![[ICO]](/icons/blank.gif)  | Name | Last modified | Size | Description | 
   
  | 
![[PARENTDIR]](/icons/back.gif)  | Parent Directory |   |   -  |   | 
![[TXT]](/icons/text.gif)  | 11593436_Re:Common sense, for the love of Pete....html | 2005-02-04 08:53   | 3.6K |   | 
![[TXT]](/icons/text.gif)  | 11593291_Re:Common sense, for the love of Pete....html | 2005-02-04 08:21   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 11593251_Re:my (not so) offtopic dream.html | 2005-02-06 08:12   | 666  |   | 
![[TXT]](/icons/text.gif)  | 11593240_Re:Read the WHOLE article..html | 2005-02-05 08:09   | 308  |   | 
![[TXT]](/icons/text.gif)  | 11593208_Re:my (not so) offtopic dream.html | 2005-02-06 08:04   | 372  |   | 
![[TXT]](/icons/text.gif)  | 11591927_Re:Read the WHOLE article..html | 2005-02-05 04:10   | 219  |   | 
![[TXT]](/icons/text.gif)  | 11591908_Re:runs on old and rare archs.html | 2005-02-05 04:07   | 303  |   | 
![[TXT]](/icons/text.gif)  | 11591897_Re:no brainer - commerial embedded devices.html | 2005-02-05 04:05   | 635  |   | 
![[TXT]](/icons/text.gif)  | 11591422_Re:The problem with windows is.html | 2005-02-05 03:00   | 320  |   | 
![[TXT]](/icons/text.gif)  | 11591046_JPEG-2000 is encumbered by patents.html | 2005-02-06 02:04   | 232  |   | 
![[TXT]](/icons/text.gif)  | 11577962_Re:FBI raids themselves.html | 2005-02-04 06:14   | 379  |   | 
![[TXT]](/icons/text.gif)  | 11577810_Re:Common sense, for the love of Pete....html | 2005-02-04 06:03   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 11577684_Re:Common sense, for the love of Pete....html | 2005-02-04 05:51   | 331  |   | 
![[TXT]](/icons/text.gif)  | 11577651_Re:Common sense, for the love of Pete....html | 2005-02-04 05:48   | 340  |   | 
![[TXT]](/icons/text.gif)  | 11534902_Re:What a frackin' idiot.html | 2005-01-31 07:07   | 288  |   | 
![[TXT]](/icons/text.gif)  | 11534877_Re:What a frackin' idiot.html | 2005-01-31 07:05   | 1.9K |   | 
![[TXT]](/icons/text.gif)  | 11534684_Re:Matrox?.html | 2005-01-31 06:48   | 346  |   | 
![[TXT]](/icons/text.gif)  | 11530297_Re:What a frackin' idiot.html | 2005-01-31 01:15   | 2.3K |   | 
![[TXT]](/icons/text.gif)  | 11530168_Re:Matrox?.html | 2005-01-31 01:04   | 327  |   | 
![[TXT]](/icons/text.gif)  | 11530134_Re:And another idiot.html | 2005-01-31 01:02   | 305  |   | 
![[TXT]](/icons/text.gif)  | 11516920_Re:In hardware?.html | 2005-01-29 08:10   | 148  |   | 
![[TXT]](/icons/text.gif)  | 11516578_Re:Ho-hum.html | 2005-01-29 07:09   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 11516518_Re:why *I* like the GPL ....html | 2005-01-29 07:01   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 11514588_Re:Ho-hum.html | 2005-01-29 01:49   | 420  |   | 
![[TXT]](/icons/text.gif)  | 11498748_Re:MOD PARENT UP!!!.html | 2005-01-22 07:13   | 200  |   | 
![[TXT]](/icons/text.gif)  | 11498536_Re:correlational!.html | 2005-01-23 06:52   | 248  |   | 
![[TXT]](/icons/text.gif)  | 11482868_Re:duh.html | 2005-01-25 01:42   | 227  |   | 
![[TXT]](/icons/text.gif)  | 11469482_Re:duh.html | 2005-01-25 11:42   | 203  |   | 
![[TXT]](/icons/text.gif)  | 11464566_Re:The bottom line.html | 2005-01-20 10:57   | 535  |   | 
![[TXT]](/icons/text.gif)  | 11435341_Re:I read the FA.html | 2005-01-17 03:23   | 353  |   | 
![[TXT]](/icons/text.gif)  | 11415655_Re:I read the FA.html | 2005-01-17 09:29   | 479  |   | 
![[TXT]](/icons/text.gif)  | 11405189_Re:Storage.html | 2005-01-16 12:18   | 176  |   | 
![[TXT]](/icons/text.gif)  | 11393023_Re:Off the top of my head, here you go.html | 2005-01-17 03:03   | 150  |   | 
![[TXT]](/icons/text.gif)  | 11383492_Re:Education no longer matters.html | 2005-01-15 02:26   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 11383465_Re:You should listen to him....html | 2005-01-14 02:16   | 407  |   | 
![[TXT]](/icons/text.gif)  | 11383399_Re:Storage.html | 2005-01-16 01:53   | 381  |   | 
![[TXT]](/icons/text.gif)  | 11383307_Re:Tux Racer.html | 2005-01-16 01:19   | 290  |   | 
![[TXT]](/icons/text.gif)  | 11381429_Re:You should listen to him....html | 2005-01-14 06:33   | 404  |   | 
![[TXT]](/icons/text.gif)  | 11381398_Re: What?.html | 2005-01-13 06:28   | 266  |   | 
![[TXT]](/icons/text.gif)  | 11379732_Re:You should listen to him....html | 2005-01-14 01:55   | 430  |   | 
![[TXT]](/icons/text.gif)  | 11377108_Re:Education no longer matters.html | 2005-01-15 11:14   | 595  |   | 
![[TXT]](/icons/text.gif)  | 11376923_Re:So useful for Windows OC'ers.html | 2005-01-15 10:30   | 181  |   | 
![[TXT]](/icons/text.gif)  | 11376901_Re:So useful for Windows OC'ers.html | 2005-01-15 10:21   | 615  |   | 
![[TXT]](/icons/text.gif)  | 11376883_Re:So useful for Windows OC'ers.html | 2005-01-15 10:17   | 208  |   | 
![[TXT]](/icons/text.gif)  | 11339222_Re:In other words.html | 2005-01-12 03:06   | 440  |   | 
![[TXT]](/icons/text.gif)  | 11339026_Re:Free as in beer.html | 2005-01-12 02:53   | 838  |   | 
![[TXT]](/icons/text.gif)  | 11332088_Re:Uhh....html | 2005-01-12 01:50   | 435  |   | 
![[TXT]](/icons/text.gif)  | 11332067_Re:and still no ATI AIW support.html | 2005-01-12 01:47   | 345  |   | 
![[TXT]](/icons/text.gif)  | 11331889_Re:competition is good, usually.html | 2005-01-11 01:22   | 421  |   | 
![[TXT]](/icons/text.gif)  | 11331797_Re:WMP-out.html | 2005-01-11 01:03   | 277  |   | 
![[TXT]](/icons/text.gif)  | 11330858_Re:Do we really need....html | 2005-01-11 10:45   | 332  |   | 
![[TXT]](/icons/text.gif)  | 11329218_Re:Sleep Apnea (OSA).html | 2005-01-11 07:55   | 323  |   | 
![[TXT]](/icons/text.gif)  | 11314109_Replace PAM.html | 2005-01-10 04:13   | 400  |   | 
![[TXT]](/icons/text.gif)  | 11314074_Re:Many Things.html | 2005-01-10 04:10   | 229  |   | 
![[TXT]](/icons/text.gif)  | 11314016_Re:same feeling with S-ATA.html | 2005-01-10 04:05   | 226  |   | 
![[TXT]](/icons/text.gif)  | 11313419_Re:Some of these predictions are -1 redundant.html | 2005-01-10 03:24   | 162  |   | 
![[TXT]](/icons/text.gif)  | 11313348_Re:What does this tell you about Stallman's crusad.html | 2005-01-10 03:18   | 331  |   | 
![[TXT]](/icons/text.gif)  | 11300337_Re: keep the politics out, please.....html | 2005-01-08 06:48   | 669  |   | 
![[TXT]](/icons/text.gif)  | 11300285_Re:They're stealing from ME....html | 2005-01-08 06:40   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 11241931_Re:ET runs well.html | 2005-01-02 11:41   | 256  |   | 
![[TXT]](/icons/text.gif)  | 11239472_Re:Spooks and cracks.html | 2005-01-01 03:07   | 203  |   | 
![[TXT]](/icons/text.gif)  | 11223726_copyright?.html | 2004-12-30 07:17   | 488  |   | 
![[TXT]](/icons/text.gif)  | 11206540_Re:The [Crimminal] is out of the bottle....html | 2004-12-28 12:22   | 514  |   | 
![[TXT]](/icons/text.gif)  | 11206523_Re:Anybody else find this disturbing?.html | 2004-12-28 12:18   | 524  |   | 
![[TXT]](/icons/text.gif)  | 11206117_Re:Intel Generations?.html | 2004-12-27 10:53   | 604  |   | 
![[TXT]](/icons/text.gif)  | 11198187_Re:886.html | 2004-12-27 05:24   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 11198154_Re:Respect to.html | 2004-12-27 05:11   | 509  |   | 
![[TXT]](/icons/text.gif)  | 11198144_Re:Intel Generations?.html | 2004-12-27 05:06   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 11196592_Re:Somehow not impressed?.html | 2004-12-27 09:39   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 11196428_Re:This quote sums it up.html | 2004-12-27 09:05   | 285  |   | 
![[TXT]](/icons/text.gif)  | 11196176_Re:This may not be that bad....html | 2004-12-27 08:23   | 361  |   | 
![[TXT]](/icons/text.gif)  | 11196120_Re:Don't fuck around w_your modem's MAC..html | 2004-12-27 08:12   | 608  |   | 
![[TXT]](/icons/text.gif)  | 11175561_Re:what about dual?.html | 2004-12-23 05:34   | 816  |   | 
![[TXT]](/icons/text.gif)  | 11154132_Re:Fun Facts Time!.html | 2004-12-21 06:57   | 183  |   | 
![[TXT]](/icons/text.gif)  | 11154015_Re:IE?.html | 2004-12-21 06:45   | 189  |   | 
![[TXT]](/icons/text.gif)  | 11141484_Re:I'm sorry for the LSB guys.html | 2004-12-20 05:46   | 466  |   | 
![[TXT]](/icons/text.gif)  | 11141427_Re:"linux standardization".html | 2004-12-20 05:41   | 492  |   | 
![[TXT]](/icons/text.gif)  | 11141367_Re:FreeBSD has it figured out.html | 2004-12-20 05:37   | 497  |   | 
![[TXT]](/icons/text.gif)  | 11141326_Re:Radio Edit....html | 2004-12-20 05:33   | 561  |   | 
![[TXT]](/icons/text.gif)  | 11134507_Re:I don't think so.html | 2004-12-14 10:18   | 348  |   | 
![[TXT]](/icons/text.gif)  | 11134135_Re:It's a major issue..html | 2004-12-18 09:16   | 307  |   | 
![[TXT]](/icons/text.gif)  | 11118447_Re:Hello it's me again.html | 2004-12-17 01:56   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 11118330_Re:Hello it's me again.html | 2004-12-17 01:47   | 211  |   | 
![[TXT]](/icons/text.gif)  | 11113988_Re:Device drivers.html | 2004-12-14 03:47   | 913  |   | 
![[TXT]](/icons/text.gif)  | 11113912_Re:The point?.html | 2004-12-15 03:20   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 11110583_Re:Advantage?.html | 2004-12-15 06:32   | 558  |   | 
![[TXT]](/icons/text.gif)  | 11110552_Re:Deja Voodoo.html | 2004-12-16 06:28   | 320  |   | 
![[TXT]](/icons/text.gif)  | 11100936_Re:MOD PARENT UP.html | 2004-12-14 12:19   | 500  |   | 
![[TXT]](/icons/text.gif)  | 11100919_Re:Device drivers.html | 2004-12-14 12:14   | 604  |   | 
![[TXT]](/icons/text.gif)  | 11099231_Re:it's easy to speed up boot.html | 2004-12-15 08:23   | 264  |   | 
![[TXT]](/icons/text.gif)  | 11096289_Re:it's easy to speed up boot.html | 2004-12-15 03:27   | 241  |   | 
![[TXT]](/icons/text.gif)  | 11096226_Re:Device drivers.html | 2004-12-14 03:22   | 656  |   | 
![[TXT]](/icons/text.gif)  | 11096173_Re:Device drivers.html | 2004-12-14 03:18   | 787  |   | 
![[TXT]](/icons/text.gif)  | 11096106_Re:Device drivers.html | 2004-12-14 03:13   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 11096030_Re:Platform or application?.html | 2004-12-14 03:07   | 919  |   | 
![[TXT]](/icons/text.gif)  | 11095941_.gnu TLD.html | 2004-12-15 03:00   | 232  |   | 
![[TXT]](/icons/text.gif)  | 11092573_Re:Cygwin RULES.html | 2004-12-15 10:39   | 538  |   | 
![[TXT]](/icons/text.gif)  | 11092431_Re:The point?.html | 2004-12-15 10:23   | 722  |   | 
![[TXT]](/icons/text.gif)  | 11089447_Re:ReactOS?.html | 2004-12-15 10:08   | 476  |   | 
![[TXT]](/icons/text.gif)  | 11089093_Re:VHDL + FPGA.html | 2004-12-14 09:16   | 252  |   | 
![[TXT]](/icons/text.gif)  | 11085741_Re:Who comes up with these ideas.html | 2004-12-14 04:31   | 304  |   | 
![[TXT]](/icons/text.gif)  | 11085692_Re:Too many opcodes?.html | 2004-12-14 04:28   | 787  |   | 
![[TXT]](/icons/text.gif)  | 11085216_Re:I don't think so.html | 2004-12-14 03:57   | 258  |   | 
