11198144_Re:Intel Generations?.html | 2004-12-27 05:06 | 1.0K | |
![[TXT]](/icons/text.gif) | 8434005_Re:No kidding? People prefer free?.html | 2004-03-01 04:50 | 1.0K | |
![[TXT]](/icons/text.gif) | 8595519_Re:Is it our right to restrict the use of our idea.html | 2004-03-17 11:14 | 1.0K | |
![[TXT]](/icons/text.gif) | 9368220_Re:Once again, I'll have to disagree with this..html | 2004-06-08 12:47 | 1.0K | |
![[TXT]](/icons/text.gif) | 4760939_Re:Windows and IE?.html | 2002-11-25 02:17 | 1.1K | |
![[TXT]](/icons/text.gif) | 4983453_Um..html | 2002-12-30 03:18 | 1.1K | |
![[TXT]](/icons/text.gif) | 5730521_Re:Can you say 'Ford Pinto'? I knew you could!.html | 2003-04-14 03:02 | 1.1K | |
![[TXT]](/icons/text.gif) | 9804605_Re:Astroturfing or another troll ?.html | 2004-07-25 02:21 | 1.1K | |
![[TXT]](/icons/text.gif) | 10816294_not free software.html | 2004-11-14 08:01 | 1.1K | |
![[TXT]](/icons/text.gif) | 8147797_Re:Linux in cache?.html | 2004-01-31 09:51 | 1.1K | |
![[TXT]](/icons/text.gif) | 8828951_Re:little kids?.html | 2004-03-31 12:31 | 1.1K | |
![[TXT]](/icons/text.gif) | 4704247_Re:A little OT.html | 2002-11-18 02:09 | 1.1K | |
![[TXT]](/icons/text.gif) | 5159067_Re:But isnt it COOL to be anti-USA now?.html | 2003-01-25 06:52 | 1.1K | |
![[TXT]](/icons/text.gif) | 5908601_Re:Release date.html | 2003-05-07 03:12 | 1.1K | |
![[TXT]](/icons/text.gif) | 8820743_Re:So what's it like in Taiwan?.html | 2004-04-09 04:55 | 1.1K | |
![[TXT]](/icons/text.gif) | 4725400_Re:The Truth? You can't handle the truth.html | 2002-11-21 02:55 | 1.1K | |
![[TXT]](/icons/text.gif) | 10889192_Re:As a consequence of purchasing intel.html | 2004-11-22 12:11 | 1.1K | |
![[TXT]](/icons/text.gif) | 9768873_Re:Link has little info about bios.html | 2004-07-22 08:09 | 1.1K | |
![[TXT]](/icons/text.gif) | 10835886_Medical practices and malpractices.html | 2004-11-16 04:54 | 1.1K | |
![[TXT]](/icons/text.gif) | 4500477_Re:Why SCSI?.html | 2002-10-21 07:13 | 1.1K | |
![[TXT]](/icons/text.gif) | 11196592_Re:Somehow not impressed?.html | 2004-12-27 09:39 | 1.1K | |
![[TXT]](/icons/text.gif) | 4951179_Re:More MS bashing for fark's sake?!.html | 2002-12-24 07:06 | 1.1K | |
![[TXT]](/icons/text.gif) | 5681505_Re:Not exactly news ....html | 2003-04-07 04:23 | 1.1K | |
![[TXT]](/icons/text.gif) | 6130969_Re:Law is not the.html | 2003-06-06 07:57 | 1.1K | |
![[TXT]](/icons/text.gif) | 11516518_Re:why *I* like the GPL ....html | 2005-01-29 07:01 | 1.1K | |
![[TXT]](/icons/text.gif) | 9332577_Re:I don't get it..html | 2004-06-02 12:53 | 1.1K | |
![[TXT]](/icons/text.gif) | 4654504_Re:Welcome to System Administration 101.html | 2002-11-12 05:09 | 1.2K | |
![[TXT]](/icons/text.gif) | 9972636_Re:The answer (not 42 this time).html | 2004-08-14 01:56 | 1.2K | |
![[TXT]](/icons/text.gif) | 9865353_Re:It's possible, I suppose..html | 2004-08-02 05:30 | 1.2K | |
![[TXT]](/icons/text.gif) | 9762526_Re:That's beside the point.html | 2004-07-19 02:15 | 1.2K | |
![[TXT]](/icons/text.gif) | 5787426_Re:Even though the other dude is sort of trolling.html | 2003-04-22 01:25 | 1.2K | |