![[TXT]](/icons/text.gif)  | 11085146_Let me be the first to say....html | 2004-12-14 03:53   | 123  |   | 
![[TXT]](/icons/text.gif)  | 11076837_Re:simplify the instruction set..html | 2004-12-13 06:04   | 854  |   | 
![[TXT]](/icons/text.gif)  | 11074627_Re:I miss SGI.html | 2004-12-13 02:24   | 322  |   | 
![[TXT]](/icons/text.gif)  | 11070557_Progress Quest.html | 2005-02-07 09:55   | 155  |   | 
![[TXT]](/icons/text.gif)  | 11069530_Re:I found the truth!.html | 2004-12-07 08:55   | 526  |   | 
![[TXT]](/icons/text.gif)  | 11069515_Re:I found the truth!.html | 2004-12-07 08:52   | 487  |   | 
![[TXT]](/icons/text.gif)  | 11068867_Re:Searching file content!.html | 2004-12-12 06:43   | 168  |   | 
![[TXT]](/icons/text.gif)  | 11068854_Re:Searching file content!.html | 2004-12-12 06:40   | 233  |   | 
![[TXT]](/icons/text.gif)  | 11068841_Re:for all the slocate guys.html | 2004-12-12 06:36   | 594  |   | 
![[TXT]](/icons/text.gif)  | 11026079_Re:Evolution.html | 2004-12-07 06:53   | 305  |   | 
![[TXT]](/icons/text.gif)  | 11026045_Re:I found the truth!.html | 2004-12-07 06:51   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 11023813_Re:Egalitarian? Who are.html | 2004-12-07 04:20   | 488  |   | 
![[TXT]](/icons/text.gif)  | 11020678_Re:that's not the goddamn point.html | 2004-12-06 12:58   | 556  |   | 
![[TXT]](/icons/text.gif)  | 11015397_Re:Timely topic, IMHO.....html | 2004-12-06 01:37   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 11009485_Re:NASA has little time (and money).html | 2004-12-06 02:10   | 385  |   | 
![[TXT]](/icons/text.gif)  | 11007524_Re:good opportunity to say.html | 2004-12-06 10:28   | 507  |   | 
![[TXT]](/icons/text.gif)  | 11005701_Re:MySQL sucks.html | 2004-12-02 01:03   | 519  |   | 
![[TXT]](/icons/text.gif)  | 10998333_Re:Dow-chem chairman Warren Anderson.html | 2004-12-03 05:50   | 330  |   | 
![[TXT]](/icons/text.gif)  | 10993889_Re:MySQL sucks.html | 2004-12-02 09:07   | 740  |   | 
![[TXT]](/icons/text.gif)  | 10992716_Re:Breaks Gentoo as a learning tool.html | 2004-11-30 06:23   | 736  |   | 
![[TXT]](/icons/text.gif)  | 10975694_Re:Real Window Managers.html | 2004-12-02 12:19   | 532  |   | 
![[TXT]](/icons/text.gif)  | 10960312_Re:I'm not sure how I feel about.html | 2004-11-27 11:32   | 354  |   | 
![[TXT]](/icons/text.gif)  | 10959697_Re:this will totally crush BSD.html | 2004-11-30 09:40   | 296  |   | 
![[TXT]](/icons/text.gif)  | 10959608_Re:don't know.html | 2004-11-30 09:23   | 750  |   | 
![[TXT]](/icons/text.gif)  | 10954572_Re:Breaks Gentoo as a learning tool.html | 2004-11-30 01:21   | 361  |   | 
![[TXT]](/icons/text.gif)  | 10947875_Re:in other words: why open source software's ille.html | 2004-11-29 06:25   | 405  |   | 
![[TXT]](/icons/text.gif)  | 10943746_Re:Whaa?.html | 2004-11-29 12:23   | 174  |   | 
![[TXT]](/icons/text.gif)  | 10938535_Re:Waste of time.html | 2004-11-28 03:32   | 225  |   | 
![[TXT]](/icons/text.gif)  | 10932777_Re:I'm not sure how I feel about this.html | 2004-11-27 03:34   | 397  |   | 
![[TXT]](/icons/text.gif)  | 10911287_Re:The Desktop.html | 2004-11-22 02:11   | 684  |   | 
![[TXT]](/icons/text.gif)  | 10911221_Re:Confused....html | 2004-11-22 02:05   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 10910809_Re:In other news....html | 2004-11-24 01:21   | 307  |   | 
![[TXT]](/icons/text.gif)  | 10903656_Re:Whoa - "perfectly"? I think not..html | 2004-11-23 05:07   | 436  |   | 
![[TXT]](/icons/text.gif)  | 10903626_Re:Please don't make them require root access..html | 2004-11-23 05:03   | 250  |   | 
![[TXT]](/icons/text.gif)  | 10900160_Re:Confused....html | 2004-11-22 12:49   | 554  |   | 
![[TXT]](/icons/text.gif)  | 10892746_Re:The Desktop.html | 2004-11-22 05:55   | 804  |   | 
![[TXT]](/icons/text.gif)  | 10892693_Re:My guess.html | 2004-11-17 05:48   | 268  |   | 
![[TXT]](/icons/text.gif)  | 10892675_Re:Interesting book but.html | 2004-11-17 05:45   | 179  |   | 
![[TXT]](/icons/text.gif)  | 10889371_Re:LAMP.html | 2004-11-22 12:28   | 591  |   | 
![[TXT]](/icons/text.gif)  | 10889254_Re:How to be an effective advocate.html | 2004-11-22 12:16   | 851  |   | 
![[TXT]](/icons/text.gif)  | 10889192_Re:As a consequence of purchasing intel.html | 2004-11-22 12:11   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 10889133_Talking out of both sides of their mouth.html | 2004-11-22 12:05   | 498  |   | 
![[TXT]](/icons/text.gif)  | 10889060_Re:Just to play devils advocate.html | 2004-11-22 11:59   | 440  |   | 
![[TXT]](/icons/text.gif)  | 10889007_Re:Threading on thin ice here.html | 2004-11-22 11:55   | 129  |   | 
![[TXT]](/icons/text.gif)  | 10888979_Re:Let's make everything free!.html | 2004-11-22 11:52   | 554  |   | 
![[TXT]](/icons/text.gif)  | 10873102_Re:Common knowledge?.html | 2004-11-16 02:12   | 205  |   | 
![[TXT]](/icons/text.gif)  | 10866061_Re:Or better yet....html | 2004-11-19 01:04   | 221  |   | 
![[TXT]](/icons/text.gif)  | 10850305_Re:dry joints.html | 2004-11-14 11:28   | 234  |   | 
![[TXT]](/icons/text.gif)  | 10835886_Medical practices and malpractices.html | 2004-11-16 04:54   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 10825575_Re:dry joints.html | 2004-11-14 07:36   | 212  |   | 
![[TXT]](/icons/text.gif)  | 10817813_Re:Piracy in China.html | 2004-11-11 01:17   | 687  |   | 
![[TXT]](/icons/text.gif)  | 10816294_not free software.html | 2004-11-14 08:01   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 10816212_Re:What's wrong with freezing a drive?.html | 2004-11-14 07:50   | 304  |   | 
![[TXT]](/icons/text.gif)  | 10802274_Re:No version 2?.html | 2004-11-12 04:34   | 318  |   | 
![[TXT]](/icons/text.gif)  | 10796187_Re:Piracy in China.html | 2004-11-11 03:21   | 711  |   | 
![[TXT]](/icons/text.gif)  | 10796178_Re:Pirating Old NES Games?.html | 2004-11-11 03:19   | 569  |   | 
![[TXT]](/icons/text.gif)  | 10777089_Re:I am the parent poster and I agree.html | 2004-11-10 10:50   | 726  |   | 
![[TXT]](/icons/text.gif)  | 10766836_Re:frist?.html | 2004-11-09 11:50   | 304  |   | 
![[TXT]](/icons/text.gif)  | 10761554_Re:Sure, blame C and C++.html | 2004-11-07 07:54   | 4.0K |   | 
![[TXT]](/icons/text.gif)  | 10761391_Re:Sometimes you gotta take a look around..html | 2004-11-07 07:33   | 308  |   | 
![[TXT]](/icons/text.gif)  | 10761368_Re:An anecdote and an opinion..html | 2004-11-08 07:31   | 700  |   | 
![[TXT]](/icons/text.gif)  | 10757719_Re:An anecdote and an opinion..html | 2004-11-08 02:48   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 10756120_Re:Blaming the language....html | 2004-11-07 12:36   | 758  |   | 
![[TXT]](/icons/text.gif)  | 10756033_Re:Sure, blame C and C++.html | 2004-11-07 12:29   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 10755870_Re:Sometimes you gotta take a look around..html | 2004-11-07 12:14   | 407  |   | 
![[TXT]](/icons/text.gif)  | 10747627_Re:Indeed - you're full of What If's....html | 2004-11-06 01:53   | 454  |   | 
![[TXT]](/icons/text.gif)  | 10712094_Re:Open Cores?.html | 2004-11-03 12:07   | 278  |   | 
![[TXT]](/icons/text.gif)  | 10688565_Re:Merkey's effect on Linux NTFS support.html | 2004-11-01 01:20   | 428  |   | 
![[TXT]](/icons/text.gif)  | 10650167_Re:Progress.html | 2004-10-27 11:12   | 220  |   | 
![[TXT]](/icons/text.gif)  | 10650101_Re:As I remember....html | 2004-10-27 11:00   | 889  |   | 
![[TXT]](/icons/text.gif)  | 10635916_De-allegizing existing cats?.html | 2004-10-26 05:14   | 416  |   | 
![[TXT]](/icons/text.gif)  | 10618652_Re:We knew this day would come.html | 2004-10-24 01:59   | 302  |   | 
![[TXT]](/icons/text.gif)  | 10602766_Re:This isn't about "hardship". It's about numbers.html | 2004-10-22 03:13   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 10595368_Re:Reality.html | 2004-10-19 11:53   | 182  |   | 
![[TXT]](/icons/text.gif)  | 10595266_Re:How about a Free Software Friendly Audio Card?.html | 2004-10-22 11:33   | 248  |   | 
![[TXT]](/icons/text.gif)  | 10595251_Re:Secrets.html | 2004-10-22 11:31   | 431  |   | 
![[TXT]](/icons/text.gif)  | 10572201_Re:What's so great about FreeBSD 5?.html | 2004-10-19 10:31   | 705  |   | 
![[TXT]](/icons/text.gif)  | 10572177_Re:What's so great about FreeBSD 5?.html | 2004-10-19 10:26   | 564  |   | 
![[TXT]](/icons/text.gif)  | 10572081_Re:Reality Distortion Fields ON!.html | 2004-10-19 10:10   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 10568077_Re:What's so great about FreeBSD 5?.html | 2004-10-19 02:08   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 10567986_Re:What's so great about FreeBSD 5?.html | 2004-10-19 02:01   | 966  |   | 
![[TXT]](/icons/text.gif)  | 10567848_Re:Reality Distortion Fields ON!.html | 2004-10-19 01:50   | 264  |   | 
![[TXT]](/icons/text.gif)  | 10566302_Re:Reality Distortion Fields ON!.html | 2004-10-19 11:22   | 285  |   | 
![[TXT]](/icons/text.gif)  | 10561125_Re:The best programmer of all time???.html | 2004-10-18 08:37   | 450  |   | 
![[TXT]](/icons/text.gif)  | 10556232_Re:What this love will consist of.html | 2004-10-18 09:56   | 497  |   | 
![[TXT]](/icons/text.gif)  | 10556211_Re:Sweet! Bring it on back =).html | 2004-10-18 09:53   | 279  |   | 
![[TXT]](/icons/text.gif)  | 10546216_Re:Best quotes.html | 2004-10-16 03:36   | 548  |   | 
![[TXT]](/icons/text.gif)  | 10540068_Re:Both Amiga and OS_2?.html | 2004-10-15 04:28   | 221  |   | 
![[TXT]](/icons/text.gif)  | 10516719_Re:Because we have a TWO PARTY SYSTEM.html | 2004-10-13 03:01   | 313  |   | 
![[TXT]](/icons/text.gif)  | 10507289_Re:CherryOS's speed claims, at least, are fraudule.html | 2004-10-12 03:52   | 351  |   | 
![[TXT]](/icons/text.gif)  | 10454694_Re:register_globals = off.html | 2004-10-05 05:05   | 198  |   | 
![[TXT]](/icons/text.gif)  | 10453815_Re:Exchange ?.html | 2004-10-06 03:21   | 182  |   | 
![[TXT]](/icons/text.gif)  | 10444645_Re:Why not use SDL?.html | 2004-10-05 04:19   | 301  |   | 
![[TXT]](/icons/text.gif)  | 10443964_Re:Biggest problem with Unix.html | 2004-10-05 03:23   | 430  |   | 
![[TXT]](/icons/text.gif)  | 10436901_Re:Needed... bad.html | 2004-10-05 12:26   | 224  |   | 
![[TXT]](/icons/text.gif)  | 10433969_Re:Chip Spec's would be better.html | 2004-10-04 04:40   | 501  |   | 
![[TXT]](/icons/text.gif)  | 10428701_Re:How is software really different?.html | 2004-10-03 09:27   | 249  |   | 
![[TXT]](/icons/text.gif)  | 10423336_Re:How is software really different?.html | 2004-10-03 07:39   | 489  |   | 
![[TXT]](/icons/text.gif)  | 10421452_Re:Guess who loses?.html | 2004-10-03 02:15   | 228  |   | 
![[TXT]](/icons/text.gif)  | 10421435_Re:So is alcohol-Nature Neutering..html | 2004-10-03 02:13   | 769  |   | 
![[TXT]](/icons/text.gif)  | 10421397_Re:So is alcohol.html | 2004-10-03 02:07   | 282  |   | 
![[TXT]](/icons/text.gif)  | 10421386_Re:The War on Drugs funds Terrorists.html | 2004-10-03 02:05   | 515  |   | 
![[TXT]](/icons/text.gif)  | 10414907_Re:Seems to me to be a bit... *duh*.html | 2004-10-02 02:34   | 543  |   | 
![[TXT]](/icons/text.gif)  | 10414419_Re:Seems to me to be a bit... *duh*.html | 2004-10-02 01:33   | 605  |   | 
![[TXT]](/icons/text.gif)  | 10406321_Re:what my party should be?.html | 2004-10-01 12:37   | 345  |   | 
![[TXT]](/icons/text.gif)  | 10397404_Does innovation suffer?.html | 2004-09-30 01:40   | 443  |   | 
![[TXT]](/icons/text.gif)  | 10390488_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 09:15   | 352  |   | 
![[TXT]](/icons/text.gif)  | 10386321_Re:What's wrong?.html | 2004-09-29 01:54   | 385  |   | 
![[TXT]](/icons/text.gif)  | 10380493_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:37   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 10380479_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:35   | 758  |   | 
![[TXT]](/icons/text.gif)  | 10380417_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 10:27   | 166  |   | 
![[TXT]](/icons/text.gif)  | 10377576_Re:Congrats, but be wary of monocultures....html | 2004-09-28 03:54   | 341  |   | 
![[TXT]](/icons/text.gif)  | 10370446_Re:18-35 #6 DRUG POLICY.html | 2004-09-28 12:06   | 168  |   | 
![[TXT]](/icons/text.gif)  | 10370000_Re:18-35 #7 DRUG POLICY.html | 2004-09-28 11:01   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 10369842_Re:18-35 #6 DRUG POLICY.html | 2004-09-28 10:44   | 363  |   | 
![[TXT]](/icons/text.gif)  | 10366586_Re:Why would this lure them away?.html | 2004-09-27 04:08   | 220  |   | 
![[TXT]](/icons/text.gif)  | 10342014_Re:Funny....html | 2004-09-21 12:45   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 10341918_Re:Funny....html | 2004-09-21 12:38   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 10341758_Re:Another view on OS_GPL.html | 2004-09-21 12:26   | 830  |   | 
![[TXT]](/icons/text.gif)  | 10341688_Re:"Derivative" is a legal term, not a technical t.html | 2004-09-21 12:22   | 594  |   | 
![[TXT]](/icons/text.gif)  | 10341634_Re:Dynamically linking OK?.html | 2004-09-21 12:18   | 870  |   | 
![[TXT]](/icons/text.gif)  | 10322853_Re:glut?.html | 2004-09-22 03:58   | 150  |   | 
![[TXT]](/icons/text.gif)  | 10321393_Re:glut?.html | 2004-09-22 01:58   | 203  |   | 
![[TXT]](/icons/text.gif)  | 10313188_Re:Darn....html | 2004-09-20 04:35   | 348  |   | 
![[TXT]](/icons/text.gif)  | 10302319_Re:Darn....html | 2004-09-20 05:16   | 257  |   | 
![[TXT]](/icons/text.gif)  | 10301580_Code.html | 2004-09-20 04:10   | 316  |   | 
![[TXT]](/icons/text.gif)  | 10277137_Re:MS stands behind its products?.html | 2004-09-17 10:58   | 259  |   | 
![[TXT]](/icons/text.gif)  | 10273179_Re:Somebody is busy ....html | 2004-09-16 08:07   | 342  |   | 
![[TXT]](/icons/text.gif)  | 10273165_Re:Yeah, I was worried too....html | 2004-09-16 08:05   | 241  |   | 
![[TXT]](/icons/text.gif)  | 10271988_Re:Answer2 - interesting reasoning....html | 2004-09-16 05:32   | 918  |   | 
![[TXT]](/icons/text.gif)  | 10269763_Re:Perhaps is the user base of those versions?.html | 2004-09-16 02:30   | 633  |   | 
![[TXT]](/icons/text.gif)  | 10269721_Re:Perhaps is the user base of those versions?.html | 2004-09-16 02:28   | 233  |   | 
![[TXT]](/icons/text.gif)  | 10251890_My mother doesn't think so.html | 2004-09-14 08:18   | 182  |   | 
![[TXT]](/icons/text.gif)  | 10251880_Re:fakechroot.html | 2004-09-13 08:15   | 169  |   | 
![[TXT]](/icons/text.gif)  | 10242342_Re:I want the opposite!.html | 2004-09-13 08:23   | 258  |   | 
![[TXT]](/icons/text.gif)  | 10242122_Re:I want the opposite!.html | 2004-09-13 07:49   | 269  |   | 
![[TXT]](/icons/text.gif)  | 10241713_Re:Regulation.html | 2004-09-13 07:02   | 240  |   | 
![[TXT]](/icons/text.gif)  | 10241663_Re:I want the opposite!.html | 2004-09-13 06:56   | 574  |   | 
![[TXT]](/icons/text.gif)  | 10241604_Re:How do we get there from here?.html | 2004-09-13 06:51   | 4.4K |   | 
![[TXT]](/icons/text.gif)  | 10240221_Re:No.html | 2004-09-13 04:40   | 759  |   | 
![[TXT]](/icons/text.gif)  | 10238445_Re:Regulation.html | 2004-09-13 01:53   | 498  |   | 
![[TXT]](/icons/text.gif)  | 10238413_Re:Mixed feelings about piracy.html | 2004-09-13 01:51   | 497  |   | 
![[TXT]](/icons/text.gif)  | 10238213_Re:Federal Regulators..html | 2004-09-13 01:34   | 341  |   | 
![[TXT]](/icons/text.gif)  | 10229764_Best solution.html | 2004-09-12 04:47   | 445  |   | 
![[TXT]](/icons/text.gif)  | 10223517_Re:To suggest this is almost criminally stupid.html | 2004-09-11 06:38   | 185  |   | 
![[TXT]](/icons/text.gif)  | 10222924_Re:Port the IE rendering engine.html | 2004-09-11 05:12   | 239  |   | 
![[TXT]](/icons/text.gif)  | 10222905_Re:Porting the whine...html | 2004-09-11 05:10   | 176  |   | 
![[TXT]](/icons/text.gif)  | 10193730_Penny Arcade said it best....html | 2004-09-08 03:03   | 371  |   | 
![[TXT]](/icons/text.gif)  | 10182584_Re:Patents and Copyright.html | 2004-09-07 04:50   | 423  |   | 
![[TXT]](/icons/text.gif)  | 10170601_Re:It's All Downhill.html | 2004-09-06 02:45   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 10164127_Re:My part to end this foolishness.html | 2004-09-05 03:37   | 241  |   | 
![[TXT]](/icons/text.gif)  | 10145809_Re:FUD?.html | 2004-09-02 10:07   | 512  |   | 
![[TXT]](/icons/text.gif)  | 10134195_Re:Other good Options.html | 2005-02-07 10:07   | 249  |   | 
![[TXT]](/icons/text.gif)  | 10123566_Hits from what?.html | 2004-08-31 05:55   | 283  |   | 
![[TXT]](/icons/text.gif)  | 10118945_Re:Let me ask everyone here....html | 2004-08-31 10:55   | 473  |   | 
![[TXT]](/icons/text.gif)  | 10112670_Re:Longhorn.html | 2004-08-30 05:01   | 237  |   | 
![[TXT]](/icons/text.gif)  | 10104007_heh.html | 2004-08-29 02:57   | 303  |   | 
![[TXT]](/icons/text.gif)  | 10084783_Re:ACPI.html | 2004-08-25 09:46   | 550  |   | 
![[TXT]](/icons/text.gif)  | 10074374_Re:ACPI.html | 2004-08-25 07:57   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 10072648_Re:My idea.html | 2004-08-25 04:36   | 732  |   | 
![[TXT]](/icons/text.gif)  | 10072588_Re:ACPI.html | 2004-08-25 04:28   | 2.3K |   | 
![[TXT]](/icons/text.gif)  | 10072440_Re:*raises hand*.html | 2004-08-25 04:12   | 2.8K |   | 
![[TXT]](/icons/text.gif)  | 10058013_Re:DirectX.html | 2004-08-24 12:02   | 299  |   | 
![[TXT]](/icons/text.gif)  | 10044134_Re:right direction.html | 2004-08-22 09:12   | 554  |   | 
![[TXT]](/icons/text.gif)  | 10036334_Re:first things first--.html | 2004-08-21 01:26   | 486  |   | 
![[TXT]](/icons/text.gif)  | 10003891_Re:Currect track record.html | 2004-08-17 12:56   | 522  |   | 
![[TXT]](/icons/text.gif)  | 9972636_Re:The answer (not 42 this time).html | 2004-08-14 01:56   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 9931480_Re:This is hilarious....html | 2004-08-10 12:39   | 866  |   | 
![[TXT]](/icons/text.gif)  | 9914523_Re:Screenshots.html | 2004-08-08 01:53   | 390  |   | 
![[TXT]](/icons/text.gif)  | 9914451_Re:Canary.html | 2004-08-05 01:42   | 136  |   | 
![[TXT]](/icons/text.gif)  | 9901235_Re:Bogus conclusions. This is the reason..html | 2004-08-05 01:24   | 950  |   | 
![[TXT]](/icons/text.gif)  | 9901151_Re:Bogus conclusions..html | 2004-08-05 01:18   | 441  |   | 
![[TXT]](/icons/text.gif)  | 9900019_Re:The biggest problem Linux currently has.html | 2004-08-05 11:34   | 376  |   | 
![[TXT]](/icons/text.gif)  | 9892745_Re:Sure.html | 2004-08-02 02:51   | 347  |   | 
![[TXT]](/icons/text.gif)  | 9891341_Re:Canary.html | 2004-08-05 01:08   | 259  |   | 
![[TXT]](/icons/text.gif)  | 9872094_Re:Debian....html | 2004-08-03 04:11   | 453  |   | 
![[TXT]](/icons/text.gif)  | 9865403_Re:Sure.html | 2004-08-02 05:40   | 302  |   | 
![[TXT]](/icons/text.gif)  | 9865353_Re:It's possible, I suppose..html | 2004-08-02 05:30   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 9854010_Re:Some thoughts....html | 2004-07-30 03:16   | 224  |   | 
![[TXT]](/icons/text.gif)  | 9853981_Re:I have done LD transfers.html | 2004-07-30 03:11   | 2.3K |   | 
![[TXT]](/icons/text.gif)  | 9846353_Re:gates is cool.html | 2004-07-30 01:24   | 2.0K |   | 
![[TXT]](/icons/text.gif)  | 9844207_Re:gates is cool.html | 2004-07-30 10:39   | 908  |   | 
![[TXT]](/icons/text.gif)  | 9839240_Re:Commodore still in business?.html | 2005-02-07 10:09   | 729  |   | 
![[TXT]](/icons/text.gif)  | 9837685_Re:Home Run.html | 2004-07-29 05:18   | 280  |   | 
![[TXT]](/icons/text.gif)  | 9825425_Re:Another solution in search of problem.html | 2004-07-28 04:08   | 443  |   | 
![[TXT]](/icons/text.gif)  | 9825378_Re:NFS4 is not supported in Windows.html | 2004-07-28 04:04   | 946  |   | 
![[TXT]](/icons/text.gif)  | 9825343_Re:Another solution in search of problem.html | 2004-07-28 04:01   | 2.5K |   | 
![[TXT]](/icons/text.gif)  | 9825119_Re:Another solution in search of problem.html | 2004-07-28 03:45   | 939  |   | 
![[TXT]](/icons/text.gif)  | 9822941_Re:Future source code release..html | 2004-07-28 12:46   | 238  |   | 
![[TXT]](/icons/text.gif)  | 9808425_Re:LOOK SCREEN.html | 2004-07-24 11:04   | 182  |   | 
![[TXT]](/icons/text.gif)  | 9804605_Re:Astroturfing or another troll ?.html | 2004-07-25 02:21   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 9804562_Re:Free Software.html | 2004-07-25 02:19   | 728  |   | 
![[TXT]](/icons/text.gif)  | 9798224_Re:Think Cigarettes company brand Crack....html | 2004-07-25 10:36   | 226  |   | 
![[TXT]](/icons/text.gif)  | 9798193_Re:A Clockwork Orange.html | 2004-07-25 10:30   | 296  |   | 
![[TXT]](/icons/text.gif)  | 9798177_Re:FYI.html | 2004-07-25 10:27   | 845  |   | 
![[TXT]](/icons/text.gif)  | 9796704_Just like circumcision.html | 2004-07-25 05:42   | 514  |   | 
![[TXT]](/icons/text.gif)  | 9792494_Re:The lesson of X11.....html | 2004-07-24 11:19   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 9789060_LOOK SCREEN.html | 2004-07-24 11:06   | 127  |   | 
![[TXT]](/icons/text.gif)  | 9787419_Re:maturation of the software industry.html | 2004-07-23 12:55   | 133  |   | 
![[TXT]](/icons/text.gif)  | 9783972_Re:I no longer care.html | 2004-07-23 04:09   | 591  |   | 
![[TXT]](/icons/text.gif)  | 9783934_Re:Don't vote Libertarian.html | 2004-07-23 04:05   | 164  |   | 
![[TXT]](/icons/text.gif)  | 9768920_Re:Steps Against DRM.html | 2004-07-22 08:17   | 1.9K |   | 
![[TXT]](/icons/text.gif)  | 9768873_Re:Link has little info about bios.html | 2004-07-22 08:09   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 9762836_Re:Attack of the Weak Analogies.html | 2004-07-21 02:41   | 380  |   | 
![[TXT]](/icons/text.gif)  | 9762805_Re:fair and balanced?.html | 2004-07-21 02:38   | 362  |   | 