![[TXT]](/icons/text.gif) | 5853270_Re:Sigh....html | 2003-05-01 11:26 | 1.2K | |
![[TXT]](/icons/text.gif) | 8665116_Re:Free as in "get out of my face".html | 2004-03-24 02:21 | 1.2K | |
![[TXT]](/icons/text.gif) | 4991125_Re:Um..html | 2002-12-30 05:51 | 1.2K | |
![[TXT]](/icons/text.gif) | 5853361_Re:Mandatory?.html | 2003-05-01 11:36 | 1.2K | |
![[TXT]](/icons/text.gif) | 8434650_Re:...and Clemens' reaction.html | 2004-03-01 06:03 | 1.2K | |
![[TXT]](/icons/text.gif) | 9211943_Re:I really don't see.html | 2004-05-20 11:51 | 1.2K | |
![[TXT]](/icons/text.gif) | 6468352_Re:The GPL is not viral..html | 2003-07-17 11:48 | 1.2K | |
![[TXT]](/icons/text.gif) | 11516578_Re:Ho-hum.html | 2005-01-29 07:09 | 1.3K | |
![[TXT]](/icons/text.gif) | 4496767_Re:I like this idea....html | 2002-10-21 12:08 | 1.3K | |
![[TXT]](/icons/text.gif) | 4655356_Re:Welcome to System Administration 101.html | 2002-11-12 06:54 | 1.3K | |
![[TXT]](/icons/text.gif) | 10074374_Re:ACPI.html | 2004-08-25 07:57 | 1.3K | |
![[TXT]](/icons/text.gif) | 6672471_Re:Either way it's a good thing.html | 2003-08-11 11:19 | 1.3K | |
![[TXT]](/icons/text.gif) | 4600776_Re:Protect?.html | 2002-11-05 02:00 | 1.3K | |
![[TXT]](/icons/text.gif) | 8375115_Re:GPL....html | 2004-02-24 12:39 | 1.3K | |
![[TXT]](/icons/text.gif) | 4611787_Re:Are you kidding?.html | 2002-11-06 04:47 | 1.3K | |
![[TXT]](/icons/text.gif) | 11300285_Re:They're stealing from ME....html | 2005-01-08 06:40 | 1.3K | |
![[TXT]](/icons/text.gif) | 10341918_Re:Funny....html | 2004-09-21 12:38 | 1.3K | |
![[TXT]](/icons/text.gif) | 4678820_Re:How Sad.html | 2002-11-15 01:39 | 1.3K | |
![[TXT]](/icons/text.gif) | 11118447_Re:Hello it's me again.html | 2004-12-17 01:56 | 1.4K | |
![[TXT]](/icons/text.gif) | 5692947_Re:Not exactly news ....html | 2003-04-07 09:15 | 1.4K | |
![[TXT]](/icons/text.gif) | 10380493_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:37 | 1.4K | |
![[TXT]](/icons/text.gif) | 4854474_Re:Use your own advice.html | 2002-12-09 10:14 | 1.4K | |
![[TXT]](/icons/text.gif) | 10572081_Re:Reality Distortion Fields ON!.html | 2004-10-19 10:10 | 1.4K | |
![[TXT]](/icons/text.gif) | 5277342_Re:GNU's take on Licenses.html | 2003-02-07 12:56 | 1.4K | |
![[TXT]](/icons/text.gif) | 11026045_Re:I found the truth!.html | 2004-12-07 06:51 | 1.4K | |
![[TXT]](/icons/text.gif) | 10911221_Re:Confused....html | 2004-11-22 02:05 | 1.4K | |
![[TXT]](/icons/text.gif) | 8665818_Re:microsoft abuses power.html | 2004-03-25 06:35 | 1.4K | |
![[TXT]](/icons/text.gif) | 10757719_Re:An anecdote and an opinion..html | 2004-11-08 02:48 | 1.4K | |
![[TXT]](/icons/text.gif) | 8623592_Re:Excellent!.html | 2004-03-20 07:01 | 1.4K | |
![[TXT]](/icons/text.gif) | 4987976_Re:Um..html | 2002-12-30 09:54 | 1.4K | |
![[TXT]](/icons/text.gif) | 4652812_Um.html | 2002-11-12 01:59 | 1.5K | |
![[TXT]](/icons/text.gif) | 8655898_Re:I hope.....html | 2004-03-24 09:55 | 1.5K | |
![[TXT]](/icons/text.gif) | 4951148_Re:That's ludicrous.html | 2002-12-23 06:53 | 1.5K | |
![[TXT]](/icons/text.gif) | 6202038_Re:News Flash, Ayanami....html | 2003-06-14 08:34 | 1.5K | |