![[TXT]](/icons/text.gif)  | 9762572_Re:That's beside the point.html | 2004-07-19 02:19   | 852  |   | 
![[TXT]](/icons/text.gif)  | 9762526_Re:That's beside the point.html | 2004-07-19 02:15   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 9762453_Re:Cheapest way to play Doom 3.html | 2004-07-20 02:10   | 939  |   | 
![[TXT]](/icons/text.gif)  | 9762371_Re:Cue the Flash-bashers....html | 2004-07-20 02:04   | 222  |   | 
![[TXT]](/icons/text.gif)  | 9755946_Re:Cue the Flash-bashers....html | 2004-07-20 09:24   | 251  |   | 
![[TXT]](/icons/text.gif)  | 9750094_Re:Holy God ....html | 2004-07-19 11:09   | 199  |   | 
![[TXT]](/icons/text.gif)  | 9750051_Re:That's beside the point.html | 2004-07-19 11:05   | 362  |   | 
![[TXT]](/icons/text.gif)  | 9749937_Re:Cheapest way to play.html | 2004-07-20 10:58   | 825  |   | 
![[TXT]](/icons/text.gif)  | 9749868_Re:Cheapest way to play Doom 3.html | 2004-07-20 10:52   | 372  |   | 
![[TXT]](/icons/text.gif)  | 9703849_Re:Probably still RH_Fedora....html | 2004-07-13 10:21   | 306  |   | 
![[TXT]](/icons/text.gif)  | 9692022_Re:Probably still RH_Fedora....html | 2004-07-13 06:36   | 241  |   | 
![[TXT]](/icons/text.gif)  | 9692002_Re:Probably still RH_Fedora....html | 2004-07-13 06:33   | 215  |   | 
![[TXT]](/icons/text.gif)  | 9685035_Re:Probably still RH_Fedora....html | 2004-07-13 08:01   | 160  |   | 
![[TXT]](/icons/text.gif)  | 9668652_Re:It's the hardware too!.html | 2004-07-11 03:27   | 475  |   | 
![[TXT]](/icons/text.gif)  | 9620948_Re:I will never shop Best Buy, and here is why....html | 2004-07-06 09:06   | 381  |   | 
![[TXT]](/icons/text.gif)  | 9612916_Re:Economics and politics and software.html | 2004-07-05 09:41   | 700  |   | 
![[TXT]](/icons/text.gif)  | 9602730_Re:like there is any chance this WON'T happen.html | 2004-07-03 06:47   | 286  |   | 
![[TXT]](/icons/text.gif)  | 9589654_Re:Uh okay.html | 2004-07-02 12:43   | 710  |   | 
![[TXT]](/icons/text.gif)  | 9447195_Re:User level virus.html | 2004-06-16 06:19   | 472  |   | 
![[TXT]](/icons/text.gif)  | 9440187_Re:Fighting a losing battle.html | 2004-06-15 05:47   | 643  |   | 
![[TXT]](/icons/text.gif)  | 9440161_Re:Kids.html | 2004-06-15 05:40   | 495  |   | 
![[TXT]](/icons/text.gif)  | 9406673_Re:80386 was more significant..html | 2004-06-12 10:08   | 679  |   | 
![[TXT]](/icons/text.gif)  | 9403108_Re:obligatory.html | 2004-06-08 05:59   | 241  |   | 
![[TXT]](/icons/text.gif)  | 9403088_Re:obligatory.html | 2004-06-08 05:56   | 189  |   | 
![[TXT]](/icons/text.gif)  | 9393769_Re:No posts thus far - an omen?.html | 2004-06-07 07:38   | 479  |   | 
![[TXT]](/icons/text.gif)  | 9393761_Re:No posts thus far - an omen?.html | 2004-06-07 07:36   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 9393460_Re:Easy to Find Out.html | 2004-06-10 06:44   | 374  |   | 
![[TXT]](/icons/text.gif)  | 9383890_Re:Using the.html | 2004-06-08 10:15   | 615  |   | 
![[TXT]](/icons/text.gif)  | 9383879_Re:Using the right tool for the job.html | 2004-06-08 10:11   | 2.0K |   | 
![[TXT]](/icons/text.gif)  | 9383776_Re:Using the right tool for the job.html | 2004-06-08 09:47   | 264  |   | 
![[TXT]](/icons/text.gif)  | 9383761_Re:Oh, the irony..html | 2004-06-08 09:44   | 329  |   | 
![[TXT]](/icons/text.gif)  | 9383748_Re:Using the right tool for the job.html | 2004-06-08 09:42   | 503  |   | 
![[TXT]](/icons/text.gif)  | 9383145_Re:Hmmm.html | 2004-06-09 07:29   | 382  |   | 
![[TXT]](/icons/text.gif)  | 9382767_Re:What else besides games?.html | 2004-06-09 06:29   | 204  |   | 
![[TXT]](/icons/text.gif)  | 9373310_Re:Using the right tool for the job.html | 2004-06-08 09:13   | 248  |   | 
![[TXT]](/icons/text.gif)  | 9373138_Re:Using the right tool for the job.html | 2004-06-08 08:47   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 9372996_Re:Wasn't it in Eclipse first?.html | 2004-06-08 08:30   | 657  |   | 
![[TXT]](/icons/text.gif)  | 9368312_Re:Did you read the story?.html | 2004-06-08 12:56   | 342  |   | 
![[TXT]](/icons/text.gif)  | 9368220_Re:Once again, I'll have to disagree with this..html | 2004-06-08 12:47   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 9368019_Re:What is going on with the BSD's.html | 2004-06-08 12:31   | 3.3K |   | 
![[TXT]](/icons/text.gif)  | 9363638_Re:Been said before, will be said again:.html | 2004-06-08 03:04   | 307  |   | 
![[TXT]](/icons/text.gif)  | 9354218_Re:Lets see you do that for hundreds of systems.html | 2004-06-06 10:58   | 542  |   | 
![[TXT]](/icons/text.gif)  | 9352549_Re:Replace it with a key labelled [help].html | 2004-06-05 04:27   | 565  |   | 
![[TXT]](/icons/text.gif)  | 9352397_Re:Lets see you do that for hundreds of systems.html | 2004-06-06 03:56   | 197  |   | 
![[TXT]](/icons/text.gif)  | 9348663_Re:Replace it with a key labelled [help].html | 2004-06-05 12:41   | 482  |   | 
![[TXT]](/icons/text.gif)  | 9348090_Re:Replace it with a key.html | 2004-06-05 09:47   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 9345876_Re:I've said this long ago....html | 2004-06-05 03:30   | 179  |   | 
![[TXT]](/icons/text.gif)  | 9341576_Re:How about....html | 2004-06-03 08:14   | 552  |   | 
![[TXT]](/icons/text.gif)  | 9341556_Re:Still got my BeBox..html | 2004-06-04 08:10   | 203  |   | 
![[TXT]](/icons/text.gif)  | 9337920_Re:Still got my BeBox..html | 2004-06-04 02:05   | 343  |   | 
![[TXT]](/icons/text.gif)  | 9332577_Re:I don't get it..html | 2004-06-02 12:53   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 9332562_Re:How about....html | 2004-06-03 12:42   | 219  |   | 
![[TXT]](/icons/text.gif)  | 9332430_Re:massively offtopic, but important.html | 2004-06-04 12:03   | 354  |   | 
![[TXT]](/icons/text.gif)  | 9327908_Re:How about....html | 2004-06-03 01:07   | 193  |   | 
![[TXT]](/icons/text.gif)  | 9322583_Re:For the *BSD nay sayers.html | 2004-05-27 12:02   | 3.3K |   | 
![[TXT]](/icons/text.gif)  | 9322502_Re:For the *BSD nay sayers.html | 2004-05-27 11:45   | 788  |   | 
![[TXT]](/icons/text.gif)  | 9322448_Re:What is free? Is your free the same as mine?.html | 2004-06-02 11:36   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 9321489_Re:I don't get it..html | 2004-06-02 08:31   | 2.3K |   | 
![[TXT]](/icons/text.gif)  | 9317041_Re:What is free? Is your free the same as mine?.html | 2004-06-02 12:54   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 9267963_Re:Probably will hit 1.0 a year after Duke Nukem.html | 2004-05-27 11:40   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 9267832_Re:For the *BSD nay sayers.html | 2004-05-27 11:31   | 3.5K |   | 
![[TXT]](/icons/text.gif)  | 9249994_Re:Like building a plane.html | 2004-05-25 12:36   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 9247658_Re:Like building a plane.html | 2004-05-25 09:44   | 742  |   | 
![[TXT]](/icons/text.gif)  | 9237014_Re:It's called a "control"....html | 2004-05-24 08:27   | 716  |   | 
![[TXT]](/icons/text.gif)  | 9236935_Re:FLAC?.html | 2004-05-24 08:18   | 372  |   | 
![[TXT]](/icons/text.gif)  | 9236446_Re:FLAC?.html | 2004-05-24 07:07   | 333  |   | 
![[TXT]](/icons/text.gif)  | 9225070_Re:web standards should ignore IE.html | 2004-05-22 11:16   | 835  |   | 
![[TXT]](/icons/text.gif)  | 9213207_Re:PF and ALTQ.html | 2004-05-17 04:45   | 333  |   | 
![[TXT]](/icons/text.gif)  | 9211943_Re:I really don't see.html | 2004-05-20 11:51   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 9211872_Re:Microsoft really pisses me off.html | 2004-05-19 11:36   | 320  |   | 
![[TXT]](/icons/text.gif)  | 9206135_Re:I really don't see.html | 2004-05-20 12:38   | 326  |   | 
![[TXT]](/icons/text.gif)  | 9202127_Re:Microsoft really pisses me off.html | 2004-05-19 02:53   | 526  |   | 
![[TXT]](/icons/text.gif)  | 9171289_Re:License.html | 2004-05-16 02:06   | 307  |   | 
![[TXT]](/icons/text.gif)  | 9113212_Re:Where are the English release notes?.html | 2004-05-10 09:23   | 737  |   | 
![[TXT]](/icons/text.gif)  | 9092025_Answer.html | 2004-05-08 02:02   | 245  |   | 
![[TXT]](/icons/text.gif)  | 9091640_Hah.html | 2004-05-07 11:44   | 316  |   | 
![[TXT]](/icons/text.gif)  | 9077336_Re:good book!.html | 2004-04-27 03:48   | 532  |   | 
![[TXT]](/icons/text.gif)  | 9031828_Re:Why open Java?.html | 2004-05-01 10:53   | 3.8K |   | 
![[TXT]](/icons/text.gif)  | 9003045_Re:Someone failed Sesame Street.html | 2004-04-28 07:35   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 9003004_Re:Well spoken..html | 2004-04-28 07:28   | 884  |   | 
![[TXT]](/icons/text.gif)  | 8992558_Re:Finally....html | 2004-04-28 09:27   | 154  |   | 
![[TXT]](/icons/text.gif)  | 8980710_Re:Interesting.html | 2004-04-26 12:42   | 259  |   | 
![[TXT]](/icons/text.gif)  | 8961161_Re:This is a very bad trend.html | 2004-04-24 04:33   | 231  |   | 
![[TXT]](/icons/text.gif)  | 8945545_Re:Free, but not automatic.html | 2004-04-22 07:48   | 412  |   | 
![[TXT]](/icons/text.gif)  | 8934603_Re:So...What's the point?.html | 2004-04-11 06:22   | 503  |   | 
![[TXT]](/icons/text.gif)  | 8934521_Re:GPL?.html | 2004-04-19 06:14   | 255  |   | 
![[TXT]](/icons/text.gif)  | 8912055_Re:Notice....html | 2004-04-19 08:33   | 210  |   | 
![[TXT]](/icons/text.gif)  | 8904539_Re:GPL?.html | 2004-04-19 10:14   | 2.4K |   | 
![[TXT]](/icons/text.gif)  | 8881197_Re:Sadly....html | 2004-04-16 10:15   | 368  |   | 
![[TXT]](/icons/text.gif)  | 8852701_Re:AFS doesn't work at my uni.html | 2004-04-12 03:50   | 458  |   | 
![[TXT]](/icons/text.gif)  | 8840806_Re:RMS Blathering.html | 2004-04-12 03:13   | 2.5K |   | 
![[TXT]](/icons/text.gif)  | 8837037_Re:Because I like PHP was: Um....html | 2004-04-07 08:46   | 713  |   | 
![[TXT]](/icons/text.gif)  | 8834641_Re:So...What's the point?.html | 2004-04-11 09:04   | 226  |   | 
![[TXT]](/icons/text.gif)  | 8829021_Re:Amen..html | 2004-03-30 12:51   | 3.5K |   | 
![[TXT]](/icons/text.gif)  | 8828951_Re:little kids?.html | 2004-03-31 12:31   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 8820743_Re:So what's it like in Taiwan?.html | 2004-04-09 04:55   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 8728566_Re:Terrible research.html | 2004-03-31 03:11   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8728397_Re:Backups are legit for some of us....html | 2004-03-31 03:00   | 249  |   | 
![[TXT]](/icons/text.gif)  | 8728349_Re:Go with your gut feeling.html | 2004-03-31 02:57   | 357  |   | 
![[TXT]](/icons/text.gif)  | 8728267_Re:little kids?.html | 2004-03-31 02:51   | 2.2K |   | 
![[TXT]](/icons/text.gif)  | 8718003_Re:Amen..html | 2004-03-30 03:15   | 485  |   | 
![[TXT]](/icons/text.gif)  | 8683695_Re:There were better GUIs.html | 2004-03-26 03:41   | 288  |   | 
![[TXT]](/icons/text.gif)  | 8680354_Re:Its a beautiful thing!.html | 2004-03-25 11:21   | 684  |   | 
![[TXT]](/icons/text.gif)  | 8665818_Re:microsoft abuses power.html | 2004-03-25 06:35   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 8665529_Re:But....html | 2004-03-25 04:50   | 813  |   | 
![[TXT]](/icons/text.gif)  | 8665116_Re:Free as in "get out of my face".html | 2004-03-24 02:21   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 8665058_Re:How can we fracture it?.html | 2004-03-25 02:04   | 607  |   | 
![[TXT]](/icons/text.gif)  | 8656320_Re:Free as in "get out of my face".html | 2004-03-24 10:31   | 2.5K |   | 
![[TXT]](/icons/text.gif)  | 8656097_Re:Free as in "get out of my face".html | 2004-03-24 10:13   | 558  |   | 
![[TXT]](/icons/text.gif)  | 8655898_Re:I hope.....html | 2004-03-24 09:55   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 8649207_Re:Abandonware.html | 2004-03-23 04:28   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8642386_NWFS.html | 2004-03-23 01:05   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8641889_Re:secure.html | 2004-03-22 11:36   | 715  |   | 
![[TXT]](/icons/text.gif)  | 8641757_Re:Xine? Mplayer?.html | 2004-03-22 11:13   | 736  |   | 
![[TXT]](/icons/text.gif)  | 8637369_Re:Xine? Mplayer?.html | 2004-03-22 03:14   | 812  |   | 
![[TXT]](/icons/text.gif)  | 8631986_Re:protecting from viruses.html | 2004-03-22 01:37   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 8624277_Re:Oh no.html | 2004-03-21 08:52   | 217  |   | 
![[TXT]](/icons/text.gif)  | 8623592_Re:Excellent!.html | 2004-03-20 07:01   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 8618279_Re:From the looks of their page.html | 2004-03-19 10:53   | 826  |   | 
![[TXT]](/icons/text.gif)  | 8603647_Re:Virus protection on the chip?.html | 2004-03-18 04:54   | 749  |   | 
![[TXT]](/icons/text.gif)  | 8595519_Re:Is it our right to restrict the use of our idea.html | 2004-03-17 11:14   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8563620_Re:Fear Uncle Sam.html | 2004-03-14 04:55   | 191  |   | 
![[TXT]](/icons/text.gif)  | 8560616_Re:True. XGItech is a co which did as much as poss.html | 2004-03-13 07:14   | 442  |   | 
![[TXT]](/icons/text.gif)  | 8526052_Re:This isn't like overclocking your hard drive....html | 2004-03-10 05:37   | 505  |   | 
![[TXT]](/icons/text.gif)  | 8524850_Re:Sometimes they do....html | 2004-03-10 03:57   | 324  |   | 
![[TXT]](/icons/text.gif)  | 8523146_Re:No No!.html | 2004-03-10 01:25   | 412  |   | 
![[TXT]](/icons/text.gif)  | 8522957_Re:Other ISPs start to do this?.html | 2004-03-10 01:12   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8507775_Re:Who actually pays?.html | 2004-03-09 03:05   | 248  |   | 
![[TXT]](/icons/text.gif)  | 8487715_Re:closed source != bad always.html | 2004-03-06 06:18   | 768  |   | 
![[TXT]](/icons/text.gif)  | 8466072_Re:How To Hire Delopers? Mandatory read..html | 2004-03-03 01:44   | 551  |   | 
![[TXT]](/icons/text.gif)  | 8460965_Re:IPR isnt a.html | 2004-03-01 02:32   | 395  |   | 
![[TXT]](/icons/text.gif)  | 8452646_Re:Gonna go buy.html | 2004-03-03 11:27   | 401  |   | 
![[TXT]](/icons/text.gif)  | 8442977_Re:Tell me -.html | 2004-02-19 01:53   | 406  |   | 
![[TXT]](/icons/text.gif)  | 8438350_Re:Are we turning into the Ferengi?.html | 2004-03-01 03:08   | 214  |   | 
![[TXT]](/icons/text.gif)  | 8437968_Re:bad for economy too.html | 2004-03-01 01:47   | 872  |   | 
![[TXT]](/icons/text.gif)  | 8435135_Re:Hello..html | 2004-03-01 07:03   | 327  |   | 
![[TXT]](/icons/text.gif)  | 8435114_Re:Hello..html | 2004-03-01 07:01   | 185  |   | 
![[TXT]](/icons/text.gif)  | 8435088_Re:Initrd tools?.html | 2004-03-01 06:57   | 902  |   | 
![[TXT]](/icons/text.gif)  | 8434650_Re:...and Clemens' reaction.html | 2004-03-01 06:03   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 8434460_Re:bad for economy too.html | 2004-03-01 05:44   | 843  |   | 
![[TXT]](/icons/text.gif)  | 8434300_Re:The major problem is.html | 2004-03-01 05:25   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 8434154_Re:So you want MORE coercion through force....html | 2004-03-01 05:05   | 315  |   | 
![[TXT]](/icons/text.gif)  | 8434117_Re:IPR isnt a problem in itself....html | 2004-03-01 05:00   | 949  |   | 
![[TXT]](/icons/text.gif)  | 8434005_Re:No kidding? People prefer free?.html | 2004-03-01 04:50   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8433906_Re:radical rethinking of IP?.html | 2004-03-01 04:41   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 8399400_Re:Criminal tools like "diff"?.html | 2004-02-26 01:09   | 259  |   | 
![[TXT]](/icons/text.gif)  | 8386893_Re:mount -o ro,loop dvdimg.iso _something_movietit.html | 2004-02-25 11:15   | 679  |   | 
![[TXT]](/icons/text.gif)  | 8381442_I'm all for this.html | 2004-02-24 09:23   | 317  |   | 
![[TXT]](/icons/text.gif)  | 8381099_Re:can x86-64 do big endian?.html | 2004-02-24 08:50   | 268  |   | 
![[TXT]](/icons/text.gif)  | 8375115_Re:GPL....html | 2004-02-24 12:39   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 8330523_Re:Who cares?.html | 2004-02-18 02:50   | 589  |   | 
![[TXT]](/icons/text.gif)  | 8330055_Re:Who cares?.html | 2004-02-18 02:25   | 548  |   | 
![[TXT]](/icons/text.gif)  | 8330006_Re:GPL.html | 2004-02-18 02:23   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 8329577_Re:I can't wait....html | 2004-02-19 01:59   | 398  |   | 
![[TXT]](/icons/text.gif)  | 8328999_Re:Hard drives and mainframe manufacturers.html | 2004-02-18 01:26   | 385  |   | 
![[TXT]](/icons/text.gif)  | 8328951_Re:And i thought it was normal...html | 2004-02-18 01:23   | 566  |   | 
![[TXT]](/icons/text.gif)  | 8328912_Re:Never a problem.html | 2004-02-18 01:20   | 555  |   | 
![[TXT]](/icons/text.gif)  | 8328839_Re:Institutional behaviour.html | 2004-02-18 01:16   | 688  |   | 
![[TXT]](/icons/text.gif)  | 8314942_Re:Correct use of "steal"!.html | 2004-02-18 08:41   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 8314769_Re:MAME cabinets.html | 2004-02-17 08:12   | 499  |   | 
![[TXT]](/icons/text.gif)  | 8291818_Re:Binary drivers are inevitable.html | 2004-02-15 02:19   | 498  |   | 
![[TXT]](/icons/text.gif)  | 8255858_Re:PC Demo?.html | 2004-02-11 01:13   | 319  |   | 
![[TXT]](/icons/text.gif)  | 8223395_Re:Open Source Software is one thing.html | 2004-02-08 01:46   | 528  |   | 
![[TXT]](/icons/text.gif)  | 8162572_Re:Anything NOT in Linux?.html | 2004-02-02 03:54   | 336  |   | 
![[TXT]](/icons/text.gif)  | 8161988_Re:Anything NOT in Linux?.html | 2004-02-02 03:11   | 228  |   | 
![[TXT]](/icons/text.gif)  | 8149389_Re:Linux in cache?.html | 2004-01-31 02:56   | 199  |   | 
![[TXT]](/icons/text.gif)  | 8149364_Re:Linux in cache?.html | 2004-01-31 02:51   | 280  |   | 
![[TXT]](/icons/text.gif)  | 8147797_Re:Linux in cache?.html | 2004-01-31 09:51   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 8139676_Re:nice.html | 2004-01-30 06:01   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 8096563_Re:Hmm.html | 2004-01-27 10:43   | 379  |   | 
![[TXT]](/icons/text.gif)  | 8092790_Re:And thus....html | 2004-01-26 04:37   | 640  |   | 
![[TXT]](/icons/text.gif)  | 8086325_Re:!opteron == no dual proc.html | 2004-01-26 03:32   | 670  |   | 
![[TXT]](/icons/text.gif)  | 8078484_Re:New MS BIOS source code leaked!.html | 2004-01-24 08:59   | 659  |   | 
![[TXT]](/icons/text.gif)  | 8071373_Re:Name issues.html | 2004-01-23 06:56   | 526  |   | 
![[TXT]](/icons/text.gif)  | 8050050_Re:Best Keyboard....html | 2004-01-21 07:06   | 806  |   | 
![[TXT]](/icons/text.gif)  | 7961978_Re:Weak? Not tested in court?.html | 2004-01-12 08:58   | 411  |   | 
![[TXT]](/icons/text.gif)  | 7822752_Re:Those Cobalt cubes were cute....html | 2003-12-28 02:24   | 199  |   | 
![[TXT]](/icons/text.gif)  | 7814905_Re:Linux Games.html | 2003-12-26 06:02   | 648  |   | 
![[TXT]](/icons/text.gif)  | 7808907_Re:Two options.html | 2003-12-25 02:11   | 433  |   | 
![[TXT]](/icons/text.gif)  | 7798258_Re:Good job NVIDIA.html | 2003-12-23 04:41   | 385  |   | 
![[TXT]](/icons/text.gif)  | 7704999_Re:On warnings.html | 2003-12-12 03:41   | 287  |   | 
![[TXT]](/icons/text.gif)  | 7642267_Re:AMD blows.html | 2003-12-05 04:10   | 339  |   | 
![[TXT]](/icons/text.gif)  | 7633150_Re:Integrity checks.html | 2003-12-04 04:44   | 479  |   | 
![[TXT]](/icons/text.gif)  | 7611705_Re:Who cares? It's still digital.html | 2003-12-02 03:39   | 611  |   | 
![[TXT]](/icons/text.gif)  | 7604596_Re:blah blah.html | 2003-12-01 07:18   | 232  |   | 
![[TXT]](/icons/text.gif)  | 7564695_Um.....html | 2003-11-25 08:45   | 328  |   | 
![[TXT]](/icons/text.gif)  | 7544254_Re:My first debian.html | 2003-11-23 06:40   | 307  |   | 
![[TXT]](/icons/text.gif)  | 7538237_Re:One cool thing in the roadmap....html | 2003-11-22 04:48   | 279  |   | 
![[TXT]](/icons/text.gif)  | 7524146_Re:I think....html | 2003-11-20 05:59   | 357  |   | 
![[TXT]](/icons/text.gif)  | 7449044_Re:Force change, not reform..html | 2003-11-11 06:24   | 404  |   | 
![[TXT]](/icons/text.gif)  | 7415831_Re:What isn't MS bundling into Longhorn?.html | 2003-11-06 08:28   | 537  |   | 
![[TXT]](/icons/text.gif)  | 7312656_Re:C64.html | 2003-10-26 03:06   | 361  |   | 
![[TXT]](/icons/text.gif)  | 7274625_Re:Unix administrators aren't mushrooms..html | 2003-10-21 03:23   | 474  |   | 
![[TXT]](/icons/text.gif)  | 7253145_Re:Very interesting comment about GNU libc.html | 2003-10-19 06:14   | 362  |   | 
![[TXT]](/icons/text.gif)  | 7223431_Re:Stallman declined to be interviewed ....html | 2003-10-15 03:44   | 486  |   | 
![[TXT]](/icons/text.gif)  | 7191312_Re:Wasn't there a similar case with some Linux syn.html | 2003-10-11 03:57   | 175  |   | 
![[TXT]](/icons/text.gif)  | 7166526_Re:What a stupid trend.html | 2003-10-08 04:51   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 7016045_Re:Telnet.html | 2003-09-21 01:38   | 714  |   | 
![[TXT]](/icons/text.gif)  | 6948267_Re:Your patent link is infringing.html | 2003-09-12 05:24   | 475  |   | 
![[TXT]](/icons/text.gif)  | 6896785_Mods on crack?.html | 2003-09-07 09:24   | 192  |   | 
![[TXT]](/icons/text.gif)  | 6817765_Re:Good idea.html | 2003-08-28 03:24   | 309  |   | 
![[TXT]](/icons/text.gif)  | 6817719_Re:yay (faker!).html | 2003-08-28 03:21   | 828  |   | 
![[TXT]](/icons/text.gif)  | 6783695_Re:Sound Mixing.....html | 2003-08-24 09:14   | 458  |   | 
![[TXT]](/icons/text.gif)  | 6778087_Re:Drivers.html | 2003-08-24 12:13   | 783  |   | 
![[TXT]](/icons/text.gif)  | 6712220_BSD.html | 2003-08-16 09:43   | 216  |   | 
![[TXT]](/icons/text.gif)  | 6672471_Re:Either way it's a good thing.html | 2003-08-11 11:19   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 6661659_Design case history: the Commodore 64.html | 2003-08-10 05:48   | 614  |   | 