![[TXT]](/icons/text.gif) | 9267963_Re:Probably will hit 1.0 a year after Duke Nukem.html | 2004-05-27 11:40 | 1.5K | |
![[TXT]](/icons/text.gif) | 5705146_Re:Trust Big Brother!.html | 2003-04-09 03:42 | 1.5K | |
![[TXT]](/icons/text.gif) | 11113912_Re:The point?.html | 2004-12-15 03:20 | 1.5K | |
![[TXT]](/icons/text.gif) | 9348090_Re:Replace it with a key.html | 2004-06-05 09:47 | 1.5K | |
![[TXT]](/icons/text.gif) | 6202069_Re:History?.html | 2003-06-14 08:41 | 1.5K | |
![[TXT]](/icons/text.gif) | 5004745_Re:Um..html | 2002-12-30 03:02 | 1.5K | |
![[TXT]](/icons/text.gif) | 11593291_Re:Common sense, for the love of Pete....html | 2005-02-04 08:21 | 1.6K | |
![[TXT]](/icons/text.gif) | 9322448_Re:What is free? Is your free the same as mine?.html | 2004-06-02 11:36 | 1.6K | |
![[TXT]](/icons/text.gif) | 5318836_Re:attitude?.html | 2003-02-17 09:09 | 1.6K | |
![[TXT]](/icons/text.gif) | 5714460_Re:I actually tried to check this out....html | 2003-04-11 08:08 | 1.6K | |
![[TXT]](/icons/text.gif) | 8330006_Re:GPL.html | 2004-02-18 02:23 | 1.6K | |
![[TXT]](/icons/text.gif) | 4991077_Re:Um..html | 2002-12-30 05:41 | 1.6K | |
![[TXT]](/icons/text.gif) | 8631986_Re:protecting from viruses.html | 2004-03-22 01:37 | 1.7K | |
![[TXT]](/icons/text.gif) | 4704309_Re:X has kept me away from Linux.html | 2002-11-13 02:37 | 1.7K | |
![[TXT]](/icons/text.gif) | 8434300_Re:The major problem is.html | 2004-03-01 05:25 | 1.7K | |
![[TXT]](/icons/text.gif) | 10602766_Re:This isn't about "hardship". It's about numbers.html | 2004-10-22 03:13 | 1.7K | |
![[TXT]](/icons/text.gif) | 11383492_Re:Education no longer matters.html | 2005-01-15 02:26 | 1.7K | |
![[TXT]](/icons/text.gif) | 8433906_Re:radical rethinking of IP?.html | 2004-03-01 04:41 | 1.7K | |
![[TXT]](/icons/text.gif) | 5686045_Re:Not exactly news ....html | 2003-04-07 09:56 | 1.8K | |
![[TXT]](/icons/text.gif) | 9249994_Re:Like building a plane.html | 2004-05-25 12:36 | 1.8K | |
![[TXT]](/icons/text.gif) | 10756033_Re:Sure, blame C and C++.html | 2004-11-07 12:29 | 1.8K | |
![[TXT]](/icons/text.gif) | 4395821_Re:Crock.html | 2002-10-04 12:34 | 1.8K | |
![[TXT]](/icons/text.gif) | 8314942_Re:Correct use of "steal"!.html | 2004-02-18 08:41 | 1.8K | |
![[TXT]](/icons/text.gif) | 11198187_Re:886.html | 2004-12-27 05:24 | 1.8K | |
![[TXT]](/icons/text.gif) | 5027913_Re:Oops, they did it again..html | 2003-01-06 04:04 | 1.9K | |
![[TXT]](/icons/text.gif) | 9768920_Re:Steps Against DRM.html | 2004-07-22 08:17 | 1.9K | |
![[TXT]](/icons/text.gif) | 4702596_Re:X has kept me away from Linux.html | 2002-11-13 07:34 | 1.9K | |
![[TXT]](/icons/text.gif) | 11534877_Re:What a frackin' idiot.html | 2005-01-31 07:05 | 1.9K | |
![[TXT]](/icons/text.gif) | 4846448_Re:Use your own advice.html | 2002-12-09 03:59 | 1.9K | |
![[TXT]](/icons/text.gif) | 9383879_Re:Using the right tool for the job.html | 2004-06-08 10:11 | 2.0K | |
![[TXT]](/icons/text.gif) | 9846353_Re:gates is cool.html | 2004-07-30 01:24 | 2.0K | |
![[TXT]](/icons/text.gif) | 10342014_Re:Funny....html | 2004-09-21 12:45 | 2.1K | |
![[TXT]](/icons/text.gif) | 9393761_Re:No posts thus far - an omen?.html | 2004-06-07 07:36 | 2.1K | |