![[TXT]](/icons/text.gif)  | 6661245_Re:Apple II graphics were different.html | 2003-08-10 04:26   | 323  |   | 
![[TXT]](/icons/text.gif)  | 6651937_Re:dreamcast, too.html | 2003-08-08 08:31   | 757  |   | 
![[TXT]](/icons/text.gif)  | 6651147_Re:Beginning to look Valid.html | 2003-08-08 06:27   | 896  |   | 
![[TXT]](/icons/text.gif)  | 6483651_Re:Can someone explain what these programs DO?.html | 2003-07-19 08:23   | 287  |   | 
![[TXT]](/icons/text.gif)  | 6468352_Re:The GPL is not viral..html | 2003-07-17 11:48   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 6429862_Re:IAWTP.html | 2003-07-13 04:36   | 866  |   | 
![[TXT]](/icons/text.gif)  | 6413027_Re:how wonderfully useless.html | 2003-07-11 02:05   | 850  |   | 
![[TXT]](/icons/text.gif)  | 6408021_Re:Make the darn drivers Open Source!.html | 2003-07-10 12:03   | 485  |   | 
![[TXT]](/icons/text.gif)  | 6388412_Re:README:.html | 2003-07-06 10:16   | 379  |   | 
![[TXT]](/icons/text.gif)  | 6386826_Re:They were lucky....html | 2003-07-02 05:50   | 385  |   | 
![[TXT]](/icons/text.gif)  | 6380713_Re:Not the full OS.html | 2003-07-06 10:27   | 802  |   | 
![[TXT]](/icons/text.gif)  | 6373190_Re:"Can Open Source save Tom's Hardware".html | 2003-07-05 02:13   | 804  |   | 
![[TXT]](/icons/text.gif)  | 6367395_Re:Waste of GNU, gains for MS.....html | 2003-07-04 10:39   | 765  |   | 
![[TXT]](/icons/text.gif)  | 6350444_Re:The M.html | 2003-07-02 11:11   | 407  |   | 
![[TXT]](/icons/text.gif)  | 6344667_Re:He is correct.html | 2003-07-01 06:30   | 356  |   | 
![[TXT]](/icons/text.gif)  | 6339350_Re:Good reference, but 'copyleft' isn't more 'free.html | 2003-07-01 10:18   | 435  |   | 
![[TXT]](/icons/text.gif)  | 6339295_Re:and if you act now.....html | 2003-07-01 10:11   | 346  |   | 
![[TXT]](/icons/text.gif)  | 6329313_Re:Installer.html | 2003-06-29 05:00   | 279  |   | 
![[TXT]](/icons/text.gif)  | 6329003_Re:The first person to mention.html | 2003-06-29 02:16   | 458  |   | 
![[TXT]](/icons/text.gif)  | 6322394_Re:Wasn't smart enough..html | 2003-06-28 08:03   | 523  |   | 
![[TXT]](/icons/text.gif)  | 6316296_Re:gnomemeeting? (warning - kinda long).html | 2003-06-27 07:46   | 320  |   | 
![[TXT]](/icons/text.gif)  | 6315976_Re:To Be Fair.html | 2003-06-27 06:57   | 393  |   | 
![[TXT]](/icons/text.gif)  | 6270317_Re:No new CDs.html | 2003-06-22 08:22   | 291  |   | 
![[TXT]](/icons/text.gif)  | 6270110_Re:The GPL: Intellectual Theft.html | 2003-06-22 07:35   | 2.4K |   | 
![[TXT]](/icons/text.gif)  | 6202085_Re:Mandate Free Software.html | 2003-06-14 08:46   | 694  |   | 
![[TXT]](/icons/text.gif)  | 6202069_Re:History?.html | 2003-06-14 08:41   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 6202038_Re:News Flash, Ayanami....html | 2003-06-14 08:34   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 6201267_Re:Mandatory defies the nature of open source.....html | 2003-06-14 05:16   | 885  |   | 
![[TXT]](/icons/text.gif)  | 6201251_Re:History?.html | 2003-06-14 05:10   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 6197576_Re:As if it will matter....html | 2003-06-13 12:16   | 515  |   | 
![[TXT]](/icons/text.gif)  | 6194140_Re:As if it will matter....html | 2003-06-13 02:52   | 540  |   | 
![[TXT]](/icons/text.gif)  | 6193215_Re:Phu-lease!.html | 2003-06-13 01:34   | 499  |   | 
![[TXT]](/icons/text.gif)  | 6179410_Re:Poorly applied logic.html | 2003-06-12 02:31   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 6178968_Dear lord.html | 2003-06-12 12:53   | 709  |   | 
![[TXT]](/icons/text.gif)  | 6172479_Re:No....html | 2003-06-04 11:40   | 784  |   | 
![[TXT]](/icons/text.gif)  | 6159126_Uh.html | 2003-06-10 03:25   | 602  |   | 
![[TXT]](/icons/text.gif)  | 6156739_Re:Speaking of FUD.html | 2003-06-06 06:59   | 140  |   | 
![[TXT]](/icons/text.gif)  | 6151514_Re:Speaking of FUD.html | 2003-06-06 11:43   | 513  |   | 
![[TXT]](/icons/text.gif)  | 6146546_Re:Only if they changed something....html | 2003-06-08 08:21   | 562  |   | 
![[TXT]](/icons/text.gif)  | 6144474_Re:Only if they changed something....html | 2003-06-08 01:50   | 675  |   | 
![[TXT]](/icons/text.gif)  | 6130969_Re:Law is not the.html | 2003-06-06 07:57   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 6130909_Re:I hate the Apple ][....html | 2003-06-06 07:40   | 769  |   | 
![[TXT]](/icons/text.gif)  | 6012837_Re:Touchy subject.html | 2003-05-20 09:50   | 395  |   | 
![[TXT]](/icons/text.gif)  | 5952341_Re:AFS good on linux, good luck on FreeBSD.html | 2003-05-13 01:05   | 733  |   | 
![[TXT]](/icons/text.gif)  | 5950103_AFS vs NFS.html | 2003-05-13 06:24   | 852  |   | 
![[TXT]](/icons/text.gif)  | 5925301_Re:I wish I knew where I could find the MS fonts.html | 2003-05-09 07:29   | 216  |   | 
![[TXT]](/icons/text.gif)  | 5925210_Re:I wish I.html | 2003-05-09 06:32   | 225  |   | 
![[TXT]](/icons/text.gif)  | 5908606_Re:Release date.html | 2003-05-07 03:15   | 323  |   | 
![[TXT]](/icons/text.gif)  | 5908601_Re:Release date.html | 2003-05-07 03:12   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 5883404_Re:How retarded.html | 2003-05-05 12:42   | 328  |   | 
![[TXT]](/icons/text.gif)  | 5878184_Re:GCC and glibc are the most important parts.html | 2003-05-03 08:49   | 383  |   | 
![[TXT]](/icons/text.gif)  | 5878172_Re:to be technically correct....html | 2003-05-03 08:46   | 539  |   | 
![[TXT]](/icons/text.gif)  | 5878159_Re:what a stupid flame..html | 2003-05-03 08:44   | 439  |   | 
![[TXT]](/icons/text.gif)  | 5858952_Re:SuSE 8.2 freezes.html | 2003-05-01 08:47   | 734  |   | 
![[TXT]](/icons/text.gif)  | 5858932_Re:Don't Bother.html | 2003-05-01 08:44   | 657  |   | 
![[TXT]](/icons/text.gif)  | 5858901_Re:Pronounciation.html | 2003-05-01 08:40   | 419  |   | 
![[TXT]](/icons/text.gif)  | 5858571_Re:What about the Audio Home Recording Act?.html | 2003-04-30 07:43   | 588  |   | 
![[TXT]](/icons/text.gif)  | 5853361_Re:Mandatory?.html | 2003-05-01 11:36   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 5853270_Re:Sigh....html | 2003-05-01 11:26   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 5851585_Re:Getting 0wn3d.html | 2003-05-01 07:33   | 773  |   | 
![[TXT]](/icons/text.gif)  | 5820900_Re:Activists vs. anti-spam crowd.html | 2003-04-27 04:29   | 483  |   | 
![[TXT]](/icons/text.gif)  | 5787443_Re:What about Transgaming.html | 2003-04-22 01:31   | 318  |   | 
![[TXT]](/icons/text.gif)  | 5787426_Re:Even though the other dude is sort of trolling.html | 2003-04-22 01:25   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 5786916_Re:Even though the other dude is sort of trolling.html | 2003-04-22 10:38   | 349  |   | 
![[TXT]](/icons/text.gif)  | 5786516_Re:For those having trouble playing it:.html | 2003-04-22 09:14   | 137  |   | 
![[TXT]](/icons/text.gif)  | 5767432_Re:....what the hell......html | 2003-04-18 11:36   | 272  |   | 
![[TXT]](/icons/text.gif)  | 5763634_Good Job Slashdot!.html | 2003-04-18 10:25   | 164  |   | 
![[TXT]](/icons/text.gif)  | 5733806_Re:So you are saying....html | 2003-04-14 12:43   | 510  |   | 
![[TXT]](/icons/text.gif)  | 5732155_Re:Can you say 'Ford Pinto'? I knew you could!.html | 2003-04-14 06:32   | 255  |   | 
![[TXT]](/icons/text.gif)  | 5732121_Re:So you are saying....html | 2003-04-14 06:28   | 662  |   | 
![[TXT]](/icons/text.gif)  | 5730521_Re:Can you say 'Ford Pinto'? I knew you could!.html | 2003-04-14 03:02   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 5714460_Re:I actually tried to check this out....html | 2003-04-11 08:08   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 5714426_Re:I actually tried to check this out....html | 2003-04-11 07:57   | 456  |   | 
![[TXT]](/icons/text.gif)  | 5712254_Re:I actually tried to check this out....html | 2003-04-11 01:39   | 637  |   | 
![[TXT]](/icons/text.gif)  | 5712124_Re:I actually tried to check this out....html | 2003-04-11 01:21   | 533  |   | 
![[TXT]](/icons/text.gif)  | 5707936_Re:Hmm....html | 2003-04-10 11:02   | 761  |   | 
![[TXT]](/icons/text.gif)  | 5705146_Re:Trust Big Brother!.html | 2003-04-09 03:42   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 5702875_Re:Not exactly news ....html | 2003-04-07 11:56   | 5.2K |   | 
![[TXT]](/icons/text.gif)  | 5694796_Re:Why the DMCA licks it....html | 2003-04-09 02:17   | 769  |   | 
![[TXT]](/icons/text.gif)  | 5692947_Re:Not exactly news ....html | 2003-04-07 09:15   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 5686045_Re:Not exactly news ....html | 2003-04-07 09:56   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 5681521_Re:Editors?.html | 2003-04-07 04:26   | 623  |   | 
![[TXT]](/icons/text.gif)  | 5681505_Re:Not exactly news ....html | 2003-04-07 04:23   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 5681398_Re:Getting the corporate word out.html | 2003-04-07 04:06   | 733  |   | 
![[TXT]](/icons/text.gif)  | 5592715_Re:XFree Obsolete?.html | 2003-03-21 01:42   | 656  |   | 
![[TXT]](/icons/text.gif)  | 5585550_Re:I fail to see what the big deal is....html | 2003-03-24 03:39   | 286  |   | 
![[TXT]](/icons/text.gif)  | 5571874_Re:XFree Obsolete?.html | 2003-03-21 09:50   | 426  |   | 
![[TXT]](/icons/text.gif)  | 5565457_Re:Inaccuracies.html | 2003-03-20 11:24   | 372  |   | 
![[TXT]](/icons/text.gif)  | 5543816_Re:Absolutely one step closer!.html | 2003-03-19 09:26   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 5527798_Re:no.html | 2003-03-16 04:51   | 631  |   | 
![[TXT]](/icons/text.gif)  | 5525581_Re:not gnu.html | 2003-03-16 06:48   | 184  |   | 
![[TXT]](/icons/text.gif)  | 5500475_Re:Two points...html | 2003-03-12 11:18   | 433  |   | 
![[TXT]](/icons/text.gif)  | 5482584_Re:Loud-mouthed weasel!.html | 2003-03-11 11:58   | 163  |   | 
![[TXT]](/icons/text.gif)  | 5479085_Re:Inovate.html | 2003-03-10 02:50   | 442  |   | 
![[TXT]](/icons/text.gif)  | 5414063_Re:The problems of GNOME.html | 2003-02-28 02:11   | 662  |   | 
![[TXT]](/icons/text.gif)  | 5334256_Re:attitude?.html | 2003-02-17 08:51   | 777  |   | 
![[TXT]](/icons/text.gif)  | 5329849_Re:attitude?.html | 2003-02-17 05:40   | 414  |   | 
![[TXT]](/icons/text.gif)  | 5329693_Re:elitism....html | 2003-02-18 05:26   | 220  |   | 
![[TXT]](/icons/text.gif)  | 5326818_Re:attitude?.html | 2003-02-17 12:19   | 628  |   | 
![[TXT]](/icons/text.gif)  | 5318836_Re:attitude?.html | 2003-02-17 09:09   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 5318235_Re:GNU's take on Licenses.html | 2003-02-07 05:30   | 361  |   | 
![[TXT]](/icons/text.gif)  | 5303748_Re:Wouldn't it be nice...?.html | 2003-02-14 01:27   | 402  |   | 
![[TXT]](/icons/text.gif)  | 5303721_Re:They go through the air!.html | 2003-02-14 01:24   | 780  |   | 
![[TXT]](/icons/text.gif)  | 5277342_Re:GNU's take on Licenses.html | 2003-02-07 12:56   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 5257357_Re:you're an.html | 2003-02-05 04:11   | 487  |   | 
![[TXT]](/icons/text.gif)  | 5257351_Re:GNU's take on Licenses.html | 2003-02-07 04:07   | 624  |   | 
![[TXT]](/icons/text.gif)  | 5252256_Re:GNU's take on Licenses.html | 2003-02-07 01:53   | 357  |   | 
![[TXT]](/icons/text.gif)  | 5234059_Re:And how do you flash a BIOS without a floppy?.html | 2003-02-05 03:35   | 276  |   | 
![[TXT]](/icons/text.gif)  | 5221324_Re:Free BSD Dying.html | 2003-02-03 02:49   | 242  |   | 
![[TXT]](/icons/text.gif)  | 5193565_Re:in case of slashdotting.html | 2003-01-31 09:56   | 211  |   | 
![[TXT]](/icons/text.gif)  | 5189782_Re:Self-installing programs are.html | 2003-01-30 12:08   | 545  |   | 
![[TXT]](/icons/text.gif)  | 5173359_Re:The wrongness is not that relevant.html | 2003-01-28 06:57   | 561  |   | 
![[TXT]](/icons/text.gif)  | 5159067_Re:But isnt it COOL to be anti-USA now?.html | 2003-01-25 06:52   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 5130183_Re:Anyone else see the note at the top of the patc.html | 2003-01-21 05:24   | 339  |   | 
![[TXT]](/icons/text.gif)  | 5112381_Re:And compromise compatibility with drivers, etc.html | 2003-01-19 04:57   | 261  |   | 
![[TXT]](/icons/text.gif)  | 5110264_Re:Repost.html | 2003-01-18 06:59   | 389  |   | 
![[TXT]](/icons/text.gif)  | 5109499_Re:Repost.html | 2003-01-18 04:49   | 303  |   | 
![[TXT]](/icons/text.gif)  | 5038148_Re:Oops, they did it again..html | 2003-01-06 01:07   | 814  |   | 
![[TXT]](/icons/text.gif)  | 5038107_Re:Don't buy one!.html | 2003-01-07 12:57   | 674  |   | 
![[TXT]](/icons/text.gif)  | 5034277_Re:On XBOX Emulation.html | 2003-01-07 01:48   | 530  |   | 
![[TXT]](/icons/text.gif)  | 5034259_Re:A quick analysis looking over it.html | 2003-01-07 01:46   | 139  |   | 
![[TXT]](/icons/text.gif)  | 5034180_Re:Don't buy one!.html | 2003-01-07 01:36   | 577  |   | 
![[TXT]](/icons/text.gif)  | 5027913_Re:Oops, they did it again..html | 2003-01-06 04:04   | 1.9K |   | 
![[TXT]](/icons/text.gif)  | 5021025_Re:Why do you care so much?.html | 2003-01-05 03:27   | 474  |   | 
![[TXT]](/icons/text.gif)  | 5017536_Re:Moral?.html | 2003-01-03 11:05   | 261  |   | 
![[TXT]](/icons/text.gif)  | 5017156_Re:Here's my stand.html | 2003-01-04 09:50   | 795  |   | 
![[TXT]](/icons/text.gif)  | 5017110_Re:Bolixed..html | 2003-01-04 09:42   | 301  |   | 
![[TXT]](/icons/text.gif)  | 5017040_Re:Okay who's with me?.html | 2003-01-04 09:25   | 227  |   | 
![[TXT]](/icons/text.gif)  | 5017008_Re:Note that Free != freedom.html | 2003-01-04 09:18   | 791  |   | 
![[TXT]](/icons/text.gif)  | 5016804_Re:It is not supposed to work that way.html | 2003-01-04 08:31   | 399  |   | 
![[TXT]](/icons/text.gif)  | 5004803_Re:Um..html | 2002-12-30 03:25   | 2.9K |   | 
![[TXT]](/icons/text.gif)  | 5004745_Re:Um..html | 2002-12-30 03:02   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 4991125_Re:Um..html | 2002-12-30 05:51   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 4991077_Re:Um..html | 2002-12-30 05:41   | 1.6K |   | 
![[TXT]](/icons/text.gif)  | 4988028_Re:really?.html | 2002-12-28 10:05   | 714  |   | 
![[TXT]](/icons/text.gif)  | 4987991_Re:Um..html | 2002-12-30 09:59   | 946  |   | 
![[TXT]](/icons/text.gif)  | 4987976_Re:Um..html | 2002-12-30 09:54   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 4987911_Re:Um..html | 2002-12-30 09:45   | 636  |   | 
![[TXT]](/icons/text.gif)  | 4983453_Um..html | 2002-12-30 03:18   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4983419_Re:Nitpick..html | 2002-12-30 03:12   | 239  |   | 
![[TXT]](/icons/text.gif)  | 4983345_Re:preach to the choir.html | 2002-12-30 03:01   | 235  |   | 
![[TXT]](/icons/text.gif)  | 4976125_Re:Not surprised.html | 2002-12-28 08:36   | 927  |   | 
![[TXT]](/icons/text.gif)  | 4965834_Re:Legislation isn't needed!.html | 2002-12-25 09:19   | 522  |   | 
![[TXT]](/icons/text.gif)  | 4965785_Re:Legislation isn't needed!.html | 2002-12-25 09:12   | 355  |   | 
![[TXT]](/icons/text.gif)  | 4959731_Re:Legislation isn't needed!.html | 2002-12-25 04:39   | 724  |   | 
![[TXT]](/icons/text.gif)  | 4959728_Re:Legislation isn't needed!.html | 2002-12-25 04:36   | 849  |   | 
![[TXT]](/icons/text.gif)  | 4956509_Re:More MS bashing for fark's sake?!.html | 2002-12-24 06:32   | 776  |   | 
![[TXT]](/icons/text.gif)  | 4956506_Re:More MS bashing for fark's sake?!.html | 2002-12-24 06:30   | 384  |   | 
![[TXT]](/icons/text.gif)  | 4955860_Re:One man's fragmentation is another's variety ..html | 2002-12-20 12:07   | 251  |   | 
![[TXT]](/icons/text.gif)  | 4955808_Re:Linux is great for server duties.html | 2002-12-20 11:46   | 815  |   | 
![[TXT]](/icons/text.gif)  | 4951179_Re:More MS bashing for fark's sake?!.html | 2002-12-24 07:06   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4951148_Re:That's ludicrous.html | 2002-12-23 06:53   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 4942492_Re:exploit?.html | 2002-12-22 09:13   | 181  |   | 
![[TXT]](/icons/text.gif)  | 4940309_Re:exploit?.html | 2002-12-22 10:21   | 239  |   | 
![[TXT]](/icons/text.gif)  | 4940245_exploit?.html | 2002-12-22 09:57   | 355  |   | 
![[TXT]](/icons/text.gif)  | 4940184_Re:Yes it could be grounds..html | 2002-12-19 09:34   | 747  |   | 
![[TXT]](/icons/text.gif)  | 4938961_Re:Anything would be faster....html | 2002-12-21 11:03   | 512  |   | 
![[TXT]](/icons/text.gif)  | 4934383_Re:It is an oxymoron.html | 2002-12-20 11:00   | 175  |   | 
![[TXT]](/icons/text.gif)  | 4927514_Re:Woops.html | 2002-12-19 09:31   | 529  |   | 
![[TXT]](/icons/text.gif)  | 4927468_Re:Great Statement, I hope Apple listens..html | 2002-12-19 09:17   | 695  |   | 
![[TXT]](/icons/text.gif)  | 4927417_Re:More FUD.html | 2002-12-19 09:03   | 762  |   | 
![[TXT]](/icons/text.gif)  | 4927401_Re:More FUD.html | 2002-12-19 08:58   | 594  |   | 
![[TXT]](/icons/text.gif)  | 4927246_Re:Why does this matter to _.-ers?.html | 2002-12-19 08:25   | 468  |   | 
![[TXT]](/icons/text.gif)  | 4926980_Re:Yes it could be.html | 2002-12-19 07:14   | 2.4K |   | 
![[TXT]](/icons/text.gif)  | 4911304_Re:Why boycotts are a risky business.html | 2002-12-17 06:00   | 672  |   | 
![[TXT]](/icons/text.gif)  | 4909387_Re:Is this news?.html | 2002-12-17 02:32   | 490  |   | 
![[TXT]](/icons/text.gif)  | 4909338_Re:in a word....html | 2002-12-17 02:26   | 755  |   | 
![[TXT]](/icons/text.gif)  | 4909288_Re:Great news? Or bad news?.html | 2002-12-17 02:22   | 682  |   | 
![[TXT]](/icons/text.gif)  | 4872756_Re:IN COMMUNIST CHINA.html | 2002-12-11 01:16   | 396  |   | 
![[TXT]](/icons/text.gif)  | 4870926_IN COMMUNIST CHINA.html | 2002-12-11 10:14   | 440  |   | 
![[TXT]](/icons/text.gif)  | 4867191_Re:Umbrella.html | 2002-12-11 07:54   | 947  |   | 
![[TXT]](/icons/text.gif)  | 4858377_Re:*Sigh*.html | 2002-12-10 05:58   | 403  |   | 
![[TXT]](/icons/text.gif)  | 4857726_Re:Good work..html | 2002-12-10 04:46   | 528  |   | 
![[TXT]](/icons/text.gif)  | 4857703_Re:*Sigh*.html | 2002-12-10 04:44   | 643  |   | 
![[TXT]](/icons/text.gif)  | 4855221_A free interview?.html | 2002-12-10 12:03   | 261  |   | 
![[TXT]](/icons/text.gif)  | 4854474_Re:Use your own advice.html | 2002-12-09 10:14   | 1.4K |   | 
![[TXT]](/icons/text.gif)  | 4846448_Re:Use your own advice.html | 2002-12-09 03:59   | 1.9K |   | 
![[TXT]](/icons/text.gif)  | 4845181_Re:Use your own advice.html | 2002-12-09 01:32   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 4844736_Re:Whatever.....html | 2002-12-09 12:27   | 864  |   | 
![[TXT]](/icons/text.gif)  | 4816831_Re:SCSI for workstations?.html | 2002-12-04 01:43   | 241  |   | 
![[TXT]](/icons/text.gif)  | 4796796_Re:heh.html | 2002-12-02 05:07   | 4.4K |   | 
![[TXT]](/icons/text.gif)  | 4796496_Water-cool your PC.....html | 2002-12-02 04:29   | 264  |   | 
![[TXT]](/icons/text.gif)  | 4796357_Re:heh.html | 2002-12-02 04:06   | 787  |   | 
![[TXT]](/icons/text.gif)  | 4792111_Re:Good intentions, but....html | 2002-12-01 05:28   | 280  |   | 
![[TXT]](/icons/text.gif)  | 4770712_Re:And while you're so hot about the movie....html | 2002-11-24 04:55   | 578  |   | 
![[TXT]](/icons/text.gif)  | 4761511_Re:Explorer?.html | 2002-11-25 03:08   | 425  |   | 
![[TXT]](/icons/text.gif)  | 4760986_Re:I hate it.html | 2002-11-25 02:21   | 271  |   | 
![[TXT]](/icons/text.gif)  | 4760939_Re:Windows and IE?.html | 2002-11-25 02:17   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4746398_Re:And while you're so hot about the movie....html | 2002-11-24 06:25   | 259  |   | 
![[TXT]](/icons/text.gif)  | 4740488_Re:Bill Cares?.html | 2002-11-23 07:01   | 224  |   | 
![[TXT]](/icons/text.gif)  | 4735132_Re:In all fairness to the switch ads.html | 2002-11-22 04:39   | 203  |   | 
![[TXT]](/icons/text.gif)  | 4734878_Re:Pot. Kettle. Black..html | 2002-11-22 04:13   | 577  |   | 
![[TXT]](/icons/text.gif)  | 4729494_Re:The Truth? You can't handle the truth.html | 2002-11-21 11:36   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 4729356_Re:Have they not seen Wierd Science.html | 2002-11-21 11:12   | 242  |   | 
![[TXT]](/icons/text.gif)  | 4729325_Re:Violating Service Contracts?.html | 2002-11-22 11:05   | 265  |   | 
![[TXT]](/icons/text.gif)  | 4726884_Re:Microsoft's contribution.html | 2002-11-21 05:33   | 217  |   | 
![[TXT]](/icons/text.gif)  | 4726855_Re:Besides.html | 2002-11-21 05:30   | 479  |   | 
![[TXT]](/icons/text.gif)  | 4726775_Re:Hah squared!.html | 2002-11-21 05:22   | 574  |   | 
![[TXT]](/icons/text.gif)  | 4726117_Re:Have they not seen Wierd Science.html | 2002-11-21 04:15   | 248  |   | 
![[TXT]](/icons/text.gif)  | 4725497_Re:Bingo!.html | 2002-11-21 03:06   | 746  |   | 
![[TXT]](/icons/text.gif)  | 4725470_Re:Riddle me this Hasie?.html | 2002-11-21 03:03   | 623  |   | 
![[TXT]](/icons/text.gif)  | 4725400_Re:The Truth? You can't handle the truth.html | 2002-11-21 02:55   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4725093_Re:that's why.html | 2002-11-21 02:22   | 924  |   | 
![[TXT]](/icons/text.gif)  | 4713979_Re:Their rules.html | 2002-11-19 03:57   | 658  |   | 
![[TXT]](/icons/text.gif)  | 4713335_Re:Wow.html | 2002-11-19 12:29   | 392  |   | 
![[TXT]](/icons/text.gif)  | 4713319_Re:Their rules.html | 2002-11-19 12:25   | 242  |   | 
![[TXT]](/icons/text.gif)  | 4708556_Re:Crazy World.html | 2002-11-18 01:39   | 751  |   | 
![[TXT]](/icons/text.gif)  | 4704824_Re:A little OT.html | 2002-11-18 06:05   | 645  |   | 
![[TXT]](/icons/text.gif)  | 4704309_Re:X has kept me away from Linux.html | 2002-11-13 02:37   | 1.7K |   | 
![[TXT]](/icons/text.gif)  | 4704260_Re:Someone explain this about BSD_Linux to me..html | 2002-11-19 02:14   | 683  |   | 