![[TXT]](/icons/text.gif) | 10170601_Re:It's All Downhill.html | 2004-09-06 02:45 | 2.1K | |
![[TXT]](/icons/text.gif) | 9373138_Re:Using the right tool for the job.html | 2004-06-08 08:47 | 2.1K | |
![[TXT]](/icons/text.gif) | 4389827_Re:Historical perspective..html | 2002-10-04 03:51 | 2.1K | |
![[TXT]](/icons/text.gif) | 10370000_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 11:01 | 2.1K | |
![[TXT]](/icons/text.gif) | 4494956_Re:Why SCSI?.html | 2002-10-21 09:04 | 2.2K | |
![[TXT]](/icons/text.gif) | 8728267_Re:little kids?.html | 2004-03-31 02:51 | 2.2K | |
![[TXT]](/icons/text.gif) | 11530297_Re:What a frackin' idiot.html | 2005-01-31 01:15 | 2.3K | |
![[TXT]](/icons/text.gif) | 4389528_Re:Historical perspective..html | 2002-10-04 03:18 | 2.3K | |
![[TXT]](/icons/text.gif) | 10072588_Re:ACPI.html | 2004-08-25 04:28 | 2.3K | |
![[TXT]](/icons/text.gif) | 9321489_Re:I don't get it..html | 2004-06-02 08:31 | 2.3K | |
![[TXT]](/icons/text.gif) | 9853981_Re:I have done LD transfers.html | 2004-07-30 03:11 | 2.3K | |
![[TXT]](/icons/text.gif) | 4926980_Re:Yes it could be.html | 2002-12-19 07:14 | 2.4K | |
![[TXT]](/icons/text.gif) | 6270110_Re:The GPL: Intellectual Theft.html | 2003-06-22 07:35 | 2.4K | |
![[TXT]](/icons/text.gif) | 8904539_Re:GPL?.html | 2004-04-19 10:14 | 2.4K | |
![[TXT]](/icons/text.gif) | 9825343_Re:Another solution in search of problem.html | 2004-07-28 04:01 | 2.5K | |
![[TXT]](/icons/text.gif) | 8656320_Re:Free as in "get out of my face".html | 2004-03-24 10:31 | 2.5K | |
![[TXT]](/icons/text.gif) | 8840806_Re:RMS Blathering.html | 2004-04-12 03:13 | 2.5K | |
![[TXT]](/icons/text.gif) | 10072440_Re:*raises hand*.html | 2004-08-25 04:12 | 2.8K | |
![[TXT]](/icons/text.gif) | 5004803_Re:Um..html | 2002-12-30 03:25 | 2.9K | |
![[TXT]](/icons/text.gif) | 4497098_Re:Why SCSI?.html | 2002-10-21 12:36 | 3.0K | |
![[TXT]](/icons/text.gif) | 9322583_Re:For the *BSD nay sayers.html | 2004-05-27 12:02 | 3.3K | |
![[TXT]](/icons/text.gif) | 9368019_Re:What is going on with the BSD's.html | 2004-06-08 12:31 | 3.3K | |
![[TXT]](/icons/text.gif) | 9267832_Re:For the *BSD nay sayers.html | 2004-05-27 11:31 | 3.5K | |
![[TXT]](/icons/text.gif) | 8829021_Re:Amen..html | 2004-03-30 12:51 | 3.5K | |
![[TXT]](/icons/text.gif) | 11593436_Re:Common sense, for the love of Pete....html | 2005-02-04 08:53 | 3.6K | |
![[TXT]](/icons/text.gif) | 4623520_Re:Where to begin.html | 2002-11-07 01:40 | 3.7K | |
![[TXT]](/icons/text.gif) | 4508969_Re:Paypal, CDNow, tons of examples come to mind.html | 2002-10-22 06:53 | 3.7K | |
![[TXT]](/icons/text.gif) | 9031828_Re:Why open Java?.html | 2004-05-01 10:53 | 3.8K | |
![[TXT]](/icons/text.gif) | 10761554_Re:Sure, blame C and C++.html | 2004-11-07 07:54 | 4.0K | |
![[TXT]](/icons/text.gif) | 4796796_Re:heh.html | 2002-12-02 05:07 | 4.4K | |
![[TXT]](/icons/text.gif) | 10241604_Re:How do we get there from here?.html | 2004-09-13 06:51 | 4.4K | |
![[TXT]](/icons/text.gif) | 4631255_Re:Where to begin.html | 2002-11-07 02:26 | 4.6K | |
![[TXT]](/icons/text.gif) | 5702875_Re:Not exactly news ....html | 2003-04-07 11:56 | 5.2K | |
|