![[TXT]](/icons/text.gif)  | 4704247_Re:A little OT.html | 2002-11-18 02:09   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4703327_Re:Crazy World.html | 2002-11-18 10:09   | 349  |   | 
![[TXT]](/icons/text.gif)  | 4703262_Re:It runs Linux and plays DVDs?.html | 2002-11-18 09:52   | 643  |   | 
![[TXT]](/icons/text.gif)  | 4703150_Re:A little OT.html | 2002-11-18 09:23   | 768  |   | 
![[TXT]](/icons/text.gif)  | 4702992_Re:rebooting 4 or 5 times a week?.html | 2002-11-18 08:45   | 753  |   | 
![[TXT]](/icons/text.gif)  | 4702596_Re:X has kept me away from Linux.html | 2002-11-13 07:34   | 1.9K |   | 
![[TXT]](/icons/text.gif)  | 4688295_Re:You have to admit that this is hard.html | 2002-11-16 08:53   | 398  |   | 
![[TXT]](/icons/text.gif)  | 4688285_Re:Some useful RE links....html | 2002-11-16 08:49   | 276  |   | 
![[TXT]](/icons/text.gif)  | 4688256_um, mod up plz.html | 2002-11-16 08:41   | 182  |   | 
![[TXT]](/icons/text.gif)  | 4687916_Re:X has kept me away from Linux.html | 2002-11-13 07:24   | 461  |   | 
![[TXT]](/icons/text.gif)  | 4687907_Re:X has kept me away from Linux.html | 2002-11-13 07:22   | 378  |   | 
![[TXT]](/icons/text.gif)  | 4682882_Re:What keeps me on windows.html | 2002-11-13 09:20   | 161  |   | 
![[TXT]](/icons/text.gif)  | 4682781_Re:X has kept me away from Linux.html | 2002-11-13 09:04   | 538  |   | 
![[TXT]](/icons/text.gif)  | 4682706_Re:I'm a Lightwave dude....html | 2002-11-13 08:49   | 377  |   | 
![[TXT]](/icons/text.gif)  | 4682665_Re:I like the Windows community spirit.html | 2002-11-13 08:42   | 529  |   | 
![[TXT]](/icons/text.gif)  | 4678820_Re:How Sad.html | 2002-11-15 01:39   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 4678636_Re:DOS 6.2.html | 2002-11-14 01:19   | 192  |   | 
![[TXT]](/icons/text.gif)  | 4674848_Re:DOS 6.2.html | 2002-11-14 11:37   | 203  |   | 
![[TXT]](/icons/text.gif)  | 4674268_Re:EFF Endored Legislation?.html | 2002-11-13 09:32   | 409  |   | 
![[TXT]](/icons/text.gif)  | 4656671_Re:OpenGL 2.0.html | 2002-11-12 10:59   | 197  |   | 
![[TXT]](/icons/text.gif)  | 4656077_Re:OpenGL 2.0.html | 2002-11-12 09:04   | 252  |   | 
![[TXT]](/icons/text.gif)  | 4655356_Re:Welcome to System Administration 101.html | 2002-11-12 06:54   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 4654504_Re:Welcome to System Administration 101.html | 2002-11-12 05:09   | 1.2K |   | 
![[TXT]](/icons/text.gif)  | 4653189_Re:Welcome to System Administration 101.html | 2002-11-12 02:37   | 251  |   | 
![[TXT]](/icons/text.gif)  | 4653113_Re:Wrong Douche bags!.html | 2002-11-12 02:29   | 204  |   | 
![[TXT]](/icons/text.gif)  | 4653047_Re:what a business.html | 2002-11-12 02:22   | 107  |   | 
![[TXT]](/icons/text.gif)  | 4653016_Re:Security??.html | 2002-11-12 02:20   | 242  |   | 
![[TXT]](/icons/text.gif)  | 4652954_Re:Could work.html | 2002-11-12 02:15   | 329  |   | 
![[TXT]](/icons/text.gif)  | 4652859_Re:Fujitsu Drives - Bad for some time.html | 2002-11-12 02:05   | 338  |   | 
![[TXT]](/icons/text.gif)  | 4652812_Um.html | 2002-11-12 01:59   | 1.5K |   | 
![[TXT]](/icons/text.gif)  | 4648357_Re:This is important stuff!.html | 2002-11-11 11:08   | 861  |   | 
![[TXT]](/icons/text.gif)  | 4647345_Re:Phew.html | 2002-11-11 08:23   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 4647298_Re:Why Open Source Needs Microsoft.html | 2002-11-11 08:16   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 4631255_Re:Where to begin.html | 2002-11-07 02:26   | 4.6K |   | 
![[TXT]](/icons/text.gif)  | 4626895_Re:I use Dualhead in X.html | 2002-11-07 01:42   | 405  |   | 
![[TXT]](/icons/text.gif)  | 4626486_Re:Skinning == crap!.html | 2002-11-08 12:56   | 324  |   | 
![[TXT]](/icons/text.gif)  | 4623528_Re:new FS....html | 2002-11-07 01:43   | 883  |   | 
![[TXT]](/icons/text.gif)  | 4623520_Re:Where to begin.html | 2002-11-07 01:40   | 3.7K |   | 
![[TXT]](/icons/text.gif)  | 4618400_Re:Where to begin.html | 2002-11-07 01:45   | 573  |   | 
![[TXT]](/icons/text.gif)  | 4618361_Re:new FS....html | 2002-11-07 01:40   | 652  |   | 
![[TXT]](/icons/text.gif)  | 4618298_Re:Missing a point.html | 2002-11-07 01:33   | 284  |   | 
![[TXT]](/icons/text.gif)  | 4611787_Re:Are you kidding?.html | 2002-11-06 04:47   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 4605080_Re:Transmeta needs to give up.html | 2002-11-05 10:32   | 240  |   | 
![[TXT]](/icons/text.gif)  | 4600870_MOD UP..html | 2002-11-05 02:09   | 198  |   | 
![[TXT]](/icons/text.gif)  | 4600776_Re:Protect?.html | 2002-11-05 02:00   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 4600713_Re:Distribution Method.html | 2002-11-05 01:51   | 345  |   | 
![[TXT]](/icons/text.gif)  | 4600694_Re:What are they trying to protect?.html | 2002-11-05 01:48   | 957  |   | 
![[TXT]](/icons/text.gif)  | 4599771_Re:PDF = open format, won't go away.html | 2002-11-04 11:10   | 265  |   | 
![[TXT]](/icons/text.gif)  | 4599751_Re:Stock took a hit?.html | 2002-11-04 11:07   | 741  |   | 
![[TXT]](/icons/text.gif)  | 4599595_Re:Not a big deal for Microsoft.html | 2002-11-05 10:43   | 430  |   | 
![[TXT]](/icons/text.gif)  | 4590326_Re:Vint Cerf says Gore was 'instrumental' too..html | 2002-11-01 04:47   | 168  |   | 
![[TXT]](/icons/text.gif)  | 4589623_Re:Am I the only one.html | 2002-11-03 02:51   | 717  |   | 
![[TXT]](/icons/text.gif)  | 4576577_Re:pet peeve, don't call us, we'll call you.html | 2002-10-31 12:28   | 244  |   | 
![[TXT]](/icons/text.gif)  | 4575026_Re:pet peeve, don't call us, we'll call you.html | 2002-10-31 06:30   | 453  |   | 
![[TXT]](/icons/text.gif)  | 4565089_Re:Migrate.html | 2002-10-30 11:46   | 191  |   | 
![[TXT]](/icons/text.gif)  | 4558148_Re:(OT) x86.html | 2002-10-29 02:51   | 778  |   | 
![[TXT]](/icons/text.gif)  | 4557889_Re:And all of you running PPC or Alpha Linux.html | 2002-10-29 02:21   | 323  |   | 
![[TXT]](/icons/text.gif)  | 4555296_Re:PDF format freer than Word?.html | 2002-10-29 09:13   | 572  |   | 
![[TXT]](/icons/text.gif)  | 4555244_Re:Commodore One.html | 2002-10-28 09:05   | 200  |   | 
![[TXT]](/icons/text.gif)  | 4555188_Re:Better sooner than later.html | 2002-10-28 08:55   | 392  |   | 
![[TXT]](/icons/text.gif)  | 4555144_Re:Commodore 64 drives?.html | 2002-10-28 08:49   | 378  |   | 
![[TXT]](/icons/text.gif)  | 4555129_Re:Apple ][ Forever !.html | 2002-10-28 08:46   | 271  |   | 
![[TXT]](/icons/text.gif)  | 4555092_Re:Grass Roots Movement.html | 2002-10-28 08:38   | 336  |   | 
![[TXT]](/icons/text.gif)  | 4550747_Re:NFS server performance.html | 2002-10-28 03:54   | 164  |   | 
![[TXT]](/icons/text.gif)  | 4543611_Re:how long...html | 2002-10-27 05:40   | 503  |   | 
![[TXT]](/icons/text.gif)  | 4543536_Re:Contributions should be illegal.html | 2002-10-27 05:22   | 401  |   | 
![[TXT]](/icons/text.gif)  | 4538058_Re:Another troll article!.html | 2002-10-26 03:34   | 293  |   | 
![[TXT]](/icons/text.gif)  | 4524006_Re:It's not just individuals....html | 2002-10-24 01:32   | 1.0K |   | 
![[TXT]](/icons/text.gif)  | 4523897_Re:a worse example.html | 2002-10-24 01:18   | 366  |   | 
![[TXT]](/icons/text.gif)  | 4520003_Re:too bad that.html | 2002-10-23 02:30   | 570  |   | 
![[TXT]](/icons/text.gif)  | 4519988_Re:Argh..html | 2002-10-23 02:27   | 375  |   | 
![[TXT]](/icons/text.gif)  | 4508969_Re:Paypal, CDNow, tons of examples come to mind.html | 2002-10-22 06:53   | 3.7K |   | 
![[TXT]](/icons/text.gif)  | 4502996_Re:rejection ?.html | 2002-10-22 06:58   | 262  |   | 
![[TXT]](/icons/text.gif)  | 4501389_Re:Why SCSI?.html | 2002-10-21 10:07   | 156  |   | 
![[TXT]](/icons/text.gif)  | 4500477_Re:Why SCSI?.html | 2002-10-21 07:13   | 1.1K |   | 
![[TXT]](/icons/text.gif)  | 4500405_Re:Why SCSI?.html | 2002-10-21 07:04   | 378  |   | 
![[TXT]](/icons/text.gif)  | 4498949_Re:Protection..html | 2002-10-21 03:55   | 672  |   | 
![[TXT]](/icons/text.gif)  | 4497245_Btw.html | 2002-10-21 12:49   | 462  |   | 
![[TXT]](/icons/text.gif)  | 4497149_Re:I like.html | 2002-10-21 12:41   | 958  |   | 
![[TXT]](/icons/text.gif)  | 4497098_Re:Why SCSI?.html | 2002-10-21 12:36   | 3.0K |   | 
![[TXT]](/icons/text.gif)  | 4496838_Re:FSP.html | 2002-10-21 12:13   | 935  |   | 
![[TXT]](/icons/text.gif)  | 4496767_Re:I like this idea....html | 2002-10-21 12:08   | 1.3K |   | 
![[TXT]](/icons/text.gif)  | 4496656_Re:Protection..html | 2002-10-21 12:01   | 622  |   | 
![[TXT]](/icons/text.gif)  | 4495890_Re:Not Version Bloat..html | 2002-10-21 10:44   | 240  |   | 
![[TXT]](/icons/text.gif)  | 4494956_Re:Why SCSI?.html | 2002-10-21 09:04   | 2.2K |   | 
![[TXT]](/icons/text.gif)  | 4494829_Re:SCSI.html | 2002-10-21 08:46   | 381  |   | 
![[TXT]](/icons/text.gif)  | 4474554_Re:The ACLU Sucks!.html | 2002-10-17 06:48   | 402  |   | 
![[TXT]](/icons/text.gif)  | 4474374_Re:Does anyone here actually understand TCP_IP?.html | 2002-10-17 06:18   | 676  |   | 
![[TXT]](/icons/text.gif)  | 4471069_Re:IDE vs. SCSI Warranty.html | 2002-10-17 12:55   | 920  |   | 
![[TXT]](/icons/text.gif)  | 4468599_Re:The ACLU Sucks!.html | 2002-10-17 08:31   | 269  |   | 
![[TXT]](/icons/text.gif)  | 4466016_Re:Illegal?.html | 2002-10-16 08:00   | 332  |   | 
![[TXT]](/icons/text.gif)  | 4458292_Re:What's in it for consumers?.html | 2002-10-15 08:23   | 403  |   | 
![[TXT]](/icons/text.gif)  | 4457289_Re:Documentation.html | 2002-10-15 05:45   | 197  |   | 
![[TXT]](/icons/text.gif)  | 4454895_Re:Bullshit technology.html | 2002-10-15 12:58   | 262  |   | 
![[TXT]](/icons/text.gif)  | 4454868_Here we go again....html | 2002-10-15 12:55   | 374  |   | 
![[TXT]](/icons/text.gif)  | 4454681_Re:Nintendo too?.html | 2002-10-15 12:36   | 637  |   | 
![[TXT]](/icons/text.gif)  | 4442823_Re:Everyone will still see it as slow.html | 2002-10-13 07:59   | 629  |   | 
![[TXT]](/icons/text.gif)  | 4438468_Re:WINE.html | 2002-10-12 05:39   | 249  |   | 
![[TXT]](/icons/text.gif)  | 4399805_Re:Why don't they use standard CVS?.html | 2002-10-06 08:57   | 482  |   | 
![[TXT]](/icons/text.gif)  | 4395821_Re:Crock.html | 2002-10-04 12:34   | 1.8K |   | 
![[TXT]](/icons/text.gif)  | 4390441_Re:Funny.html | 2002-10-04 05:10   | 212  |   | 
![[TXT]](/icons/text.gif)  | 4389849_Re:Historical perspective..html | 2002-10-04 03:53   | 199  |   | 
![[TXT]](/icons/text.gif)  | 4389827_Re:Historical perspective..html | 2002-10-04 03:51   | 2.1K |   | 
![[TXT]](/icons/text.gif)  | 4389581_Re:Crock of shit.html | 2002-10-04 03:26   | 442  |   | 
![[TXT]](/icons/text.gif)  | 4389560_Re:Sigh..html | 2002-10-04 03:22   | 257  |   | 
![[TXT]](/icons/text.gif)  | 4389528_Re:Historical perspective..html | 2002-10-04 03:18   | 2.3K |   | 
![[TXT]](/icons/text.gif)  | 4389441_Re:Sigh..html | 2002-10-04 03:04   | 728  |   | 
   
  |